a9e56f4f36
BUG=chromium:716032 Review-Url: https://codereview.chromium.org/2890603007 Cr-Commit-Position: refs/heads/master@{#45400}
10115 lines
325 KiB
C++
10115 lines
325 KiB
C++
// Copyright 2012 the V8 project authors. All rights reserved.
|
|
// Use of this source code is governed by a BSD-style license that can be
|
|
// found in the LICENSE file.
|
|
|
|
/** \mainpage V8 API Reference Guide
|
|
*
|
|
* V8 is Google's open source JavaScript engine.
|
|
*
|
|
* This set of documents provides reference material generated from the
|
|
* V8 header file, include/v8.h.
|
|
*
|
|
* For other documentation see http://code.google.com/apis/v8/
|
|
*/
|
|
|
|
#ifndef INCLUDE_V8_H_
|
|
#define INCLUDE_V8_H_
|
|
|
|
#include <stddef.h>
|
|
#include <stdint.h>
|
|
#include <stdio.h>
|
|
#include <memory>
|
|
#include <utility>
|
|
#include <vector>
|
|
|
|
#include "v8-version.h" // NOLINT(build/include)
|
|
#include "v8config.h" // NOLINT(build/include)
|
|
|
|
// We reserve the V8_* prefix for macros defined in V8 public API and
|
|
// assume there are no name conflicts with the embedder's code.
|
|
|
|
#ifdef V8_OS_WIN
|
|
|
|
// Setup for Windows DLL export/import. When building the V8 DLL the
|
|
// BUILDING_V8_SHARED needs to be defined. When building a program which uses
|
|
// the V8 DLL USING_V8_SHARED needs to be defined. When either building the V8
|
|
// static library or building a program which uses the V8 static library neither
|
|
// BUILDING_V8_SHARED nor USING_V8_SHARED should be defined.
|
|
#ifdef BUILDING_V8_SHARED
|
|
# define V8_EXPORT __declspec(dllexport)
|
|
#elif USING_V8_SHARED
|
|
# define V8_EXPORT __declspec(dllimport)
|
|
#else
|
|
# define V8_EXPORT
|
|
#endif // BUILDING_V8_SHARED
|
|
|
|
#else // V8_OS_WIN
|
|
|
|
// Setup for Linux shared library export.
|
|
#if V8_HAS_ATTRIBUTE_VISIBILITY
|
|
# ifdef BUILDING_V8_SHARED
|
|
# define V8_EXPORT __attribute__ ((visibility("default")))
|
|
# else
|
|
# define V8_EXPORT
|
|
# endif
|
|
#else
|
|
# define V8_EXPORT
|
|
#endif
|
|
|
|
#endif // V8_OS_WIN
|
|
|
|
/**
|
|
* The v8 JavaScript engine.
|
|
*/
|
|
namespace v8 {
|
|
|
|
class AccessorSignature;
|
|
class Array;
|
|
class ArrayBuffer;
|
|
class Boolean;
|
|
class BooleanObject;
|
|
class Context;
|
|
class CpuProfiler;
|
|
class Data;
|
|
class Date;
|
|
class External;
|
|
class Function;
|
|
class FunctionTemplate;
|
|
class HeapProfiler;
|
|
class ImplementationUtilities;
|
|
class Int32;
|
|
class Integer;
|
|
class Isolate;
|
|
template <class T>
|
|
class Maybe;
|
|
class Name;
|
|
class Number;
|
|
class NumberObject;
|
|
class Object;
|
|
class ObjectOperationDescriptor;
|
|
class ObjectTemplate;
|
|
class Platform;
|
|
class Primitive;
|
|
class Promise;
|
|
class PropertyDescriptor;
|
|
class Proxy;
|
|
class RawOperationDescriptor;
|
|
class Script;
|
|
class SharedArrayBuffer;
|
|
class Signature;
|
|
class StartupData;
|
|
class StackFrame;
|
|
class StackTrace;
|
|
class String;
|
|
class StringObject;
|
|
class Symbol;
|
|
class SymbolObject;
|
|
class Private;
|
|
class Uint32;
|
|
class Utils;
|
|
class Value;
|
|
class WasmCompiledModule;
|
|
template <class T> class Local;
|
|
template <class T>
|
|
class MaybeLocal;
|
|
template <class T> class Eternal;
|
|
template<class T> class NonCopyablePersistentTraits;
|
|
template<class T> class PersistentBase;
|
|
template <class T, class M = NonCopyablePersistentTraits<T> >
|
|
class Persistent;
|
|
template <class T>
|
|
class Global;
|
|
template<class K, class V, class T> class PersistentValueMap;
|
|
template <class K, class V, class T>
|
|
class PersistentValueMapBase;
|
|
template <class K, class V, class T>
|
|
class GlobalValueMap;
|
|
template<class V, class T> class PersistentValueVector;
|
|
template<class T, class P> class WeakCallbackObject;
|
|
class FunctionTemplate;
|
|
class ObjectTemplate;
|
|
template<typename T> class FunctionCallbackInfo;
|
|
template<typename T> class PropertyCallbackInfo;
|
|
class StackTrace;
|
|
class StackFrame;
|
|
class Isolate;
|
|
class CallHandlerHelper;
|
|
class EscapableHandleScope;
|
|
template<typename T> class ReturnValue;
|
|
|
|
namespace internal {
|
|
class Arguments;
|
|
class Heap;
|
|
class HeapObject;
|
|
class Isolate;
|
|
class Object;
|
|
struct StreamedSource;
|
|
template<typename T> class CustomArguments;
|
|
class PropertyCallbackArguments;
|
|
class FunctionCallbackArguments;
|
|
class GlobalHandles;
|
|
} // namespace internal
|
|
|
|
namespace debug {
|
|
class ConsoleCallArguments;
|
|
} // namespace debug
|
|
|
|
// --- Handles ---
|
|
|
|
#define TYPE_CHECK(T, S) \
|
|
while (false) { \
|
|
*(static_cast<T* volatile*>(0)) = static_cast<S*>(0); \
|
|
}
|
|
|
|
/**
|
|
* An object reference managed by the v8 garbage collector.
|
|
*
|
|
* All objects returned from v8 have to be tracked by the garbage
|
|
* collector so that it knows that the objects are still alive. Also,
|
|
* because the garbage collector may move objects, it is unsafe to
|
|
* point directly to an object. Instead, all objects are stored in
|
|
* handles which are known by the garbage collector and updated
|
|
* whenever an object moves. Handles should always be passed by value
|
|
* (except in cases like out-parameters) and they should never be
|
|
* allocated on the heap.
|
|
*
|
|
* There are two types of handles: local and persistent handles.
|
|
*
|
|
* Local handles are light-weight and transient and typically used in
|
|
* local operations. They are managed by HandleScopes. That means that a
|
|
* HandleScope must exist on the stack when they are created and that they are
|
|
* only valid inside of the HandleScope active during their creation.
|
|
* For passing a local handle to an outer HandleScope, an EscapableHandleScope
|
|
* and its Escape() method must be used.
|
|
*
|
|
* Persistent handles can be used when storing objects across several
|
|
* independent operations and have to be explicitly deallocated when they're no
|
|
* longer used.
|
|
*
|
|
* It is safe to extract the object stored in the handle by
|
|
* dereferencing the handle (for instance, to extract the Object* from
|
|
* a Local<Object>); the value will still be governed by a handle
|
|
* behind the scenes and the same rules apply to these values as to
|
|
* their handles.
|
|
*/
|
|
template <class T>
|
|
class Local {
|
|
public:
|
|
V8_INLINE Local() : val_(0) {}
|
|
template <class S>
|
|
V8_INLINE Local(Local<S> that)
|
|
: val_(reinterpret_cast<T*>(*that)) {
|
|
/**
|
|
* This check fails when trying to convert between incompatible
|
|
* handles. For example, converting from a Local<String> to a
|
|
* Local<Number>.
|
|
*/
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
|
|
/**
|
|
* Returns true if the handle is empty.
|
|
*/
|
|
V8_INLINE bool IsEmpty() const { return val_ == 0; }
|
|
|
|
/**
|
|
* Sets the handle to be empty. IsEmpty() will then return true.
|
|
*/
|
|
V8_INLINE void Clear() { val_ = 0; }
|
|
|
|
V8_INLINE T* operator->() const { return val_; }
|
|
|
|
V8_INLINE T* operator*() const { return val_; }
|
|
|
|
/**
|
|
* Checks whether two handles are the same.
|
|
* Returns true if both are empty, or if the objects
|
|
* to which they refer are identical.
|
|
* The handles' references are not checked.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE bool operator==(const Local<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == 0) return b == 0;
|
|
if (b == 0) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S> V8_INLINE bool operator==(
|
|
const PersistentBase<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == 0) return b == 0;
|
|
if (b == 0) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
/**
|
|
* Checks whether two handles are different.
|
|
* Returns true if only one of the handles is empty, or if
|
|
* the objects to which they refer are different.
|
|
* The handles' references are not checked.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const Local<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
template <class S> V8_INLINE bool operator!=(
|
|
const Persistent<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
/**
|
|
* Cast a handle to a subclass, e.g. Local<Value> to Local<Object>.
|
|
* This is only valid if the handle actually refers to a value of the
|
|
* target type.
|
|
*/
|
|
template <class S> V8_INLINE static Local<T> Cast(Local<S> that) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
// If we're going to perform the type check then we have to check
|
|
// that the handle isn't empty before doing the checked cast.
|
|
if (that.IsEmpty()) return Local<T>();
|
|
#endif
|
|
return Local<T>(T::Cast(*that));
|
|
}
|
|
|
|
/**
|
|
* Calling this is equivalent to Local<S>::Cast().
|
|
* In particular, this is only valid if the handle actually refers to a value
|
|
* of the target type.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Local<S> As() const {
|
|
return Local<S>::Cast(*this);
|
|
}
|
|
|
|
/**
|
|
* Create a local handle for the content of another handle.
|
|
* The referee is kept alive by the local handle even when
|
|
* the original handle is destroyed/disposed.
|
|
*/
|
|
V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that);
|
|
V8_INLINE static Local<T> New(Isolate* isolate,
|
|
const PersistentBase<T>& that);
|
|
|
|
private:
|
|
friend class Utils;
|
|
template<class F> friend class Eternal;
|
|
template<class F> friend class PersistentBase;
|
|
template<class F, class M> friend class Persistent;
|
|
template<class F> friend class Local;
|
|
template <class F>
|
|
friend class MaybeLocal;
|
|
template<class F> friend class FunctionCallbackInfo;
|
|
template<class F> friend class PropertyCallbackInfo;
|
|
friend class String;
|
|
friend class Object;
|
|
friend class Context;
|
|
friend class Private;
|
|
template<class F> friend class internal::CustomArguments;
|
|
friend Local<Primitive> Undefined(Isolate* isolate);
|
|
friend Local<Primitive> Null(Isolate* isolate);
|
|
friend Local<Boolean> True(Isolate* isolate);
|
|
friend Local<Boolean> False(Isolate* isolate);
|
|
friend class HandleScope;
|
|
friend class EscapableHandleScope;
|
|
template <class F1, class F2, class F3>
|
|
friend class PersistentValueMapBase;
|
|
template<class F1, class F2> friend class PersistentValueVector;
|
|
template <class F>
|
|
friend class ReturnValue;
|
|
|
|
explicit V8_INLINE Local(T* that) : val_(that) {}
|
|
V8_INLINE static Local<T> New(Isolate* isolate, T* that);
|
|
T* val_;
|
|
};
|
|
|
|
|
|
#if !defined(V8_IMMINENT_DEPRECATION_WARNINGS)
|
|
// Handle is an alias for Local for historical reasons.
|
|
template <class T>
|
|
using Handle = Local<T>;
|
|
#endif
|
|
|
|
|
|
/**
|
|
* A MaybeLocal<> is a wrapper around Local<> that enforces a check whether
|
|
* the Local<> is empty before it can be used.
|
|
*
|
|
* If an API method returns a MaybeLocal<>, the API method can potentially fail
|
|
* either because an exception is thrown, or because an exception is pending,
|
|
* e.g. because a previous API call threw an exception that hasn't been caught
|
|
* yet, or because a TerminateExecution exception was thrown. In that case, an
|
|
* empty MaybeLocal is returned.
|
|
*/
|
|
template <class T>
|
|
class MaybeLocal {
|
|
public:
|
|
V8_INLINE MaybeLocal() : val_(nullptr) {}
|
|
template <class S>
|
|
V8_INLINE MaybeLocal(Local<S> that)
|
|
: val_(reinterpret_cast<T*>(*that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
|
|
V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
|
|
|
|
/**
|
|
* Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty,
|
|
* |false| is returned and |out| is left untouched.
|
|
*/
|
|
template <class S>
|
|
V8_WARN_UNUSED_RESULT V8_INLINE bool ToLocal(Local<S>* out) const {
|
|
out->val_ = IsEmpty() ? nullptr : this->val_;
|
|
return !IsEmpty();
|
|
}
|
|
|
|
/**
|
|
* Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty,
|
|
* V8 will crash the process.
|
|
*/
|
|
V8_INLINE Local<T> ToLocalChecked();
|
|
|
|
/**
|
|
* Converts this MaybeLocal<> to a Local<>, using a default value if this
|
|
* MaybeLocal<> is empty.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Local<S> FromMaybe(Local<S> default_value) const {
|
|
return IsEmpty() ? default_value : Local<S>(val_);
|
|
}
|
|
|
|
private:
|
|
T* val_;
|
|
};
|
|
|
|
/**
|
|
* Eternal handles are set-once handles that live for the lifetime of the
|
|
* isolate.
|
|
*/
|
|
template <class T> class Eternal {
|
|
public:
|
|
V8_INLINE Eternal() : val_(nullptr) {}
|
|
template <class S>
|
|
V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : val_(nullptr) {
|
|
Set(isolate, handle);
|
|
}
|
|
// Can only be safely called if already set.
|
|
V8_INLINE Local<T> Get(Isolate* isolate) const;
|
|
V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
|
|
template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle);
|
|
|
|
private:
|
|
T* val_;
|
|
};
|
|
|
|
|
|
static const int kInternalFieldsInWeakCallback = 2;
|
|
static const int kEmbedderFieldsInWeakCallback = 2;
|
|
|
|
template <typename T>
|
|
class WeakCallbackInfo {
|
|
public:
|
|
typedef void (*Callback)(const WeakCallbackInfo<T>& data);
|
|
|
|
WeakCallbackInfo(Isolate* isolate, T* parameter,
|
|
void* embedder_fields[kEmbedderFieldsInWeakCallback],
|
|
Callback* callback)
|
|
: isolate_(isolate), parameter_(parameter), callback_(callback) {
|
|
for (int i = 0; i < kEmbedderFieldsInWeakCallback; ++i) {
|
|
embedder_fields_[i] = embedder_fields[i];
|
|
}
|
|
}
|
|
|
|
V8_INLINE Isolate* GetIsolate() const { return isolate_; }
|
|
V8_INLINE T* GetParameter() const { return parameter_; }
|
|
V8_INLINE void* GetInternalField(int index) const;
|
|
|
|
V8_INLINE V8_DEPRECATED("use indexed version",
|
|
void* GetInternalField1() const) {
|
|
return embedder_fields_[0];
|
|
}
|
|
V8_INLINE V8_DEPRECATED("use indexed version",
|
|
void* GetInternalField2() const) {
|
|
return embedder_fields_[1];
|
|
}
|
|
|
|
V8_DEPRECATED("Not realiable once SetSecondPassCallback() was used.",
|
|
bool IsFirstPass() const) {
|
|
return callback_ != nullptr;
|
|
}
|
|
|
|
// When first called, the embedder MUST Reset() the Global which triggered the
|
|
// callback. The Global itself is unusable for anything else. No v8 other api
|
|
// calls may be called in the first callback. Should additional work be
|
|
// required, the embedder must set a second pass callback, which will be
|
|
// called after all the initial callbacks are processed.
|
|
// Calling SetSecondPassCallback on the second pass will immediately crash.
|
|
void SetSecondPassCallback(Callback callback) const { *callback_ = callback; }
|
|
|
|
private:
|
|
Isolate* isolate_;
|
|
T* parameter_;
|
|
Callback* callback_;
|
|
void* embedder_fields_[kEmbedderFieldsInWeakCallback];
|
|
};
|
|
|
|
|
|
// kParameter will pass a void* parameter back to the callback, kInternalFields
|
|
// will pass the first two internal fields back to the callback, kFinalizer
|
|
// will pass a void* parameter back, but is invoked before the object is
|
|
// actually collected, so it can be resurrected. In the last case, it is not
|
|
// possible to request a second pass callback.
|
|
enum class WeakCallbackType { kParameter, kInternalFields, kFinalizer };
|
|
|
|
/**
|
|
* An object reference that is independent of any handle scope. Where
|
|
* a Local handle only lives as long as the HandleScope in which it was
|
|
* allocated, a PersistentBase handle remains valid until it is explicitly
|
|
* disposed using Reset().
|
|
*
|
|
* A persistent handle contains a reference to a storage cell within
|
|
* the V8 engine which holds an object value and which is updated by
|
|
* the garbage collector whenever the object is moved. A new storage
|
|
* cell can be created using the constructor or PersistentBase::Reset and
|
|
* existing handles can be disposed using PersistentBase::Reset.
|
|
*
|
|
*/
|
|
template <class T> class PersistentBase {
|
|
public:
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* IsEmpty() will return true after this call.
|
|
*/
|
|
V8_INLINE void Reset();
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* and create a new one with the contents of other if other is non empty
|
|
*/
|
|
template <class S>
|
|
V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
|
|
|
|
/**
|
|
* If non-empty, destroy the underlying storage cell
|
|
* and create a new one with the contents of other if other is non empty
|
|
*/
|
|
template <class S>
|
|
V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other);
|
|
|
|
V8_INLINE bool IsEmpty() const { return val_ == NULL; }
|
|
V8_INLINE void Empty() { val_ = 0; }
|
|
|
|
V8_INLINE Local<T> Get(Isolate* isolate) const {
|
|
return Local<T>::New(isolate, *this);
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator==(const PersistentBase<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == NULL) return b == NULL;
|
|
if (b == NULL) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator==(const Local<S>& that) const {
|
|
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
|
|
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
|
|
if (a == NULL) return b == NULL;
|
|
if (b == NULL) return false;
|
|
return *a == *b;
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const PersistentBase<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
template <class S>
|
|
V8_INLINE bool operator!=(const Local<S>& that) const {
|
|
return !operator==(that);
|
|
}
|
|
|
|
/**
|
|
* Install a finalization callback on this object.
|
|
* NOTE: There is no guarantee as to *when* or even *if* the callback is
|
|
* invoked. The invocation is performed solely on a best effort basis.
|
|
* As always, GC-based finalization should *not* be relied upon for any
|
|
* critical form of resource management!
|
|
*/
|
|
template <typename P>
|
|
V8_INLINE void SetWeak(P* parameter,
|
|
typename WeakCallbackInfo<P>::Callback callback,
|
|
WeakCallbackType type);
|
|
|
|
/**
|
|
* Turns this handle into a weak phantom handle without finalization callback.
|
|
* The handle will be reset automatically when the garbage collector detects
|
|
* that the object is no longer reachable.
|
|
* A related function Isolate::NumberOfPhantomHandleResetsSinceLastCall
|
|
* returns how many phantom handles were reset by the garbage collector.
|
|
*/
|
|
V8_INLINE void SetWeak();
|
|
|
|
template<typename P>
|
|
V8_INLINE P* ClearWeak();
|
|
|
|
// TODO(dcarney): remove this.
|
|
V8_INLINE void ClearWeak() { ClearWeak<void>(); }
|
|
|
|
/**
|
|
* Allows the embedder to tell the v8 garbage collector that a certain object
|
|
* is alive. Only allowed when the embedder is asked to trace its heap by
|
|
* EmbedderHeapTracer.
|
|
*/
|
|
V8_INLINE void RegisterExternalReference(Isolate* isolate) const;
|
|
|
|
/**
|
|
* Marks the reference to this object independent. Garbage collector is free
|
|
* to ignore any object groups containing this object. Weak callback for an
|
|
* independent handle should not assume that it will be preceded by a global
|
|
* GC prologue callback or followed by a global GC epilogue callback.
|
|
*/
|
|
V8_INLINE void MarkIndependent();
|
|
|
|
/**
|
|
* Marks the reference to this object as active. The scavenge garbage
|
|
* collection should not reclaim the objects marked as active.
|
|
* This bit is cleared after the each garbage collection pass.
|
|
*/
|
|
V8_INLINE void MarkActive();
|
|
|
|
V8_INLINE bool IsIndependent() const;
|
|
|
|
/** Checks if the handle holds the only reference to an object. */
|
|
V8_INLINE bool IsNearDeath() const;
|
|
|
|
/** Returns true if the handle's reference is weak. */
|
|
V8_INLINE bool IsWeak() const;
|
|
|
|
/**
|
|
* Assigns a wrapper class ID to the handle. See RetainedObjectInfo interface
|
|
* description in v8-profiler.h for details.
|
|
*/
|
|
V8_INLINE void SetWrapperClassId(uint16_t class_id);
|
|
|
|
/**
|
|
* Returns the class ID previously assigned to this handle or 0 if no class ID
|
|
* was previously assigned.
|
|
*/
|
|
V8_INLINE uint16_t WrapperClassId() const;
|
|
|
|
PersistentBase(const PersistentBase& other) = delete; // NOLINT
|
|
void operator=(const PersistentBase&) = delete;
|
|
|
|
private:
|
|
friend class Isolate;
|
|
friend class Utils;
|
|
template<class F> friend class Local;
|
|
template<class F1, class F2> friend class Persistent;
|
|
template <class F>
|
|
friend class Global;
|
|
template<class F> friend class PersistentBase;
|
|
template<class F> friend class ReturnValue;
|
|
template <class F1, class F2, class F3>
|
|
friend class PersistentValueMapBase;
|
|
template<class F1, class F2> friend class PersistentValueVector;
|
|
friend class Object;
|
|
|
|
explicit V8_INLINE PersistentBase(T* val) : val_(val) {}
|
|
V8_INLINE static T* New(Isolate* isolate, T* that);
|
|
|
|
T* val_;
|
|
};
|
|
|
|
|
|
/**
|
|
* Default traits for Persistent. This class does not allow
|
|
* use of the copy constructor or assignment operator.
|
|
* At present kResetInDestructor is not set, but that will change in a future
|
|
* version.
|
|
*/
|
|
template<class T>
|
|
class NonCopyablePersistentTraits {
|
|
public:
|
|
typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent;
|
|
static const bool kResetInDestructor = false;
|
|
template<class S, class M>
|
|
V8_INLINE static void Copy(const Persistent<S, M>& source,
|
|
NonCopyablePersistent* dest) {
|
|
Uncompilable<Object>();
|
|
}
|
|
// TODO(dcarney): come up with a good compile error here.
|
|
template<class O> V8_INLINE static void Uncompilable() {
|
|
TYPE_CHECK(O, Primitive);
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* Helper class traits to allow copying and assignment of Persistent.
|
|
* This will clone the contents of storage cell, but not any of the flags, etc.
|
|
*/
|
|
template<class T>
|
|
struct CopyablePersistentTraits {
|
|
typedef Persistent<T, CopyablePersistentTraits<T> > CopyablePersistent;
|
|
static const bool kResetInDestructor = true;
|
|
template<class S, class M>
|
|
static V8_INLINE void Copy(const Persistent<S, M>& source,
|
|
CopyablePersistent* dest) {
|
|
// do nothing, just allow copy
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* A PersistentBase which allows copy and assignment.
|
|
*
|
|
* Copy, assignment and destructor behavior is controlled by the traits
|
|
* class M.
|
|
*
|
|
* Note: Persistent class hierarchy is subject to future changes.
|
|
*/
|
|
template <class T, class M> class Persistent : public PersistentBase<T> {
|
|
public:
|
|
/**
|
|
* A Persistent with no storage cell.
|
|
*/
|
|
V8_INLINE Persistent() : PersistentBase<T>(0) { }
|
|
/**
|
|
* Construct a Persistent from a Local.
|
|
* When the Local is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Persistent(Isolate* isolate, Local<S> that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Construct a Persistent from a Persistent.
|
|
* When the Persistent is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* The copy constructors and assignment operator create a Persistent
|
|
* exactly as the Persistent constructor, but the Copy function from the
|
|
* traits class is called, allowing the setting of flags based on the
|
|
* copied Persistent.
|
|
*/
|
|
V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(0) {
|
|
Copy(that);
|
|
}
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) {
|
|
Copy(that);
|
|
}
|
|
V8_INLINE Persistent& operator=(const Persistent& that) { // NOLINT
|
|
Copy(that);
|
|
return *this;
|
|
}
|
|
template <class S, class M2>
|
|
V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT
|
|
Copy(that);
|
|
return *this;
|
|
}
|
|
/**
|
|
* The destructor will dispose the Persistent based on the
|
|
* kResetInDestructor flags in the traits class. Since not calling dispose
|
|
* can result in a memory leak, it is recommended to always set this flag.
|
|
*/
|
|
V8_INLINE ~Persistent() {
|
|
if (M::kResetInDestructor) this->Reset();
|
|
}
|
|
|
|
// TODO(dcarney): this is pretty useless, fix or remove
|
|
template <class S>
|
|
V8_INLINE static Persistent<T>& Cast(const Persistent<S>& that) { // NOLINT
|
|
#ifdef V8_ENABLE_CHECKS
|
|
// If we're going to perform the type check then we have to check
|
|
// that the handle isn't empty before doing the checked cast.
|
|
if (!that.IsEmpty()) T::Cast(*that);
|
|
#endif
|
|
return reinterpret_cast<Persistent<T>&>(const_cast<Persistent<S>&>(that));
|
|
}
|
|
|
|
// TODO(dcarney): this is pretty useless, fix or remove
|
|
template <class S>
|
|
V8_INLINE Persistent<S>& As() const { // NOLINT
|
|
return Persistent<S>::Cast(*this);
|
|
}
|
|
|
|
private:
|
|
friend class Isolate;
|
|
friend class Utils;
|
|
template<class F> friend class Local;
|
|
template<class F1, class F2> friend class Persistent;
|
|
template<class F> friend class ReturnValue;
|
|
|
|
explicit V8_INLINE Persistent(T* that) : PersistentBase<T>(that) {}
|
|
V8_INLINE T* operator*() const { return this->val_; }
|
|
template<class S, class M2>
|
|
V8_INLINE void Copy(const Persistent<S, M2>& that);
|
|
};
|
|
|
|
|
|
/**
|
|
* A PersistentBase which has move semantics.
|
|
*
|
|
* Note: Persistent class hierarchy is subject to future changes.
|
|
*/
|
|
template <class T>
|
|
class Global : public PersistentBase<T> {
|
|
public:
|
|
/**
|
|
* A Global with no storage cell.
|
|
*/
|
|
V8_INLINE Global() : PersistentBase<T>(nullptr) {}
|
|
/**
|
|
* Construct a Global from a Local.
|
|
* When the Local is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global(Isolate* isolate, Local<S> that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Construct a Global from a PersistentBase.
|
|
* When the Persistent is non-empty, a new storage cell is created
|
|
* pointing to the same object, and no flags are set.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that)
|
|
: PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
/**
|
|
* Move constructor.
|
|
*/
|
|
V8_INLINE Global(Global&& other) : PersistentBase<T>(other.val_) { // NOLINT
|
|
other.val_ = nullptr;
|
|
}
|
|
V8_INLINE ~Global() { this->Reset(); }
|
|
/**
|
|
* Move via assignment.
|
|
*/
|
|
template <class S>
|
|
V8_INLINE Global& operator=(Global<S>&& rhs) { // NOLINT
|
|
TYPE_CHECK(T, S);
|
|
if (this != &rhs) {
|
|
this->Reset();
|
|
this->val_ = rhs.val_;
|
|
rhs.val_ = nullptr;
|
|
}
|
|
return *this;
|
|
}
|
|
/**
|
|
* Pass allows returning uniques from functions, etc.
|
|
*/
|
|
Global Pass() { return static_cast<Global&&>(*this); } // NOLINT
|
|
|
|
/*
|
|
* For compatibility with Chromium's base::Bind (base::Passed).
|
|
*/
|
|
typedef void MoveOnlyTypeForCPP03;
|
|
|
|
Global(const Global&) = delete;
|
|
void operator=(const Global&) = delete;
|
|
|
|
private:
|
|
template <class F>
|
|
friend class ReturnValue;
|
|
V8_INLINE T* operator*() const { return this->val_; }
|
|
};
|
|
|
|
|
|
// UniquePersistent is an alias for Global for historical reason.
|
|
template <class T>
|
|
using UniquePersistent = Global<T>;
|
|
|
|
|
|
/**
|
|
* A stack-allocated class that governs a number of local handles.
|
|
* After a handle scope has been created, all local handles will be
|
|
* allocated within that handle scope until either the handle scope is
|
|
* deleted or another handle scope is created. If there is already a
|
|
* handle scope and a new one is created, all allocations will take
|
|
* place in the new handle scope until it is deleted. After that,
|
|
* new handles will again be allocated in the original handle scope.
|
|
*
|
|
* After the handle scope of a local handle has been deleted the
|
|
* garbage collector will no longer track the object stored in the
|
|
* handle and may deallocate it. The behavior of accessing a handle
|
|
* for which the handle scope has been deleted is undefined.
|
|
*/
|
|
class V8_EXPORT HandleScope {
|
|
public:
|
|
explicit HandleScope(Isolate* isolate);
|
|
|
|
~HandleScope();
|
|
|
|
/**
|
|
* Counts the number of allocated handles.
|
|
*/
|
|
static int NumberOfHandles(Isolate* isolate);
|
|
|
|
V8_INLINE Isolate* GetIsolate() const {
|
|
return reinterpret_cast<Isolate*>(isolate_);
|
|
}
|
|
|
|
HandleScope(const HandleScope&) = delete;
|
|
void operator=(const HandleScope&) = delete;
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
protected:
|
|
V8_INLINE HandleScope() {}
|
|
|
|
void Initialize(Isolate* isolate);
|
|
|
|
static internal::Object** CreateHandle(internal::Isolate* isolate,
|
|
internal::Object* value);
|
|
|
|
private:
|
|
// Uses heap_object to obtain the current Isolate.
|
|
static internal::Object** CreateHandle(internal::HeapObject* heap_object,
|
|
internal::Object* value);
|
|
|
|
internal::Isolate* isolate_;
|
|
internal::Object** prev_next_;
|
|
internal::Object** prev_limit_;
|
|
|
|
// Local::New uses CreateHandle with an Isolate* parameter.
|
|
template<class F> friend class Local;
|
|
|
|
// Object::GetInternalField and Context::GetEmbedderData use CreateHandle with
|
|
// a HeapObject* in their shortcuts.
|
|
friend class Object;
|
|
friend class Context;
|
|
};
|
|
|
|
|
|
/**
|
|
* A HandleScope which first allocates a handle in the current scope
|
|
* which will be later filled with the escape value.
|
|
*/
|
|
class V8_EXPORT EscapableHandleScope : public HandleScope {
|
|
public:
|
|
explicit EscapableHandleScope(Isolate* isolate);
|
|
V8_INLINE ~EscapableHandleScope() {}
|
|
|
|
/**
|
|
* Pushes the value into the previous scope and returns a handle to it.
|
|
* Cannot be called twice.
|
|
*/
|
|
template <class T>
|
|
V8_INLINE Local<T> Escape(Local<T> value) {
|
|
internal::Object** slot =
|
|
Escape(reinterpret_cast<internal::Object**>(*value));
|
|
return Local<T>(reinterpret_cast<T*>(slot));
|
|
}
|
|
|
|
EscapableHandleScope(const EscapableHandleScope&) = delete;
|
|
void operator=(const EscapableHandleScope&) = delete;
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
private:
|
|
internal::Object** Escape(internal::Object** escape_value);
|
|
internal::Object** escape_slot_;
|
|
};
|
|
|
|
/**
|
|
* A SealHandleScope acts like a handle scope in which no handle allocations
|
|
* are allowed. It can be useful for debugging handle leaks.
|
|
* Handles can be allocated within inner normal HandleScopes.
|
|
*/
|
|
class V8_EXPORT SealHandleScope {
|
|
public:
|
|
SealHandleScope(Isolate* isolate);
|
|
~SealHandleScope();
|
|
|
|
SealHandleScope(const SealHandleScope&) = delete;
|
|
void operator=(const SealHandleScope&) = delete;
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
private:
|
|
internal::Isolate* const isolate_;
|
|
internal::Object** prev_limit_;
|
|
int prev_sealed_level_;
|
|
};
|
|
|
|
|
|
// --- Special objects ---
|
|
|
|
|
|
/**
|
|
* The superclass of values and API object templates.
|
|
*/
|
|
class V8_EXPORT Data {
|
|
private:
|
|
Data();
|
|
};
|
|
|
|
|
|
/**
|
|
* The optional attributes of ScriptOrigin.
|
|
*/
|
|
class ScriptOriginOptions {
|
|
public:
|
|
V8_INLINE ScriptOriginOptions(bool is_shared_cross_origin = false,
|
|
bool is_opaque = false, bool is_wasm = false,
|
|
bool is_module = false)
|
|
: flags_((is_shared_cross_origin ? kIsSharedCrossOrigin : 0) |
|
|
(is_wasm ? kIsWasm : 0) | (is_opaque ? kIsOpaque : 0) |
|
|
(is_module ? kIsModule : 0)) {}
|
|
V8_INLINE ScriptOriginOptions(int flags)
|
|
: flags_(flags &
|
|
(kIsSharedCrossOrigin | kIsOpaque | kIsWasm | kIsModule)) {}
|
|
|
|
bool IsSharedCrossOrigin() const {
|
|
return (flags_ & kIsSharedCrossOrigin) != 0;
|
|
}
|
|
bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; }
|
|
bool IsWasm() const { return (flags_ & kIsWasm) != 0; }
|
|
bool IsModule() const { return (flags_ & kIsModule) != 0; }
|
|
|
|
int Flags() const { return flags_; }
|
|
|
|
private:
|
|
enum {
|
|
kIsSharedCrossOrigin = 1,
|
|
kIsOpaque = 1 << 1,
|
|
kIsWasm = 1 << 2,
|
|
kIsModule = 1 << 3
|
|
};
|
|
const int flags_;
|
|
};
|
|
|
|
/**
|
|
* The origin, within a file, of a script.
|
|
*/
|
|
class ScriptOrigin {
|
|
public:
|
|
V8_INLINE ScriptOrigin(
|
|
Local<Value> resource_name,
|
|
Local<Integer> resource_line_offset = Local<Integer>(),
|
|
Local<Integer> resource_column_offset = Local<Integer>(),
|
|
Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(),
|
|
Local<Integer> script_id = Local<Integer>(),
|
|
Local<Value> source_map_url = Local<Value>(),
|
|
Local<Boolean> resource_is_opaque = Local<Boolean>(),
|
|
Local<Boolean> is_wasm = Local<Boolean>(),
|
|
Local<Boolean> is_module = Local<Boolean>());
|
|
|
|
V8_INLINE Local<Value> ResourceName() const;
|
|
V8_INLINE Local<Integer> ResourceLineOffset() const;
|
|
V8_INLINE Local<Integer> ResourceColumnOffset() const;
|
|
/**
|
|
* Returns true for embedder's debugger scripts
|
|
*/
|
|
V8_INLINE Local<Integer> ScriptID() const;
|
|
V8_INLINE Local<Value> SourceMapUrl() const;
|
|
V8_INLINE ScriptOriginOptions Options() const { return options_; }
|
|
|
|
private:
|
|
Local<Value> resource_name_;
|
|
Local<Integer> resource_line_offset_;
|
|
Local<Integer> resource_column_offset_;
|
|
ScriptOriginOptions options_;
|
|
Local<Integer> script_id_;
|
|
Local<Value> source_map_url_;
|
|
};
|
|
|
|
|
|
/**
|
|
* A compiled JavaScript script, not yet tied to a Context.
|
|
*/
|
|
class V8_EXPORT UnboundScript {
|
|
public:
|
|
/**
|
|
* Binds the script to the currently entered context.
|
|
*/
|
|
Local<Script> BindToCurrentContext();
|
|
|
|
int GetId();
|
|
Local<Value> GetScriptName();
|
|
|
|
/**
|
|
* Data read from magic sourceURL comments.
|
|
*/
|
|
Local<Value> GetSourceURL();
|
|
/**
|
|
* Data read from magic sourceMappingURL comments.
|
|
*/
|
|
Local<Value> GetSourceMappingURL();
|
|
|
|
/**
|
|
* Returns zero based line number of the code_pos location in the script.
|
|
* -1 will be returned if no information available.
|
|
*/
|
|
int GetLineNumber(int code_pos);
|
|
|
|
static const int kNoScriptId = 0;
|
|
};
|
|
|
|
/**
|
|
* This is an unfinished experimental feature, and is only exposed
|
|
* here for internal testing purposes. DO NOT USE.
|
|
*
|
|
* A compiled JavaScript module.
|
|
*/
|
|
class V8_EXPORT Module {
|
|
public:
|
|
/**
|
|
* Returns the number of modules requested by this module.
|
|
*/
|
|
int GetModuleRequestsLength() const;
|
|
|
|
/**
|
|
* Returns the ith module specifier in this module.
|
|
* i must be < GetModuleRequestsLength() and >= 0.
|
|
*/
|
|
Local<String> GetModuleRequest(int i) const;
|
|
|
|
/**
|
|
* Returns the identity hash for this object.
|
|
*/
|
|
int GetIdentityHash() const;
|
|
|
|
typedef MaybeLocal<Module> (*ResolveCallback)(Local<Context> context,
|
|
Local<String> specifier,
|
|
Local<Module> referrer);
|
|
|
|
/**
|
|
* ModuleDeclarationInstantiation
|
|
*
|
|
* Returns false if an exception occurred during instantiation. (In the case
|
|
* where the callback throws an exception, that exception is propagated.)
|
|
*/
|
|
V8_WARN_UNUSED_RESULT bool Instantiate(Local<Context> context,
|
|
ResolveCallback callback);
|
|
|
|
/**
|
|
* ModuleEvaluation
|
|
*
|
|
* Returns the completion value.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Evaluate(Local<Context> context);
|
|
};
|
|
|
|
/**
|
|
* This is an unfinished experimental feature, and is only exposed
|
|
* here for internal testing purposes. DO NOT USE.
|
|
*
|
|
* A compiled JavaScript module.
|
|
*/
|
|
class V8_EXPORT DynamicImportResult {
|
|
public:
|
|
/**
|
|
* Resolves the promise with the namespace object of the given
|
|
* module.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT bool FinishDynamicImportSuccess(Local<Context> context,
|
|
Local<Module> module);
|
|
|
|
/**
|
|
* Rejects the promise with the given exception.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT bool FinishDynamicImportFailure(Local<Context> context,
|
|
Local<Value> exception);
|
|
};
|
|
|
|
/**
|
|
* A compiled JavaScript script, tied to a Context which was active when the
|
|
* script was compiled.
|
|
*/
|
|
class V8_EXPORT Script {
|
|
public:
|
|
/**
|
|
* A shorthand for ScriptCompiler::Compile().
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Script> Compile(Local<String> source,
|
|
ScriptOrigin* origin = nullptr));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, Local<String> source,
|
|
ScriptOrigin* origin = nullptr);
|
|
|
|
static Local<Script> V8_DEPRECATE_SOON("Use maybe version",
|
|
Compile(Local<String> source,
|
|
Local<String> file_name));
|
|
|
|
/**
|
|
* Runs the script returning the resulting value. It will be run in the
|
|
* context in which it was created (ScriptCompiler::CompileBound or
|
|
* UnboundScript::BindToCurrentContext()).
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Run());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context);
|
|
|
|
/**
|
|
* Returns the corresponding context-unbound script.
|
|
*/
|
|
Local<UnboundScript> GetUnboundScript();
|
|
};
|
|
|
|
|
|
/**
|
|
* For compiling scripts.
|
|
*/
|
|
class V8_EXPORT ScriptCompiler {
|
|
public:
|
|
/**
|
|
* Compilation data that the embedder can cache and pass back to speed up
|
|
* future compilations. The data is produced if the CompilerOptions passed to
|
|
* the compilation functions in ScriptCompiler contains produce_data_to_cache
|
|
* = true. The data to cache can then can be retrieved from
|
|
* UnboundScript.
|
|
*/
|
|
struct V8_EXPORT CachedData {
|
|
enum BufferPolicy {
|
|
BufferNotOwned,
|
|
BufferOwned
|
|
};
|
|
|
|
CachedData()
|
|
: data(NULL),
|
|
length(0),
|
|
rejected(false),
|
|
buffer_policy(BufferNotOwned) {}
|
|
|
|
// If buffer_policy is BufferNotOwned, the caller keeps the ownership of
|
|
// data and guarantees that it stays alive until the CachedData object is
|
|
// destroyed. If the policy is BufferOwned, the given data will be deleted
|
|
// (with delete[]) when the CachedData object is destroyed.
|
|
CachedData(const uint8_t* data, int length,
|
|
BufferPolicy buffer_policy = BufferNotOwned);
|
|
~CachedData();
|
|
// TODO(marja): Async compilation; add constructors which take a callback
|
|
// which will be called when V8 no longer needs the data.
|
|
const uint8_t* data;
|
|
int length;
|
|
bool rejected;
|
|
BufferPolicy buffer_policy;
|
|
|
|
// Prevent copying.
|
|
CachedData(const CachedData&) = delete;
|
|
CachedData& operator=(const CachedData&) = delete;
|
|
};
|
|
|
|
/**
|
|
* Source code which can be then compiled to a UnboundScript or Script.
|
|
*/
|
|
class Source {
|
|
public:
|
|
// Source takes ownership of CachedData.
|
|
V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
|
|
CachedData* cached_data = NULL);
|
|
V8_INLINE Source(Local<String> source_string,
|
|
CachedData* cached_data = NULL);
|
|
V8_INLINE ~Source();
|
|
|
|
// Ownership of the CachedData or its buffers is *not* transferred to the
|
|
// caller. The CachedData object is alive as long as the Source object is
|
|
// alive.
|
|
V8_INLINE const CachedData* GetCachedData() const;
|
|
|
|
V8_INLINE const ScriptOriginOptions& GetResourceOptions() const;
|
|
|
|
// Prevent copying.
|
|
Source(const Source&) = delete;
|
|
Source& operator=(const Source&) = delete;
|
|
|
|
private:
|
|
friend class ScriptCompiler;
|
|
|
|
Local<String> source_string;
|
|
|
|
// Origin information
|
|
Local<Value> resource_name;
|
|
Local<Integer> resource_line_offset;
|
|
Local<Integer> resource_column_offset;
|
|
ScriptOriginOptions resource_options;
|
|
Local<Value> source_map_url;
|
|
|
|
// Cached data from previous compilation (if a kConsume*Cache flag is
|
|
// set), or hold newly generated cache data (kProduce*Cache flags) are
|
|
// set when calling a compile method.
|
|
CachedData* cached_data;
|
|
};
|
|
|
|
/**
|
|
* For streaming incomplete script data to V8. The embedder should implement a
|
|
* subclass of this class.
|
|
*/
|
|
class V8_EXPORT ExternalSourceStream {
|
|
public:
|
|
virtual ~ExternalSourceStream() {}
|
|
|
|
/**
|
|
* V8 calls this to request the next chunk of data from the embedder. This
|
|
* function will be called on a background thread, so it's OK to block and
|
|
* wait for the data, if the embedder doesn't have data yet. Returns the
|
|
* length of the data returned. When the data ends, GetMoreData should
|
|
* return 0. Caller takes ownership of the data.
|
|
*
|
|
* If the embedder wants to cancel the streaming, they should make the next
|
|
* GetMoreData call return 0. V8 will interpret it as end of data (and most
|
|
* probably, parsing will fail). The streaming task will return as soon as
|
|
* V8 has parsed the data it received so far.
|
|
*/
|
|
virtual size_t GetMoreData(const uint8_t** src) = 0;
|
|
|
|
/**
|
|
* V8 calls this method to set a 'bookmark' at the current position in
|
|
* the source stream, for the purpose of (maybe) later calling
|
|
* ResetToBookmark. If ResetToBookmark is called later, then subsequent
|
|
* calls to GetMoreData should return the same data as they did when
|
|
* SetBookmark was called earlier.
|
|
*
|
|
* The embedder may return 'false' to indicate it cannot provide this
|
|
* functionality.
|
|
*/
|
|
virtual bool SetBookmark();
|
|
|
|
/**
|
|
* V8 calls this to return to a previously set bookmark.
|
|
*/
|
|
virtual void ResetToBookmark();
|
|
};
|
|
|
|
|
|
/**
|
|
* Source code which can be streamed into V8 in pieces. It will be parsed
|
|
* while streaming. It can be compiled after the streaming is complete.
|
|
* StreamedSource must be kept alive while the streaming task is ran (see
|
|
* ScriptStreamingTask below).
|
|
*/
|
|
class V8_EXPORT StreamedSource {
|
|
public:
|
|
enum Encoding { ONE_BYTE, TWO_BYTE, UTF8 };
|
|
|
|
StreamedSource(ExternalSourceStream* source_stream, Encoding encoding);
|
|
~StreamedSource();
|
|
|
|
// Ownership of the CachedData or its buffers is *not* transferred to the
|
|
// caller. The CachedData object is alive as long as the StreamedSource
|
|
// object is alive.
|
|
const CachedData* GetCachedData() const;
|
|
|
|
internal::StreamedSource* impl() const { return impl_; }
|
|
|
|
// Prevent copying.
|
|
StreamedSource(const StreamedSource&) = delete;
|
|
StreamedSource& operator=(const StreamedSource&) = delete;
|
|
|
|
private:
|
|
internal::StreamedSource* impl_;
|
|
};
|
|
|
|
/**
|
|
* A streaming task which the embedder must run on a background thread to
|
|
* stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript.
|
|
*/
|
|
class ScriptStreamingTask {
|
|
public:
|
|
virtual ~ScriptStreamingTask() {}
|
|
virtual void Run() = 0;
|
|
};
|
|
|
|
enum CompileOptions {
|
|
kNoCompileOptions = 0,
|
|
kProduceParserCache,
|
|
kConsumeParserCache,
|
|
kProduceCodeCache,
|
|
kConsumeCodeCache
|
|
};
|
|
|
|
/**
|
|
* Compiles the specified script (context-independent).
|
|
* Cached data as part of the source object can be optionally produced to be
|
|
* consumed later to speed up compilation of identical source scripts.
|
|
*
|
|
* Note that when producing cached data, the source must point to NULL for
|
|
* cached data. When consuming cached data, the cached data must have been
|
|
* produced by the same version of V8.
|
|
*
|
|
* \param source Script source code.
|
|
* \return Compiled script object (context independent; for running it must be
|
|
* bound to a context).
|
|
*/
|
|
static V8_DEPRECATED("Use maybe version",
|
|
Local<UnboundScript> CompileUnbound(
|
|
Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript(
|
|
Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Compiles the specified script (bound to current context).
|
|
*
|
|
* \param source Script source code.
|
|
* \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile()
|
|
* using pre_data speeds compilation if it's done multiple times.
|
|
* Owned by caller, no references are kept when this function returns.
|
|
* \return Compiled script object, bound to the context that was active
|
|
* when this function was called. When run it will always use this
|
|
* context.
|
|
*/
|
|
static V8_DEPRECATED(
|
|
"Use maybe version",
|
|
Local<Script> Compile(Isolate* isolate, Source* source,
|
|
CompileOptions options = kNoCompileOptions));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, Source* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Returns a task which streams script data into V8, or NULL if the script
|
|
* cannot be streamed. The user is responsible for running the task on a
|
|
* background thread and deleting it. When ran, the task starts parsing the
|
|
* script, and it will request data from the StreamedSource as needed. When
|
|
* ScriptStreamingTask::Run exits, all data has been streamed and the script
|
|
* can be compiled (see Compile below).
|
|
*
|
|
* This API allows to start the streaming with as little data as possible, and
|
|
* the remaining data (for example, the ScriptOrigin) is passed to Compile.
|
|
*/
|
|
static ScriptStreamingTask* StartStreamingScript(
|
|
Isolate* isolate, StreamedSource* source,
|
|
CompileOptions options = kNoCompileOptions);
|
|
|
|
/**
|
|
* Compiles a streamed script (bound to current context).
|
|
*
|
|
* This can only be called after the streaming has finished
|
|
* (ScriptStreamingTask has been run). V8 doesn't construct the source string
|
|
* during streaming, so the embedder needs to pass the full source here.
|
|
*/
|
|
static V8_DEPRECATED("Use maybe version",
|
|
Local<Script> Compile(Isolate* isolate,
|
|
StreamedSource* source,
|
|
Local<String> full_source_string,
|
|
const ScriptOrigin& origin));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
|
|
Local<Context> context, StreamedSource* source,
|
|
Local<String> full_source_string, const ScriptOrigin& origin);
|
|
|
|
/**
|
|
* Return a version tag for CachedData for the current V8 version & flags.
|
|
*
|
|
* This value is meant only for determining whether a previously generated
|
|
* CachedData instance is still valid; the tag has no other meaing.
|
|
*
|
|
* Background: The data carried by CachedData may depend on the exact
|
|
* V8 version number or current compiler flags. This means that when
|
|
* persisting CachedData, the embedder must take care to not pass in
|
|
* data from another V8 version, or the same version with different
|
|
* features enabled.
|
|
*
|
|
* The easiest way to do so is to clear the embedder's cache on any
|
|
* such change.
|
|
*
|
|
* Alternatively, this tag can be stored alongside the cached data and
|
|
* compared when it is being used.
|
|
*/
|
|
static uint32_t CachedDataVersionTag();
|
|
|
|
/**
|
|
* This is an unfinished experimental feature, and is only exposed
|
|
* here for internal testing purposes. DO NOT USE.
|
|
*
|
|
* Compile an ES module, returning a Module that encapsulates
|
|
* the compiled code.
|
|
*
|
|
* Corresponds to the ParseModule abstract operation in the
|
|
* ECMAScript specification.
|
|
*/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule(
|
|
Isolate* isolate, Source* source);
|
|
|
|
/**
|
|
* Compile a function for a given context. This is equivalent to running
|
|
*
|
|
* with (obj) {
|
|
* return function(args) { ... }
|
|
* }
|
|
*
|
|
* It is possible to specify multiple context extensions (obj in the above
|
|
* example).
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Function> CompileFunctionInContext(
|
|
Isolate* isolate, Source* source,
|
|
Local<Context> context, size_t arguments_count,
|
|
Local<String> arguments[],
|
|
size_t context_extension_count,
|
|
Local<Object> context_extensions[]));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext(
|
|
Local<Context> context, Source* source, size_t arguments_count,
|
|
Local<String> arguments[], size_t context_extension_count,
|
|
Local<Object> context_extensions[]);
|
|
|
|
private:
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal(
|
|
Isolate* isolate, Source* source, CompileOptions options);
|
|
};
|
|
|
|
|
|
/**
|
|
* An error message.
|
|
*/
|
|
class V8_EXPORT Message {
|
|
public:
|
|
Local<String> Get() const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine(
|
|
Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the origin for the script from where the function causing the
|
|
* error originates.
|
|
*/
|
|
ScriptOrigin GetScriptOrigin() const;
|
|
|
|
/**
|
|
* Returns the resource name for the script from where the function causing
|
|
* the error originates.
|
|
*/
|
|
Local<Value> GetScriptResourceName() const;
|
|
|
|
/**
|
|
* Exception stack trace. By default stack traces are not captured for
|
|
* uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows
|
|
* to change this option.
|
|
*/
|
|
Local<StackTrace> GetStackTrace() const;
|
|
|
|
/**
|
|
* Returns the number, 1-based, of the line where the error occurred.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the index within the script of the first character where
|
|
* the error occurred.
|
|
*/
|
|
int GetStartPosition() const;
|
|
|
|
/**
|
|
* Returns the index within the script of the last character where
|
|
* the error occurred.
|
|
*/
|
|
int GetEndPosition() const;
|
|
|
|
/**
|
|
* Returns the error level of the message.
|
|
*/
|
|
int ErrorLevel() const;
|
|
|
|
/**
|
|
* Returns the index within the line of the first character where
|
|
* the error occurred.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the index within the line of the last character where
|
|
* the error occurred.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version", int GetEndColumn() const);
|
|
V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const;
|
|
|
|
/**
|
|
* Passes on the value set by the embedder when it fed the script from which
|
|
* this Message was generated to V8.
|
|
*/
|
|
bool IsSharedCrossOrigin() const;
|
|
bool IsOpaque() const;
|
|
|
|
// TODO(1245381): Print to a string instead of on a FILE.
|
|
static void PrintCurrentStackTrace(Isolate* isolate, FILE* out);
|
|
|
|
static const int kNoLineNumberInfo = 0;
|
|
static const int kNoColumnInfo = 0;
|
|
static const int kNoScriptIdInfo = 0;
|
|
};
|
|
|
|
|
|
/**
|
|
* Representation of a JavaScript stack trace. The information collected is a
|
|
* snapshot of the execution stack and the information remains valid after
|
|
* execution continues.
|
|
*/
|
|
class V8_EXPORT StackTrace {
|
|
public:
|
|
/**
|
|
* Flags that determine what information is placed captured for each
|
|
* StackFrame when grabbing the current stack trace.
|
|
* Note: these options are deprecated and we always collect all available
|
|
* information (kDetailed).
|
|
*/
|
|
enum StackTraceOptions {
|
|
kLineNumber = 1,
|
|
kColumnOffset = 1 << 1 | kLineNumber,
|
|
kScriptName = 1 << 2,
|
|
kFunctionName = 1 << 3,
|
|
kIsEval = 1 << 4,
|
|
kIsConstructor = 1 << 5,
|
|
kScriptNameOrSourceURL = 1 << 6,
|
|
kScriptId = 1 << 7,
|
|
kExposeFramesAcrossSecurityOrigins = 1 << 8,
|
|
kOverview = kLineNumber | kColumnOffset | kScriptName | kFunctionName,
|
|
kDetailed = kOverview | kIsEval | kIsConstructor | kScriptNameOrSourceURL
|
|
};
|
|
|
|
/**
|
|
* Returns a StackFrame at a particular index.
|
|
*/
|
|
Local<StackFrame> GetFrame(uint32_t index) const;
|
|
|
|
/**
|
|
* Returns the number of StackFrames.
|
|
*/
|
|
int GetFrameCount() const;
|
|
|
|
/**
|
|
* Returns StackTrace as a v8::Array that contains StackFrame objects.
|
|
*/
|
|
V8_DEPRECATED("Use native API instead", Local<Array> AsArray());
|
|
|
|
/**
|
|
* Grab a snapshot of the current JavaScript execution stack.
|
|
*
|
|
* \param frame_limit The maximum number of stack frames we want to capture.
|
|
* \param options Enumerates the set of things we will capture for each
|
|
* StackFrame.
|
|
*/
|
|
static Local<StackTrace> CurrentStackTrace(
|
|
Isolate* isolate, int frame_limit, StackTraceOptions options = kDetailed);
|
|
};
|
|
|
|
|
|
/**
|
|
* A single JavaScript stack frame.
|
|
*/
|
|
class V8_EXPORT StackFrame {
|
|
public:
|
|
/**
|
|
* Returns the number, 1-based, of the line for the associate function call.
|
|
* This method will return Message::kNoLineNumberInfo if it is unable to
|
|
* retrieve the line number, or if kLineNumber was not passed as an option
|
|
* when capturing the StackTrace.
|
|
*/
|
|
int GetLineNumber() const;
|
|
|
|
/**
|
|
* Returns the 1-based column offset on the line for the associated function
|
|
* call.
|
|
* This method will return Message::kNoColumnInfo if it is unable to retrieve
|
|
* the column number, or if kColumnOffset was not passed as an option when
|
|
* capturing the StackTrace.
|
|
*/
|
|
int GetColumn() const;
|
|
|
|
/**
|
|
* Returns the id of the script for the function for this StackFrame.
|
|
* This method will return Message::kNoScriptIdInfo if it is unable to
|
|
* retrieve the script id, or if kScriptId was not passed as an option when
|
|
* capturing the StackTrace.
|
|
*/
|
|
int GetScriptId() const;
|
|
|
|
/**
|
|
* Returns the name of the resource that contains the script for the
|
|
* function for this StackFrame.
|
|
*/
|
|
Local<String> GetScriptName() const;
|
|
|
|
/**
|
|
* Returns the name of the resource that contains the script for the
|
|
* function for this StackFrame or sourceURL value if the script name
|
|
* is undefined and its source ends with //# sourceURL=... string or
|
|
* deprecated //@ sourceURL=... string.
|
|
*/
|
|
Local<String> GetScriptNameOrSourceURL() const;
|
|
|
|
/**
|
|
* Returns the name of the function associated with this stack frame.
|
|
*/
|
|
Local<String> GetFunctionName() const;
|
|
|
|
/**
|
|
* Returns whether or not the associated function is compiled via a call to
|
|
* eval().
|
|
*/
|
|
bool IsEval() const;
|
|
|
|
/**
|
|
* Returns whether or not the associated function is called as a
|
|
* constructor via "new".
|
|
*/
|
|
bool IsConstructor() const;
|
|
|
|
/**
|
|
* Returns whether or not the associated functions is defined in wasm.
|
|
*/
|
|
bool IsWasm() const;
|
|
};
|
|
|
|
|
|
// A StateTag represents a possible state of the VM.
|
|
enum StateTag { JS, GC, COMPILER, OTHER, EXTERNAL, IDLE };
|
|
|
|
// A RegisterState represents the current state of registers used
|
|
// by the sampling profiler API.
|
|
struct RegisterState {
|
|
RegisterState() : pc(nullptr), sp(nullptr), fp(nullptr) {}
|
|
void* pc; // Instruction pointer.
|
|
void* sp; // Stack pointer.
|
|
void* fp; // Frame pointer.
|
|
};
|
|
|
|
// The output structure filled up by GetStackSample API function.
|
|
struct SampleInfo {
|
|
size_t frames_count; // Number of frames collected.
|
|
StateTag vm_state; // Current VM state.
|
|
void* external_callback_entry; // External callback address if VM is
|
|
// executing an external callback.
|
|
};
|
|
|
|
/**
|
|
* A JSON Parser and Stringifier.
|
|
*/
|
|
class V8_EXPORT JSON {
|
|
public:
|
|
/**
|
|
* Tries to parse the string |json_string| and returns it as value if
|
|
* successful.
|
|
*
|
|
* \param json_string The string to parse.
|
|
* \return The corresponding value if successfully parsed.
|
|
*/
|
|
static V8_DEPRECATED("Use the maybe version taking context",
|
|
Local<Value> Parse(Local<String> json_string));
|
|
static V8_DEPRECATE_SOON("Use the maybe version taking context",
|
|
MaybeLocal<Value> Parse(Isolate* isolate,
|
|
Local<String> json_string));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Value> Parse(
|
|
Local<Context> context, Local<String> json_string);
|
|
|
|
/**
|
|
* Tries to stringify the JSON-serializable object |json_object| and returns
|
|
* it as string if successful.
|
|
*
|
|
* \param json_object The JSON-serializable object to stringify.
|
|
* \return The corresponding string if successfully stringified.
|
|
*/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> Stringify(
|
|
Local<Context> context, Local<Object> json_object,
|
|
Local<String> gap = Local<String>());
|
|
};
|
|
|
|
/**
|
|
* Value serialization compatible with the HTML structured clone algorithm.
|
|
* The format is backward-compatible (i.e. safe to store to disk).
|
|
*
|
|
* WARNING: This API is under development, and changes (including incompatible
|
|
* changes to the API or wire format) may occur without notice until this
|
|
* warning is removed.
|
|
*/
|
|
class V8_EXPORT ValueSerializer {
|
|
public:
|
|
class V8_EXPORT Delegate {
|
|
public:
|
|
virtual ~Delegate() {}
|
|
|
|
/**
|
|
* Handles the case where a DataCloneError would be thrown in the structured
|
|
* clone spec. Other V8 embedders may throw some other appropriate exception
|
|
* type.
|
|
*/
|
|
virtual void ThrowDataCloneError(Local<String> message) = 0;
|
|
|
|
/**
|
|
* The embedder overrides this method to write some kind of host object, if
|
|
* possible. If not, a suitable exception should be thrown and
|
|
* Nothing<bool>() returned.
|
|
*/
|
|
virtual Maybe<bool> WriteHostObject(Isolate* isolate, Local<Object> object);
|
|
|
|
/**
|
|
* Called when the ValueSerializer is going to serialize a
|
|
* SharedArrayBuffer object. The embedder must return an ID for the
|
|
* object, using the same ID if this SharedArrayBuffer has already been
|
|
* serialized in this buffer. When deserializing, this ID will be passed to
|
|
* ValueDeserializer::TransferSharedArrayBuffer as |transfer_id|.
|
|
*
|
|
* If the object cannot be serialized, an
|
|
* exception should be thrown and Nothing<uint32_t>() returned.
|
|
*/
|
|
virtual Maybe<uint32_t> GetSharedArrayBufferId(
|
|
Isolate* isolate, Local<SharedArrayBuffer> shared_array_buffer);
|
|
|
|
virtual Maybe<uint32_t> GetWasmModuleTransferId(
|
|
Isolate* isolate, Local<WasmCompiledModule> module);
|
|
/**
|
|
* Allocates memory for the buffer of at least the size provided. The actual
|
|
* size (which may be greater or equal) is written to |actual_size|. If no
|
|
* buffer has been allocated yet, nullptr will be provided.
|
|
*
|
|
* If the memory cannot be allocated, nullptr should be returned.
|
|
* |actual_size| will be ignored. It is assumed that |old_buffer| is still
|
|
* valid in this case and has not been modified.
|
|
*/
|
|
virtual void* ReallocateBufferMemory(void* old_buffer, size_t size,
|
|
size_t* actual_size);
|
|
|
|
/**
|
|
* Frees a buffer allocated with |ReallocateBufferMemory|.
|
|
*/
|
|
virtual void FreeBufferMemory(void* buffer);
|
|
};
|
|
|
|
explicit ValueSerializer(Isolate* isolate);
|
|
ValueSerializer(Isolate* isolate, Delegate* delegate);
|
|
~ValueSerializer();
|
|
|
|
/**
|
|
* Writes out a header, which includes the format version.
|
|
*/
|
|
void WriteHeader();
|
|
|
|
/**
|
|
* Serializes a JavaScript value into the buffer.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> WriteValue(Local<Context> context,
|
|
Local<Value> value);
|
|
|
|
/**
|
|
* Returns the stored data. This serializer should not be used once the buffer
|
|
* is released. The contents are undefined if a previous write has failed.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use Release()", std::vector<uint8_t> ReleaseBuffer());
|
|
|
|
/**
|
|
* Returns the stored data (allocated using the delegate's
|
|
* AllocateBufferMemory) and its size. This serializer should not be used once
|
|
* the buffer is released. The contents are undefined if a previous write has
|
|
* failed.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT std::pair<uint8_t*, size_t> Release();
|
|
|
|
/**
|
|
* Marks an ArrayBuffer as havings its contents transferred out of band.
|
|
* Pass the corresponding ArrayBuffer in the deserializing context to
|
|
* ValueDeserializer::TransferArrayBuffer.
|
|
*/
|
|
void TransferArrayBuffer(uint32_t transfer_id,
|
|
Local<ArrayBuffer> array_buffer);
|
|
|
|
/**
|
|
* Similar to TransferArrayBuffer, but for SharedArrayBuffer.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use Delegate::GetSharedArrayBufferId",
|
|
void TransferSharedArrayBuffer(
|
|
uint32_t transfer_id,
|
|
Local<SharedArrayBuffer> shared_array_buffer));
|
|
|
|
/**
|
|
* Indicate whether to treat ArrayBufferView objects as host objects,
|
|
* i.e. pass them to Delegate::WriteHostObject. This should not be
|
|
* called when no Delegate was passed.
|
|
*
|
|
* The default is not to treat ArrayBufferViews as host objects.
|
|
*/
|
|
void SetTreatArrayBufferViewsAsHostObjects(bool mode);
|
|
|
|
/**
|
|
* Write raw data in various common formats to the buffer.
|
|
* Note that integer types are written in base-128 varint format, not with a
|
|
* binary copy. For use during an override of Delegate::WriteHostObject.
|
|
*/
|
|
void WriteUint32(uint32_t value);
|
|
void WriteUint64(uint64_t value);
|
|
void WriteDouble(double value);
|
|
void WriteRawBytes(const void* source, size_t length);
|
|
|
|
private:
|
|
ValueSerializer(const ValueSerializer&) = delete;
|
|
void operator=(const ValueSerializer&) = delete;
|
|
|
|
struct PrivateData;
|
|
PrivateData* private_;
|
|
};
|
|
|
|
/**
|
|
* Deserializes values from data written with ValueSerializer, or a compatible
|
|
* implementation.
|
|
*
|
|
* WARNING: This API is under development, and changes (including incompatible
|
|
* changes to the API or wire format) may occur without notice until this
|
|
* warning is removed.
|
|
*/
|
|
class V8_EXPORT ValueDeserializer {
|
|
public:
|
|
class V8_EXPORT Delegate {
|
|
public:
|
|
virtual ~Delegate() {}
|
|
|
|
/**
|
|
* The embedder overrides this method to read some kind of host object, if
|
|
* possible. If not, a suitable exception should be thrown and
|
|
* MaybeLocal<Object>() returned.
|
|
*/
|
|
virtual MaybeLocal<Object> ReadHostObject(Isolate* isolate);
|
|
|
|
/**
|
|
* Get a WasmCompiledModule given a transfer_id previously provided
|
|
* by ValueSerializer::GetWasmModuleTransferId
|
|
*/
|
|
virtual MaybeLocal<WasmCompiledModule> GetWasmModuleFromId(
|
|
Isolate* isolate, uint32_t transfer_id);
|
|
};
|
|
|
|
ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size);
|
|
ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size,
|
|
Delegate* delegate);
|
|
~ValueDeserializer();
|
|
|
|
/**
|
|
* Reads and validates a header (including the format version).
|
|
* May, for example, reject an invalid or unsupported wire format.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> ReadHeader(Local<Context> context);
|
|
|
|
/**
|
|
* Deserializes a JavaScript value from the buffer.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> ReadValue(Local<Context> context);
|
|
|
|
/**
|
|
* Accepts the array buffer corresponding to the one passed previously to
|
|
* ValueSerializer::TransferArrayBuffer.
|
|
*/
|
|
void TransferArrayBuffer(uint32_t transfer_id,
|
|
Local<ArrayBuffer> array_buffer);
|
|
|
|
/**
|
|
* Similar to TransferArrayBuffer, but for SharedArrayBuffer.
|
|
* The id is not necessarily in the same namespace as unshared ArrayBuffer
|
|
* objects.
|
|
*/
|
|
void TransferSharedArrayBuffer(uint32_t id,
|
|
Local<SharedArrayBuffer> shared_array_buffer);
|
|
|
|
/**
|
|
* Must be called before ReadHeader to enable support for reading the legacy
|
|
* wire format (i.e., which predates this being shipped).
|
|
*
|
|
* Don't use this unless you need to read data written by previous versions of
|
|
* blink::ScriptValueSerializer.
|
|
*/
|
|
void SetSupportsLegacyWireFormat(bool supports_legacy_wire_format);
|
|
|
|
/**
|
|
* Expect inline wasm in the data stream (rather than in-memory transfer)
|
|
*/
|
|
void SetExpectInlineWasm(bool allow_inline_wasm);
|
|
|
|
/**
|
|
* Reads the underlying wire format version. Likely mostly to be useful to
|
|
* legacy code reading old wire format versions. Must be called after
|
|
* ReadHeader.
|
|
*/
|
|
uint32_t GetWireFormatVersion() const;
|
|
|
|
/**
|
|
* Reads raw data in various common formats to the buffer.
|
|
* Note that integer types are read in base-128 varint format, not with a
|
|
* binary copy. For use during an override of Delegate::ReadHostObject.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT bool ReadUint32(uint32_t* value);
|
|
V8_WARN_UNUSED_RESULT bool ReadUint64(uint64_t* value);
|
|
V8_WARN_UNUSED_RESULT bool ReadDouble(double* value);
|
|
V8_WARN_UNUSED_RESULT bool ReadRawBytes(size_t length, const void** data);
|
|
|
|
private:
|
|
ValueDeserializer(const ValueDeserializer&) = delete;
|
|
void operator=(const ValueDeserializer&) = delete;
|
|
|
|
struct PrivateData;
|
|
PrivateData* private_;
|
|
};
|
|
|
|
/**
|
|
* A map whose keys are referenced weakly. It is similar to JavaScript WeakMap
|
|
* but can be created without entering a v8::Context and hence shouldn't
|
|
* escape to JavaScript.
|
|
*/
|
|
class V8_EXPORT NativeWeakMap : public Data {
|
|
public:
|
|
static Local<NativeWeakMap> New(Isolate* isolate);
|
|
void Set(Local<Value> key, Local<Value> value);
|
|
Local<Value> Get(Local<Value> key) const;
|
|
bool Has(Local<Value> key);
|
|
bool Delete(Local<Value> key);
|
|
};
|
|
|
|
|
|
// --- Value ---
|
|
|
|
|
|
/**
|
|
* The superclass of all JavaScript values and objects.
|
|
*/
|
|
class V8_EXPORT Value : public Data {
|
|
public:
|
|
/**
|
|
* Returns true if this value is the undefined value. See ECMA-262
|
|
* 4.3.10.
|
|
*/
|
|
V8_INLINE bool IsUndefined() const;
|
|
|
|
/**
|
|
* Returns true if this value is the null value. See ECMA-262
|
|
* 4.3.11.
|
|
*/
|
|
V8_INLINE bool IsNull() const;
|
|
|
|
/**
|
|
* Returns true if this value is either the null or the undefined value.
|
|
* See ECMA-262
|
|
* 4.3.11. and 4.3.12
|
|
*/
|
|
V8_INLINE bool IsNullOrUndefined() const;
|
|
|
|
/**
|
|
* Returns true if this value is true.
|
|
*/
|
|
bool IsTrue() const;
|
|
|
|
/**
|
|
* Returns true if this value is false.
|
|
*/
|
|
bool IsFalse() const;
|
|
|
|
/**
|
|
* Returns true if this value is a symbol or a string.
|
|
*/
|
|
bool IsName() const;
|
|
|
|
/**
|
|
* Returns true if this value is an instance of the String type.
|
|
* See ECMA-262 8.4.
|
|
*/
|
|
V8_INLINE bool IsString() const;
|
|
|
|
/**
|
|
* Returns true if this value is a symbol.
|
|
*/
|
|
bool IsSymbol() const;
|
|
|
|
/**
|
|
* Returns true if this value is a function.
|
|
*/
|
|
bool IsFunction() const;
|
|
|
|
/**
|
|
* Returns true if this value is an array. Note that it will return false for
|
|
* an Proxy for an array.
|
|
*/
|
|
bool IsArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an object.
|
|
*/
|
|
bool IsObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is boolean.
|
|
*/
|
|
bool IsBoolean() const;
|
|
|
|
/**
|
|
* Returns true if this value is a number.
|
|
*/
|
|
bool IsNumber() const;
|
|
|
|
/**
|
|
* Returns true if this value is external.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if this value is a 32-bit signed integer.
|
|
*/
|
|
bool IsInt32() const;
|
|
|
|
/**
|
|
* Returns true if this value is a 32-bit unsigned integer.
|
|
*/
|
|
bool IsUint32() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Date.
|
|
*/
|
|
bool IsDate() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Arguments object.
|
|
*/
|
|
bool IsArgumentsObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Boolean object.
|
|
*/
|
|
bool IsBooleanObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Number object.
|
|
*/
|
|
bool IsNumberObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a String object.
|
|
*/
|
|
bool IsStringObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Symbol object.
|
|
*/
|
|
bool IsSymbolObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a NativeError.
|
|
*/
|
|
bool IsNativeError() const;
|
|
|
|
/**
|
|
* Returns true if this value is a RegExp.
|
|
*/
|
|
bool IsRegExp() const;
|
|
|
|
/**
|
|
* Returns true if this value is an async function.
|
|
*/
|
|
bool IsAsyncFunction() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Generator function.
|
|
*/
|
|
bool IsGeneratorFunction() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Generator object (iterator).
|
|
*/
|
|
bool IsGeneratorObject() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Promise.
|
|
*/
|
|
bool IsPromise() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Map.
|
|
*/
|
|
bool IsMap() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Set.
|
|
*/
|
|
bool IsSet() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Map Iterator.
|
|
*/
|
|
bool IsMapIterator() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Set Iterator.
|
|
*/
|
|
bool IsSetIterator() const;
|
|
|
|
/**
|
|
* Returns true if this value is a WeakMap.
|
|
*/
|
|
bool IsWeakMap() const;
|
|
|
|
/**
|
|
* Returns true if this value is a WeakSet.
|
|
*/
|
|
bool IsWeakSet() const;
|
|
|
|
/**
|
|
* Returns true if this value is an ArrayBuffer.
|
|
*/
|
|
bool IsArrayBuffer() const;
|
|
|
|
/**
|
|
* Returns true if this value is an ArrayBufferView.
|
|
*/
|
|
bool IsArrayBufferView() const;
|
|
|
|
/**
|
|
* Returns true if this value is one of TypedArrays.
|
|
*/
|
|
bool IsTypedArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint8Array.
|
|
*/
|
|
bool IsUint8Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint8ClampedArray.
|
|
*/
|
|
bool IsUint8ClampedArray() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int8Array.
|
|
*/
|
|
bool IsInt8Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint16Array.
|
|
*/
|
|
bool IsUint16Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int16Array.
|
|
*/
|
|
bool IsInt16Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Uint32Array.
|
|
*/
|
|
bool IsUint32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is an Int32Array.
|
|
*/
|
|
bool IsInt32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Float32Array.
|
|
*/
|
|
bool IsFloat32Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a Float64Array.
|
|
*/
|
|
bool IsFloat64Array() const;
|
|
|
|
/**
|
|
* Returns true if this value is a DataView.
|
|
*/
|
|
bool IsDataView() const;
|
|
|
|
/**
|
|
* Returns true if this value is a SharedArrayBuffer.
|
|
* This is an experimental feature.
|
|
*/
|
|
bool IsSharedArrayBuffer() const;
|
|
|
|
/**
|
|
* Returns true if this value is a JavaScript Proxy.
|
|
*/
|
|
bool IsProxy() const;
|
|
|
|
bool IsWebAssemblyCompiledModule() const;
|
|
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ToString(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ToDetailString(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> ToObject(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Integer> ToInteger(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToUint32(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Boolean> ToBoolean(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Number> ToNumber(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<String> ToString(Isolate* isolate) const);
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<String> ToDetailString(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Object> ToObject(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Integer> ToInteger(Isolate* isolate) const);
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Uint32> ToUint32(Isolate* isolate) const);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Int32> ToInt32(Isolate* isolate) const);
|
|
|
|
inline V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Boolean> ToBoolean() const);
|
|
inline V8_DEPRECATED("Use maybe version", Local<Number> ToNumber() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString() const);
|
|
inline V8_DEPRECATED("Use maybe version",
|
|
Local<String> ToDetailString() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject() const);
|
|
inline V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Integer> ToInteger() const);
|
|
inline V8_DEPRECATED("Use maybe version", Local<Uint32> ToUint32() const);
|
|
inline V8_DEPRECATED("Use maybe version", Local<Int32> ToInt32() const);
|
|
|
|
/**
|
|
* Attempts to convert a string to an array index.
|
|
* Returns an empty handle if the conversion fails.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version", Local<Uint32> ToArrayIndex() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex(
|
|
Local<Context> context) const;
|
|
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> BooleanValue(Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<double> NumberValue(Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<int64_t> IntegerValue(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<uint32_t> Uint32Value(
|
|
Local<Context> context) const;
|
|
V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const;
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", double NumberValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value() const);
|
|
V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value() const);
|
|
|
|
/** JS == */
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Equals(Local<Value> that) const);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context,
|
|
Local<Value> that) const;
|
|
bool StrictEquals(Local<Value> that) const;
|
|
bool SameValue(Local<Value> that) const;
|
|
|
|
template <class T> V8_INLINE static Value* Cast(T* value);
|
|
|
|
Local<String> TypeOf(Isolate*);
|
|
|
|
Maybe<bool> InstanceOf(Local<Context> context, Local<Object> object);
|
|
|
|
private:
|
|
V8_INLINE bool QuickIsUndefined() const;
|
|
V8_INLINE bool QuickIsNull() const;
|
|
V8_INLINE bool QuickIsNullOrUndefined() const;
|
|
V8_INLINE bool QuickIsString() const;
|
|
bool FullIsUndefined() const;
|
|
bool FullIsNull() const;
|
|
bool FullIsString() const;
|
|
};
|
|
|
|
|
|
/**
|
|
* The superclass of primitive values. See ECMA-262 4.3.2.
|
|
*/
|
|
class V8_EXPORT Primitive : public Value { };
|
|
|
|
|
|
/**
|
|
* A primitive boolean value (ECMA-262, 4.3.14). Either the true
|
|
* or false value.
|
|
*/
|
|
class V8_EXPORT Boolean : public Primitive {
|
|
public:
|
|
bool Value() const;
|
|
V8_INLINE static Boolean* Cast(v8::Value* obj);
|
|
V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value);
|
|
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A superclass for symbols and strings.
|
|
*/
|
|
class V8_EXPORT Name : public Primitive {
|
|
public:
|
|
/**
|
|
* Returns the identity hash for this object. The current implementation
|
|
* uses an inline property on the object to store the identity hash.
|
|
*
|
|
* The return value will never be 0. Also, it is not guaranteed to be
|
|
* unique.
|
|
*/
|
|
int GetIdentityHash();
|
|
|
|
V8_INLINE static Name* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* A flag describing different modes of string creation.
|
|
*
|
|
* Aside from performance implications there are no differences between the two
|
|
* creation modes.
|
|
*/
|
|
enum class NewStringType {
|
|
/**
|
|
* Create a new string, always allocating new storage memory.
|
|
*/
|
|
kNormal,
|
|
|
|
/**
|
|
* Acts as a hint that the string should be created in the
|
|
* old generation heap space and be deduplicated if an identical string
|
|
* already exists.
|
|
*/
|
|
kInternalized
|
|
};
|
|
|
|
/**
|
|
* A JavaScript string value (ECMA-262, 4.3.17).
|
|
*/
|
|
class V8_EXPORT String : public Name {
|
|
public:
|
|
static const int kMaxLength = (1 << 28) - 16;
|
|
|
|
enum Encoding {
|
|
UNKNOWN_ENCODING = 0x1,
|
|
TWO_BYTE_ENCODING = 0x0,
|
|
ONE_BYTE_ENCODING = 0x8
|
|
};
|
|
/**
|
|
* Returns the number of characters (UTF-16 code units) in this string.
|
|
*/
|
|
int Length() const;
|
|
|
|
/**
|
|
* Returns the number of bytes in the UTF-8 encoded
|
|
* representation of this string.
|
|
*/
|
|
int Utf8Length() const;
|
|
|
|
/**
|
|
* Returns whether this string is known to contain only one byte data,
|
|
* i.e. ISO-8859-1 code points.
|
|
* Does not read the string.
|
|
* False negatives are possible.
|
|
*/
|
|
bool IsOneByte() const;
|
|
|
|
/**
|
|
* Returns whether this string contain only one byte data,
|
|
* i.e. ISO-8859-1 code points.
|
|
* Will read the entire string in some cases.
|
|
*/
|
|
bool ContainsOnlyOneByte() const;
|
|
|
|
/**
|
|
* Write the contents of the string to an external buffer.
|
|
* If no arguments are given, expects the buffer to be large
|
|
* enough to hold the entire string and NULL terminator. Copies
|
|
* the contents of the string and the NULL terminator into the
|
|
* buffer.
|
|
*
|
|
* WriteUtf8 will not write partial UTF-8 sequences, preferring to stop
|
|
* before the end of the buffer.
|
|
*
|
|
* Copies up to length characters into the output buffer.
|
|
* Only null-terminates if there is enough space in the buffer.
|
|
*
|
|
* \param buffer The buffer into which the string will be copied.
|
|
* \param start The starting position within the string at which
|
|
* copying begins.
|
|
* \param length The number of characters to copy from the string. For
|
|
* WriteUtf8 the number of bytes in the buffer.
|
|
* \param nchars_ref The number of characters written, can be NULL.
|
|
* \param options Various options that might affect performance of this or
|
|
* subsequent operations.
|
|
* \return The number of characters copied to the buffer excluding the null
|
|
* terminator. For WriteUtf8: The number of bytes copied to the buffer
|
|
* including the null terminator (if written).
|
|
*/
|
|
enum WriteOptions {
|
|
NO_OPTIONS = 0,
|
|
HINT_MANY_WRITES_EXPECTED = 1,
|
|
NO_NULL_TERMINATION = 2,
|
|
PRESERVE_ONE_BYTE_NULL = 4,
|
|
// Used by WriteUtf8 to replace orphan surrogate code units with the
|
|
// unicode replacement character. Needs to be set to guarantee valid UTF-8
|
|
// output.
|
|
REPLACE_INVALID_UTF8 = 8
|
|
};
|
|
|
|
// 16-bit character codes.
|
|
int Write(uint16_t* buffer,
|
|
int start = 0,
|
|
int length = -1,
|
|
int options = NO_OPTIONS) const;
|
|
// One byte characters.
|
|
int WriteOneByte(uint8_t* buffer,
|
|
int start = 0,
|
|
int length = -1,
|
|
int options = NO_OPTIONS) const;
|
|
// UTF-8 encoded characters.
|
|
int WriteUtf8(char* buffer,
|
|
int length = -1,
|
|
int* nchars_ref = NULL,
|
|
int options = NO_OPTIONS) const;
|
|
|
|
/**
|
|
* A zero length string.
|
|
*/
|
|
V8_INLINE static Local<String> Empty(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns true if the string is external
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if the string is both external and one-byte.
|
|
*/
|
|
bool IsExternalOneByte() const;
|
|
|
|
class V8_EXPORT ExternalStringResourceBase { // NOLINT
|
|
public:
|
|
virtual ~ExternalStringResourceBase() {}
|
|
|
|
virtual bool IsCompressible() const { return false; }
|
|
|
|
protected:
|
|
ExternalStringResourceBase() {}
|
|
|
|
/**
|
|
* Internally V8 will call this Dispose method when the external string
|
|
* resource is no longer needed. The default implementation will use the
|
|
* delete operator. This method can be overridden in subclasses to
|
|
* control how allocated external string resources are disposed.
|
|
*/
|
|
virtual void Dispose() { delete this; }
|
|
|
|
// Disallow copying and assigning.
|
|
ExternalStringResourceBase(const ExternalStringResourceBase&) = delete;
|
|
void operator=(const ExternalStringResourceBase&) = delete;
|
|
|
|
private:
|
|
friend class internal::Heap;
|
|
friend class v8::String;
|
|
};
|
|
|
|
/**
|
|
* An ExternalStringResource is a wrapper around a two-byte string
|
|
* buffer that resides outside V8's heap. Implement an
|
|
* ExternalStringResource to manage the life cycle of the underlying
|
|
* buffer. Note that the string data must be immutable.
|
|
*/
|
|
class V8_EXPORT ExternalStringResource
|
|
: public ExternalStringResourceBase {
|
|
public:
|
|
/**
|
|
* Override the destructor to manage the life cycle of the underlying
|
|
* buffer.
|
|
*/
|
|
virtual ~ExternalStringResource() {}
|
|
|
|
/**
|
|
* The string data from the underlying buffer.
|
|
*/
|
|
virtual const uint16_t* data() const = 0;
|
|
|
|
/**
|
|
* The length of the string. That is, the number of two-byte characters.
|
|
*/
|
|
virtual size_t length() const = 0;
|
|
|
|
protected:
|
|
ExternalStringResource() {}
|
|
};
|
|
|
|
/**
|
|
* An ExternalOneByteStringResource is a wrapper around an one-byte
|
|
* string buffer that resides outside V8's heap. Implement an
|
|
* ExternalOneByteStringResource to manage the life cycle of the
|
|
* underlying buffer. Note that the string data must be immutable
|
|
* and that the data must be Latin-1 and not UTF-8, which would require
|
|
* special treatment internally in the engine and do not allow efficient
|
|
* indexing. Use String::New or convert to 16 bit data for non-Latin1.
|
|
*/
|
|
|
|
class V8_EXPORT ExternalOneByteStringResource
|
|
: public ExternalStringResourceBase {
|
|
public:
|
|
/**
|
|
* Override the destructor to manage the life cycle of the underlying
|
|
* buffer.
|
|
*/
|
|
virtual ~ExternalOneByteStringResource() {}
|
|
/** The string data from the underlying buffer.*/
|
|
virtual const char* data() const = 0;
|
|
/** The number of Latin-1 characters in the string.*/
|
|
virtual size_t length() const = 0;
|
|
protected:
|
|
ExternalOneByteStringResource() {}
|
|
};
|
|
|
|
/**
|
|
* If the string is an external string, return the ExternalStringResourceBase
|
|
* regardless of the encoding, otherwise return NULL. The encoding of the
|
|
* string is returned in encoding_out.
|
|
*/
|
|
V8_INLINE ExternalStringResourceBase* GetExternalStringResourceBase(
|
|
Encoding* encoding_out) const;
|
|
|
|
/**
|
|
* Get the ExternalStringResource for an external string. Returns
|
|
* NULL if IsExternal() doesn't return true.
|
|
*/
|
|
V8_INLINE ExternalStringResource* GetExternalStringResource() const;
|
|
|
|
/**
|
|
* Get the ExternalOneByteStringResource for an external one-byte string.
|
|
* Returns NULL if IsExternalOneByte() doesn't return true.
|
|
*/
|
|
const ExternalOneByteStringResource* GetExternalOneByteStringResource() const;
|
|
|
|
V8_INLINE static String* Cast(v8::Value* obj);
|
|
|
|
// TODO(dcarney): remove with deprecation of New functions.
|
|
enum NewStringType {
|
|
kNormalString = static_cast<int>(v8::NewStringType::kNormal),
|
|
kInternalizedString = static_cast<int>(v8::NewStringType::kInternalized)
|
|
};
|
|
|
|
/** Allocates a new string from UTF-8 data.*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewFromUtf8(Isolate* isolate, const char* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from UTF-8 data. Only returns an empty value when
|
|
* length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromUtf8(
|
|
Isolate* isolate, const char* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/** Allocates a new string from Latin-1 data.*/
|
|
static V8_DEPRECATED(
|
|
"Use maybe version",
|
|
Local<String> NewFromOneByte(Isolate* isolate, const uint8_t* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from Latin-1 data. Only returns an empty value
|
|
* when length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromOneByte(
|
|
Isolate* isolate, const uint8_t* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/** Allocates a new string from UTF-16 data.*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewFromTwoByte(Isolate* isolate, const uint16_t* data,
|
|
NewStringType type = kNormalString,
|
|
int length = -1));
|
|
|
|
/** Allocates a new string from UTF-16 data. Only returns an empty value when
|
|
* length > kMaxLength. **/
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromTwoByte(
|
|
Isolate* isolate, const uint16_t* data, v8::NewStringType type,
|
|
int length = -1);
|
|
|
|
/**
|
|
* Creates a new string by concatenating the left and the right strings
|
|
* passed in as parameters.
|
|
*/
|
|
static Local<String> Concat(Local<String> left, Local<String> right);
|
|
|
|
/**
|
|
* Creates a new external string using the data defined in the given
|
|
* resource. When the external string is no longer live on V8's heap the
|
|
* resource will be disposed by calling its Dispose method. The caller of
|
|
* this function should not otherwise delete or modify the resource. Neither
|
|
* should the underlying buffer be deallocated or modified except through the
|
|
* destructor of the external string resource.
|
|
*/
|
|
static V8_DEPRECATED("Use maybe version",
|
|
Local<String> NewExternal(
|
|
Isolate* isolate, ExternalStringResource* resource));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalTwoByte(
|
|
Isolate* isolate, ExternalStringResource* resource);
|
|
|
|
/**
|
|
* Associate an external string resource with this string by transforming it
|
|
* in place so that existing references to this string in the JavaScript heap
|
|
* will use the external string resource. The external string resource's
|
|
* character contents need to be equivalent to this string.
|
|
* Returns true if the string has been changed to be an external string.
|
|
* The string is not modified if the operation fails. See NewExternal for
|
|
* information on the lifetime of the resource.
|
|
*/
|
|
bool MakeExternal(ExternalStringResource* resource);
|
|
|
|
/**
|
|
* Creates a new external string using the one-byte data defined in the given
|
|
* resource. When the external string is no longer live on V8's heap the
|
|
* resource will be disposed by calling its Dispose method. The caller of
|
|
* this function should not otherwise delete or modify the resource. Neither
|
|
* should the underlying buffer be deallocated or modified except through the
|
|
* destructor of the external string resource.
|
|
*/
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<String> NewExternal(Isolate* isolate,
|
|
ExternalOneByteStringResource* resource));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalOneByte(
|
|
Isolate* isolate, ExternalOneByteStringResource* resource);
|
|
|
|
/**
|
|
* Associate an external string resource with this string by transforming it
|
|
* in place so that existing references to this string in the JavaScript heap
|
|
* will use the external string resource. The external string resource's
|
|
* character contents need to be equivalent to this string.
|
|
* Returns true if the string has been changed to be an external string.
|
|
* The string is not modified if the operation fails. See NewExternal for
|
|
* information on the lifetime of the resource.
|
|
*/
|
|
bool MakeExternal(ExternalOneByteStringResource* resource);
|
|
|
|
/**
|
|
* Returns true if this string can be made external.
|
|
*/
|
|
bool CanMakeExternal();
|
|
|
|
/**
|
|
* Converts an object to a UTF-8-encoded character array. Useful if
|
|
* you want to print the object. If conversion to a string fails
|
|
* (e.g. due to an exception in the toString() method of the object)
|
|
* then the length() method returns 0 and the * operator returns
|
|
* NULL.
|
|
*/
|
|
class V8_EXPORT Utf8Value {
|
|
public:
|
|
explicit Utf8Value(Local<v8::Value> obj);
|
|
~Utf8Value();
|
|
char* operator*() { return str_; }
|
|
const char* operator*() const { return str_; }
|
|
int length() const { return length_; }
|
|
|
|
// Disallow copying and assigning.
|
|
Utf8Value(const Utf8Value&) = delete;
|
|
void operator=(const Utf8Value&) = delete;
|
|
|
|
private:
|
|
char* str_;
|
|
int length_;
|
|
};
|
|
|
|
/**
|
|
* Converts an object to a two-byte (UTF-16-encoded) string.
|
|
* If conversion to a string fails (eg. due to an exception in the toString()
|
|
* method of the object) then the length() method returns 0 and the * operator
|
|
* returns NULL.
|
|
*/
|
|
class V8_EXPORT Value {
|
|
public:
|
|
explicit Value(Local<v8::Value> obj);
|
|
~Value();
|
|
uint16_t* operator*() { return str_; }
|
|
const uint16_t* operator*() const { return str_; }
|
|
int length() const { return length_; }
|
|
|
|
// Disallow copying and assigning.
|
|
Value(const Value&) = delete;
|
|
void operator=(const Value&) = delete;
|
|
|
|
private:
|
|
uint16_t* str_;
|
|
int length_;
|
|
};
|
|
|
|
private:
|
|
void VerifyExternalStringResourceBase(ExternalStringResourceBase* v,
|
|
Encoding encoding) const;
|
|
void VerifyExternalStringResource(ExternalStringResource* val) const;
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript symbol (ECMA-262 edition 6)
|
|
*/
|
|
class V8_EXPORT Symbol : public Name {
|
|
public:
|
|
/**
|
|
* Returns the print name string of the symbol, or undefined if none.
|
|
*/
|
|
Local<Value> Name() const;
|
|
|
|
/**
|
|
* Create a symbol. If name is not empty, it will be used as the description.
|
|
*/
|
|
static Local<Symbol> New(Isolate* isolate,
|
|
Local<String> name = Local<String>());
|
|
|
|
/**
|
|
* Access global symbol registry.
|
|
* Note that symbols created this way are never collected, so
|
|
* they should only be used for statically fixed properties.
|
|
* Also, there is only one global name space for the names used as keys.
|
|
* To minimize the potential for clashes, use qualified names as keys.
|
|
*/
|
|
static Local<Symbol> For(Isolate *isolate, Local<String> name);
|
|
|
|
/**
|
|
* Retrieve a global symbol. Similar to |For|, but using a separate
|
|
* registry that is not accessible by (and cannot clash with) JavaScript code.
|
|
*/
|
|
static Local<Symbol> ForApi(Isolate *isolate, Local<String> name);
|
|
|
|
// Well-known symbols
|
|
static Local<Symbol> GetHasInstance(Isolate* isolate);
|
|
static Local<Symbol> GetIsConcatSpreadable(Isolate* isolate);
|
|
static Local<Symbol> GetIterator(Isolate* isolate);
|
|
static Local<Symbol> GetMatch(Isolate* isolate);
|
|
static Local<Symbol> GetReplace(Isolate* isolate);
|
|
static Local<Symbol> GetSearch(Isolate* isolate);
|
|
static Local<Symbol> GetSplit(Isolate* isolate);
|
|
static Local<Symbol> GetToPrimitive(Isolate* isolate);
|
|
static Local<Symbol> GetToStringTag(Isolate* isolate);
|
|
static Local<Symbol> GetUnscopables(Isolate* isolate);
|
|
|
|
V8_INLINE static Symbol* Cast(Value* obj);
|
|
|
|
private:
|
|
Symbol();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A private symbol
|
|
*
|
|
* This is an experimental feature. Use at your own risk.
|
|
*/
|
|
class V8_EXPORT Private : public Data {
|
|
public:
|
|
/**
|
|
* Returns the print name string of the private symbol, or undefined if none.
|
|
*/
|
|
Local<Value> Name() const;
|
|
|
|
/**
|
|
* Create a private symbol. If name is not empty, it will be the description.
|
|
*/
|
|
static Local<Private> New(Isolate* isolate,
|
|
Local<String> name = Local<String>());
|
|
|
|
/**
|
|
* Retrieve a global private symbol. If a symbol with this name has not
|
|
* been retrieved in the same isolate before, it is created.
|
|
* Note that private symbols created this way are never collected, so
|
|
* they should only be used for statically fixed properties.
|
|
* Also, there is only one global name space for the names used as keys.
|
|
* To minimize the potential for clashes, use qualified names as keys,
|
|
* e.g., "Class#property".
|
|
*/
|
|
static Local<Private> ForApi(Isolate* isolate, Local<String> name);
|
|
|
|
private:
|
|
Private();
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript number value (ECMA-262, 4.3.20)
|
|
*/
|
|
class V8_EXPORT Number : public Primitive {
|
|
public:
|
|
double Value() const;
|
|
static Local<Number> New(Isolate* isolate, double value);
|
|
V8_INLINE static Number* Cast(v8::Value* obj);
|
|
private:
|
|
Number();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a signed integer.
|
|
*/
|
|
class V8_EXPORT Integer : public Number {
|
|
public:
|
|
static Local<Integer> New(Isolate* isolate, int32_t value);
|
|
static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value);
|
|
int64_t Value() const;
|
|
V8_INLINE static Integer* Cast(v8::Value* obj);
|
|
private:
|
|
Integer();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a 32-bit signed integer.
|
|
*/
|
|
class V8_EXPORT Int32 : public Integer {
|
|
public:
|
|
int32_t Value() const;
|
|
V8_INLINE static Int32* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
Int32();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value representing a 32-bit unsigned integer.
|
|
*/
|
|
class V8_EXPORT Uint32 : public Integer {
|
|
public:
|
|
uint32_t Value() const;
|
|
V8_INLINE static Uint32* Cast(v8::Value* obj);
|
|
|
|
private:
|
|
Uint32();
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
/**
|
|
* PropertyAttribute.
|
|
*/
|
|
enum PropertyAttribute {
|
|
/** None. **/
|
|
None = 0,
|
|
/** ReadOnly, i.e., not writable. **/
|
|
ReadOnly = 1 << 0,
|
|
/** DontEnum, i.e., not enumerable. **/
|
|
DontEnum = 1 << 1,
|
|
/** DontDelete, i.e., not configurable. **/
|
|
DontDelete = 1 << 2
|
|
};
|
|
|
|
/**
|
|
* Accessor[Getter|Setter] are used as callback functions when
|
|
* setting|getting a particular property. See Object and ObjectTemplate's
|
|
* method SetAccessor.
|
|
*/
|
|
typedef void (*AccessorGetterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
typedef void (*AccessorNameGetterCallback)(
|
|
Local<Name> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
typedef void (*AccessorSetterCallback)(
|
|
Local<String> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<void>& info);
|
|
typedef void (*AccessorNameSetterCallback)(
|
|
Local<Name> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<void>& info);
|
|
|
|
|
|
/**
|
|
* Access control specifications.
|
|
*
|
|
* Some accessors should be accessible across contexts. These
|
|
* accessors have an explicit access control parameter which specifies
|
|
* the kind of cross-context access that should be allowed.
|
|
*
|
|
* TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused.
|
|
*/
|
|
enum AccessControl {
|
|
DEFAULT = 0,
|
|
ALL_CAN_READ = 1,
|
|
ALL_CAN_WRITE = 1 << 1,
|
|
PROHIBITS_OVERWRITING = 1 << 2
|
|
};
|
|
|
|
/**
|
|
* Property filter bits. They can be or'ed to build a composite filter.
|
|
*/
|
|
enum PropertyFilter {
|
|
ALL_PROPERTIES = 0,
|
|
ONLY_WRITABLE = 1,
|
|
ONLY_ENUMERABLE = 2,
|
|
ONLY_CONFIGURABLE = 4,
|
|
SKIP_STRINGS = 8,
|
|
SKIP_SYMBOLS = 16
|
|
};
|
|
|
|
/**
|
|
* Keys/Properties filter enums:
|
|
*
|
|
* KeyCollectionMode limits the range of collected properties. kOwnOnly limits
|
|
* the collected properties to the given Object only. kIncludesPrototypes will
|
|
* include all keys of the objects's prototype chain as well.
|
|
*/
|
|
enum class KeyCollectionMode { kOwnOnly, kIncludePrototypes };
|
|
|
|
/**
|
|
* kIncludesIndices allows for integer indices to be collected, while
|
|
* kSkipIndices will exclude integer indicies from being collected.
|
|
*/
|
|
enum class IndexFilter { kIncludeIndices, kSkipIndices };
|
|
|
|
/**
|
|
* Integrity level for objects.
|
|
*/
|
|
enum class IntegrityLevel { kFrozen, kSealed };
|
|
|
|
/**
|
|
* A JavaScript object (ECMA-262, 4.3.3)
|
|
*/
|
|
class V8_EXPORT Object : public Value {
|
|
public:
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool Set(Local<Value> key, Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context,
|
|
Local<Value> key, Local<Value> value);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool Set(uint32_t index, Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index,
|
|
Local<Value> value);
|
|
|
|
// Implements CreateDataProperty (ECMA-262, 7.3.4).
|
|
//
|
|
// Defines a configurable, writable, enumerable property with the given value
|
|
// on the object unless the property already exists and is not configurable
|
|
// or the object is not extensible.
|
|
//
|
|
// Returns true on success.
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
|
|
Local<Name> key,
|
|
Local<Value> value);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
|
|
uint32_t index,
|
|
Local<Value> value);
|
|
|
|
// Implements DefineOwnProperty.
|
|
//
|
|
// In general, CreateDataProperty will be faster, however, does not allow
|
|
// for specifying attributes.
|
|
//
|
|
// Returns true on success.
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty(
|
|
Local<Context> context, Local<Name> key, Local<Value> value,
|
|
PropertyAttribute attributes = None);
|
|
|
|
// Implements Object.DefineProperty(O, P, Attributes), see Ecma-262 19.1.2.4.
|
|
//
|
|
// The defineProperty function is used to add an own property or
|
|
// update the attributes of an existing own property of an object.
|
|
//
|
|
// Both data and accessor descriptors can be used.
|
|
//
|
|
// In general, CreateDataProperty is faster, however, does not allow
|
|
// for specifying attributes or an accessor descriptor.
|
|
//
|
|
// The PropertyDescriptor can change when redefining a property.
|
|
//
|
|
// Returns true on success.
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> DefineProperty(
|
|
Local<Context> context, Local<Name> key, PropertyDescriptor& descriptor);
|
|
|
|
// Sets an own property on this object bypassing interceptors and
|
|
// overriding accessors or read-only properties.
|
|
//
|
|
// Note that if the object has an interceptor the property will be set
|
|
// locally, but since the interceptor takes precedence the local property
|
|
// will only be returned if the interceptor doesn't return a value.
|
|
//
|
|
// Note also that this only works for named properties.
|
|
V8_DEPRECATED("Use CreateDataProperty / DefineOwnProperty",
|
|
bool ForceSet(Local<Value> key, Local<Value> value,
|
|
PropertyAttribute attribs = None));
|
|
V8_DEPRECATE_SOON("Use CreateDataProperty / DefineOwnProperty",
|
|
Maybe<bool> ForceSet(Local<Context> context,
|
|
Local<Value> key, Local<Value> value,
|
|
PropertyAttribute attribs = None));
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
uint32_t index);
|
|
|
|
/**
|
|
* Gets the property attributes of a property which can be None or
|
|
* any combination of ReadOnly, DontEnum and DontDelete. Returns
|
|
* None when the property doesn't exist.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
PropertyAttribute GetPropertyAttributes(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes(
|
|
Local<Context> context, Local<Value> key);
|
|
|
|
/**
|
|
* Returns Object.getOwnPropertyDescriptor as per ES5 section 15.2.3.3.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Value> GetOwnPropertyDescriptor(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor(
|
|
Local<Context> context, Local<String> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key));
|
|
/**
|
|
* Object::Has() calls the abstract operation HasProperty(O, P) described
|
|
* in ECMA-262, 7.3.10. Has() returns
|
|
* true, if the object has the property, either own or on the prototype chain.
|
|
* Interceptors, i.e., PropertyQueryCallbacks, are called if present.
|
|
*
|
|
* Has() has the same side effects as JavaScript's `variable in object`.
|
|
* For example, calling Has() on a revoked proxy will throw an exception.
|
|
*
|
|
* \note Has() converts the key to a name, which possibly calls back into
|
|
* JavaScript.
|
|
*
|
|
* See also v8::Object::HasOwnProperty() and
|
|
* v8::Object::HasRealNamedProperty().
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
V8_DEPRECATED("Use maybe version", bool Has(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
uint32_t index);
|
|
|
|
V8_DEPRECATED("Use maybe version", bool Delete(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
uint32_t index);
|
|
|
|
V8_DEPRECATED("Use maybe version",
|
|
bool SetAccessor(Local<String> name,
|
|
AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None));
|
|
V8_DEPRECATED("Use maybe version",
|
|
bool SetAccessor(Local<Name> name,
|
|
AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> SetAccessor(Local<Context> context,
|
|
Local<Name> name,
|
|
AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
MaybeLocal<Value> data = MaybeLocal<Value>(),
|
|
AccessControl settings = DEFAULT,
|
|
PropertyAttribute attribute = None);
|
|
|
|
void SetAccessorProperty(Local<Name> name, Local<Function> getter,
|
|
Local<Function> setter = Local<Function>(),
|
|
PropertyAttribute attribute = None,
|
|
AccessControl settings = DEFAULT);
|
|
|
|
/**
|
|
* Sets a native data property like Template::SetNativeDataProperty, but
|
|
* this method sets on this object directly.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> SetNativeDataProperty(
|
|
Local<Context> context, Local<Name> name,
|
|
AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = nullptr,
|
|
Local<Value> data = Local<Value>(), PropertyAttribute attributes = None);
|
|
|
|
/**
|
|
* Functionality for private properties.
|
|
* This is an experimental feature, use at your own risk.
|
|
* Note: Private properties are not inherited. Do not rely on this, since it
|
|
* may change.
|
|
*/
|
|
Maybe<bool> HasPrivate(Local<Context> context, Local<Private> key);
|
|
Maybe<bool> SetPrivate(Local<Context> context, Local<Private> key,
|
|
Local<Value> value);
|
|
Maybe<bool> DeletePrivate(Local<Context> context, Local<Private> key);
|
|
MaybeLocal<Value> GetPrivate(Local<Context> context, Local<Private> key);
|
|
|
|
/**
|
|
* Returns an array containing the names of the enumerable properties
|
|
* of this object, including properties from prototype objects. The
|
|
* array returned by this method contains the same values as would
|
|
* be enumerated by a for-in statement over this object.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetPropertyNames());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames(
|
|
Local<Context> context);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames(
|
|
Local<Context> context, KeyCollectionMode mode,
|
|
PropertyFilter property_filter, IndexFilter index_filter);
|
|
|
|
/**
|
|
* This function has the same functionality as GetPropertyNames but
|
|
* the returned array doesn't contain the names of properties from
|
|
* prototype objects.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetOwnPropertyNames());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Returns an array containing the names of the filtered properties
|
|
* of this object, including properties from prototype objects. The
|
|
* array returned by this method contains the same values as would
|
|
* be enumerated by a for-in statement over this object.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames(
|
|
Local<Context> context, PropertyFilter filter);
|
|
|
|
/**
|
|
* Get the prototype object. This does not skip objects marked to
|
|
* be skipped by __proto__ and it does not consult the security
|
|
* handler.
|
|
*/
|
|
Local<Value> GetPrototype();
|
|
|
|
/**
|
|
* Set the prototype object. This does not skip objects marked to
|
|
* be skipped by __proto__ and it does not consult the security
|
|
* handler.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version", bool SetPrototype(Local<Value> prototype));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context,
|
|
Local<Value> prototype);
|
|
|
|
/**
|
|
* Finds an instance of the given function template in the prototype
|
|
* chain.
|
|
*/
|
|
Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl);
|
|
|
|
/**
|
|
* Call builtin Object.prototype.toString on this object.
|
|
* This is different from Value::ToString() that may call
|
|
* user-defined toString function. This one does not.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version", Local<String> ObjectProtoToString());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<String> ObjectProtoToString(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Returns the name of the function invoked as a constructor for this object.
|
|
*/
|
|
Local<String> GetConstructorName();
|
|
|
|
/**
|
|
* Sets the integrity level of the object.
|
|
*/
|
|
Maybe<bool> SetIntegrityLevel(Local<Context> context, IntegrityLevel level);
|
|
|
|
/** Gets the number of internal fields for this Object. */
|
|
int InternalFieldCount();
|
|
|
|
/** Same as above, but works for Persistents */
|
|
V8_INLINE static int InternalFieldCount(
|
|
const PersistentBase<Object>& object) {
|
|
return object.val_->InternalFieldCount();
|
|
}
|
|
|
|
/** Gets the value from an internal field. */
|
|
V8_INLINE Local<Value> GetInternalField(int index);
|
|
|
|
/** Sets the value in an internal field. */
|
|
void SetInternalField(int index, Local<Value> value);
|
|
|
|
/**
|
|
* Gets a 2-byte-aligned native pointer from an internal field. This field
|
|
* must have been set by SetAlignedPointerInInternalField, everything else
|
|
* leads to undefined behavior.
|
|
*/
|
|
V8_INLINE void* GetAlignedPointerFromInternalField(int index);
|
|
|
|
/** Same as above, but works for Persistents */
|
|
V8_INLINE static void* GetAlignedPointerFromInternalField(
|
|
const PersistentBase<Object>& object, int index) {
|
|
return object.val_->GetAlignedPointerFromInternalField(index);
|
|
}
|
|
|
|
/**
|
|
* Sets a 2-byte-aligned native pointer in an internal field. To retrieve such
|
|
* a field, GetAlignedPointerFromInternalField must be used, everything else
|
|
* leads to undefined behavior.
|
|
*/
|
|
void SetAlignedPointerInInternalField(int index, void* value);
|
|
void SetAlignedPointerInInternalFields(int argc, int indices[],
|
|
void* values[]);
|
|
|
|
// Testers for local properties.
|
|
V8_DEPRECATED("Use maybe version", bool HasOwnProperty(Local<String> key));
|
|
|
|
/**
|
|
* HasOwnProperty() is like JavaScript's Object.prototype.hasOwnProperty().
|
|
*
|
|
* See also v8::Object::Has() and v8::Object::HasRealNamedProperty().
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context,
|
|
Local<Name> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context,
|
|
uint32_t index);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealNamedProperty(Local<String> key));
|
|
/**
|
|
* Use HasRealNamedProperty() if you want to check if an object has an own
|
|
* property without causing side effects, i.e., without calling interceptors.
|
|
*
|
|
* This function is similar to v8::Object::HasOwnProperty(), but it does not
|
|
* call interceptors.
|
|
*
|
|
* \note Consider using non-masking interceptors, i.e., the interceptors are
|
|
* not called if the receiver has the real named property. See
|
|
* `v8::PropertyHandlerFlags::kNonMasking`.
|
|
*
|
|
* See also v8::Object::Has().
|
|
*/
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context,
|
|
Local<Name> key);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealIndexedProperty(uint32_t index));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty(
|
|
Local<Context> context, uint32_t index);
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
bool HasRealNamedCallbackProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* If result.IsEmpty() no real property was located in the prototype chain.
|
|
* This means interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATED(
|
|
"Use maybe version",
|
|
Local<Value> GetRealNamedPropertyInPrototypeChain(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* Gets the property attributes of a real property in the prototype chain,
|
|
* which can be None or any combination of ReadOnly, DontEnum and DontDelete.
|
|
* Interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATED(
|
|
"Use maybe version",
|
|
Maybe<PropertyAttribute> GetRealNamedPropertyAttributesInPrototypeChain(
|
|
Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute>
|
|
GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context,
|
|
Local<Name> key);
|
|
|
|
/**
|
|
* If result.IsEmpty() no real property was located on the object or
|
|
* in the prototype chain.
|
|
* This means interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Value> GetRealNamedProperty(Local<String> key));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/**
|
|
* Gets the property attributes of a real property which can be
|
|
* None or any combination of ReadOnly, DontEnum and DontDelete.
|
|
* Interceptors in the prototype chain are not called.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
|
|
Local<String> key));
|
|
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
|
|
Local<Context> context, Local<Name> key);
|
|
|
|
/** Tests for a named lookup interceptor.*/
|
|
bool HasNamedLookupInterceptor();
|
|
|
|
/** Tests for an index lookup interceptor.*/
|
|
bool HasIndexedLookupInterceptor();
|
|
|
|
/**
|
|
* Returns the identity hash for this object. The current implementation
|
|
* uses a hidden property on the object to store the identity hash.
|
|
*
|
|
* The return value will never be 0. Also, it is not guaranteed to be
|
|
* unique.
|
|
*/
|
|
int GetIdentityHash();
|
|
|
|
/**
|
|
* Clone this object with a fast but shallow copy. Values will point
|
|
* to the same values as the original object.
|
|
*/
|
|
// TODO(dcarney): take an isolate and optionally bail out?
|
|
Local<Object> Clone();
|
|
|
|
/**
|
|
* Returns the context in which the object was created.
|
|
*/
|
|
Local<Context> CreationContext();
|
|
|
|
/** Same as above, but works for Persistents */
|
|
V8_INLINE static Local<Context> CreationContext(
|
|
const PersistentBase<Object>& object) {
|
|
return object.val_->CreationContext();
|
|
}
|
|
|
|
/**
|
|
* Checks whether a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
* When an Object is callable this method returns true.
|
|
*/
|
|
bool IsCallable();
|
|
|
|
/**
|
|
* True if this object is a constructor.
|
|
*/
|
|
bool IsConstructor();
|
|
|
|
/**
|
|
* Call an Object as a function if a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Value> CallAsFunction(Local<Value> recv, int argc,
|
|
Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context,
|
|
Local<Value> recv,
|
|
int argc,
|
|
Local<Value> argv[]);
|
|
|
|
/**
|
|
* Call an Object as a constructor if a callback is set by the
|
|
* ObjectTemplate::SetCallAsFunctionHandler method.
|
|
* Note: This method behaves like the Function::NewInstance method.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Value> CallAsConstructor(int argc, Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor(
|
|
Local<Context> context, int argc, Local<Value> argv[]);
|
|
|
|
/**
|
|
* Return the isolate to which the Object belongs to.
|
|
*/
|
|
V8_DEPRECATE_SOON("Keep track of isolate correctly", Isolate* GetIsolate());
|
|
|
|
static Local<Object> New(Isolate* isolate);
|
|
|
|
V8_INLINE static Object* Cast(Value* obj);
|
|
|
|
private:
|
|
Object();
|
|
static void CheckCast(Value* obj);
|
|
Local<Value> SlowGetInternalField(int index);
|
|
void* SlowGetAlignedPointerFromInternalField(int index);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in array constructor (ECMA-262, 15.4.2).
|
|
*/
|
|
class V8_EXPORT Array : public Object {
|
|
public:
|
|
uint32_t Length() const;
|
|
|
|
/**
|
|
* Clones an element at index |index|. Returns an empty
|
|
* handle if cloning fails (for any reason).
|
|
*/
|
|
V8_DEPRECATED("Cloning is not supported.",
|
|
Local<Object> CloneElementAt(uint32_t index));
|
|
V8_DEPRECATED("Cloning is not supported.",
|
|
MaybeLocal<Object> CloneElementAt(Local<Context> context,
|
|
uint32_t index));
|
|
|
|
/**
|
|
* Creates a JavaScript array with the given length. If the length
|
|
* is negative the returned array will have length 0.
|
|
*/
|
|
static Local<Array> New(Isolate* isolate, int length = 0);
|
|
|
|
V8_INLINE static Array* Cast(Value* obj);
|
|
private:
|
|
Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1).
|
|
*/
|
|
class V8_EXPORT Map : public Object {
|
|
public:
|
|
size_t Size() const;
|
|
void Clear();
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context,
|
|
Local<Value> key,
|
|
Local<Value> value);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
/**
|
|
* Returns an array of length Size() * 2, where index N is the Nth key and
|
|
* index N + 1 is the Nth value.
|
|
*/
|
|
Local<Array> AsArray() const;
|
|
|
|
/**
|
|
* Creates a new empty Map.
|
|
*/
|
|
static Local<Map> New(Isolate* isolate);
|
|
|
|
V8_INLINE static Map* Cast(Value* obj);
|
|
|
|
private:
|
|
Map();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1).
|
|
*/
|
|
class V8_EXPORT Set : public Object {
|
|
public:
|
|
size_t Size() const;
|
|
void Clear();
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
|
|
Local<Value> key);
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
|
|
Local<Value> key);
|
|
|
|
/**
|
|
* Returns an array of the keys in this Set.
|
|
*/
|
|
Local<Array> AsArray() const;
|
|
|
|
/**
|
|
* Creates a new empty Set.
|
|
*/
|
|
static Local<Set> New(Isolate* isolate);
|
|
|
|
V8_INLINE static Set* Cast(Value* obj);
|
|
|
|
private:
|
|
Set();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
template<typename T>
|
|
class ReturnValue {
|
|
public:
|
|
template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that)
|
|
: value_(that.value_) {
|
|
TYPE_CHECK(T, S);
|
|
}
|
|
// Local setters
|
|
template <typename S>
|
|
V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead",
|
|
void Set(const Persistent<S>& handle));
|
|
template <typename S>
|
|
V8_INLINE void Set(const Global<S>& handle);
|
|
template <typename S>
|
|
V8_INLINE void Set(const Local<S> handle);
|
|
// Fast primitive setters
|
|
V8_INLINE void Set(bool value);
|
|
V8_INLINE void Set(double i);
|
|
V8_INLINE void Set(int32_t i);
|
|
V8_INLINE void Set(uint32_t i);
|
|
// Fast JS primitive setters
|
|
V8_INLINE void SetNull();
|
|
V8_INLINE void SetUndefined();
|
|
V8_INLINE void SetEmptyString();
|
|
// Convenience getter for Isolate
|
|
V8_INLINE Isolate* GetIsolate() const;
|
|
|
|
// Pointer setter: Uncompilable to prevent inadvertent misuse.
|
|
template <typename S>
|
|
V8_INLINE void Set(S* whatever);
|
|
|
|
// Getter. Creates a new Local<> so it comes with a certain performance
|
|
// hit. If the ReturnValue was not yet set, this will return the undefined
|
|
// value.
|
|
V8_INLINE Local<Value> Get() const;
|
|
|
|
private:
|
|
template<class F> friend class ReturnValue;
|
|
template<class F> friend class FunctionCallbackInfo;
|
|
template<class F> friend class PropertyCallbackInfo;
|
|
template <class F, class G, class H>
|
|
friend class PersistentValueMapBase;
|
|
V8_INLINE void SetInternal(internal::Object* value) { *value_ = value; }
|
|
V8_INLINE internal::Object* GetDefaultValue();
|
|
V8_INLINE explicit ReturnValue(internal::Object** slot);
|
|
internal::Object** value_;
|
|
};
|
|
|
|
|
|
/**
|
|
* The argument information given to function call callbacks. This
|
|
* class provides access to information about the context of the call,
|
|
* including the receiver, the number and values of arguments, and
|
|
* the holder of the function.
|
|
*/
|
|
template<typename T>
|
|
class FunctionCallbackInfo {
|
|
public:
|
|
/** The number of available arguments. */
|
|
V8_INLINE int Length() const;
|
|
/** Accessor for the available arguments. */
|
|
V8_INLINE Local<Value> operator[](int i) const;
|
|
V8_INLINE V8_DEPRECATED("Use Data() to explicitly pass Callee instead",
|
|
Local<Function> Callee() const);
|
|
/** Returns the receiver. This corresponds to the "this" value. */
|
|
V8_INLINE Local<Object> This() const;
|
|
/**
|
|
* If the callback was created without a Signature, this is the same
|
|
* value as This(). If there is a signature, and the signature didn't match
|
|
* This() but one of its hidden prototypes, this will be the respective
|
|
* hidden prototype.
|
|
*
|
|
* Note that this is not the prototype of This() on which the accessor
|
|
* referencing this callback was found (which in V8 internally is often
|
|
* referred to as holder [sic]).
|
|
*/
|
|
V8_INLINE Local<Object> Holder() const;
|
|
/** For construct calls, this returns the "new.target" value. */
|
|
V8_INLINE Local<Value> NewTarget() const;
|
|
/** Indicates whether this is a regular call or a construct call. */
|
|
V8_INLINE bool IsConstructCall() const;
|
|
/** The data argument specified when creating the callback. */
|
|
V8_INLINE Local<Value> Data() const;
|
|
/** The current Isolate. */
|
|
V8_INLINE Isolate* GetIsolate() const;
|
|
/** The ReturnValue for the call. */
|
|
V8_INLINE ReturnValue<T> GetReturnValue() const;
|
|
// This shouldn't be public, but the arm compiler needs it.
|
|
static const int kArgsLength = 8;
|
|
|
|
protected:
|
|
friend class internal::FunctionCallbackArguments;
|
|
friend class internal::CustomArguments<FunctionCallbackInfo>;
|
|
friend class debug::ConsoleCallArguments;
|
|
static const int kHolderIndex = 0;
|
|
static const int kIsolateIndex = 1;
|
|
static const int kReturnValueDefaultValueIndex = 2;
|
|
static const int kReturnValueIndex = 3;
|
|
static const int kDataIndex = 4;
|
|
static const int kCalleeIndex = 5;
|
|
static const int kContextSaveIndex = 6;
|
|
static const int kNewTargetIndex = 7;
|
|
|
|
V8_INLINE FunctionCallbackInfo(internal::Object** implicit_args,
|
|
internal::Object** values, int length);
|
|
internal::Object** implicit_args_;
|
|
internal::Object** values_;
|
|
int length_;
|
|
};
|
|
|
|
|
|
/**
|
|
* The information passed to a property callback about the context
|
|
* of the property access.
|
|
*/
|
|
template<typename T>
|
|
class PropertyCallbackInfo {
|
|
public:
|
|
/**
|
|
* \return The isolate of the property access.
|
|
*/
|
|
V8_INLINE Isolate* GetIsolate() const;
|
|
|
|
/**
|
|
* \return The data set in the configuration, i.e., in
|
|
* `NamedPropertyHandlerConfiguration` or
|
|
* `IndexedPropertyHandlerConfiguration.`
|
|
*/
|
|
V8_INLINE Local<Value> Data() const;
|
|
|
|
/**
|
|
* \return The receiver. In many cases, this is the object on which the
|
|
* property access was intercepted. When using
|
|
* `Reflect.get`, `Function.prototype.call`, or similar functions, it is the
|
|
* object passed in as receiver or thisArg.
|
|
*
|
|
* \code
|
|
* void GetterCallback(Local<Name> name,
|
|
* const v8::PropertyCallbackInfo<v8::Value>& info) {
|
|
* auto context = info.GetIsolate()->GetCurrentContext();
|
|
*
|
|
* v8::Local<v8::Value> a_this =
|
|
* info.This()
|
|
* ->GetRealNamedProperty(context, v8_str("a"))
|
|
* .ToLocalChecked();
|
|
* v8::Local<v8::Value> a_holder =
|
|
* info.Holder()
|
|
* ->GetRealNamedProperty(context, v8_str("a"))
|
|
* .ToLocalChecked();
|
|
*
|
|
* CHECK(v8_str("r")->Equals(context, a_this).FromJust());
|
|
* CHECK(v8_str("obj")->Equals(context, a_holder).FromJust());
|
|
*
|
|
* info.GetReturnValue().Set(name);
|
|
* }
|
|
*
|
|
* v8::Local<v8::FunctionTemplate> templ =
|
|
* v8::FunctionTemplate::New(isolate);
|
|
* templ->InstanceTemplate()->SetHandler(
|
|
* v8::NamedPropertyHandlerConfiguration(GetterCallback));
|
|
* LocalContext env;
|
|
* env->Global()
|
|
* ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local())
|
|
* .ToLocalChecked()
|
|
* ->NewInstance(env.local())
|
|
* .ToLocalChecked())
|
|
* .FromJust();
|
|
*
|
|
* CompileRun("obj.a = 'obj'; var r = {a: 'r'}; Reflect.get(obj, 'x', r)");
|
|
* \endcode
|
|
*/
|
|
V8_INLINE Local<Object> This() const;
|
|
|
|
/**
|
|
* \return The object in the prototype chain of the receiver that has the
|
|
* interceptor. Suppose you have `x` and its prototype is `y`, and `y`
|
|
* has an interceptor. Then `info.This()` is `x` and `info.Holder()` is `y`.
|
|
* The Holder() could be a hidden object (the global object, rather
|
|
* than the global proxy).
|
|
*
|
|
* \note For security reasons, do not pass the object back into the runtime.
|
|
*/
|
|
V8_INLINE Local<Object> Holder() const;
|
|
|
|
/**
|
|
* \return The return value of the callback.
|
|
* Can be changed by calling Set().
|
|
* \code
|
|
* info.GetReturnValue().Set(...)
|
|
* \endcode
|
|
*
|
|
*/
|
|
V8_INLINE ReturnValue<T> GetReturnValue() const;
|
|
|
|
/**
|
|
* \return True if the intercepted function should throw if an error occurs.
|
|
* Usually, `true` corresponds to `'use strict'`.
|
|
*
|
|
* \note Always `false` when intercepting `Reflect.set()`
|
|
* independent of the language mode.
|
|
*/
|
|
V8_INLINE bool ShouldThrowOnError() const;
|
|
|
|
// This shouldn't be public, but the arm compiler needs it.
|
|
static const int kArgsLength = 7;
|
|
|
|
protected:
|
|
friend class MacroAssembler;
|
|
friend class internal::PropertyCallbackArguments;
|
|
friend class internal::CustomArguments<PropertyCallbackInfo>;
|
|
static const int kShouldThrowOnErrorIndex = 0;
|
|
static const int kHolderIndex = 1;
|
|
static const int kIsolateIndex = 2;
|
|
static const int kReturnValueDefaultValueIndex = 3;
|
|
static const int kReturnValueIndex = 4;
|
|
static const int kDataIndex = 5;
|
|
static const int kThisIndex = 6;
|
|
|
|
V8_INLINE PropertyCallbackInfo(internal::Object** args) : args_(args) {}
|
|
internal::Object** args_;
|
|
};
|
|
|
|
|
|
typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info);
|
|
|
|
enum class ConstructorBehavior { kThrow, kAllow };
|
|
|
|
/**
|
|
* A JavaScript function object (ECMA-262, 15.3).
|
|
*/
|
|
class V8_EXPORT Function : public Object {
|
|
public:
|
|
/**
|
|
* Create a function in the current execution context
|
|
* for a given FunctionCallback.
|
|
*/
|
|
static MaybeLocal<Function> New(
|
|
Local<Context> context, FunctionCallback callback,
|
|
Local<Value> data = Local<Value>(), int length = 0,
|
|
ConstructorBehavior behavior = ConstructorBehavior::kAllow);
|
|
static V8_DEPRECATE_SOON(
|
|
"Use maybe version",
|
|
Local<Function> New(Isolate* isolate, FunctionCallback callback,
|
|
Local<Value> data = Local<Value>(), int length = 0));
|
|
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Object> NewInstance(int argc, Local<Value> argv[]) const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
|
|
Local<Context> context, int argc, Local<Value> argv[]) const;
|
|
|
|
V8_DEPRECATED("Use maybe version", Local<Object> NewInstance() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
|
|
Local<Context> context) const {
|
|
return NewInstance(context, 0, nullptr);
|
|
}
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Value> Call(Local<Value> recv, int argc,
|
|
Local<Value> argv[]));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context,
|
|
Local<Value> recv, int argc,
|
|
Local<Value> argv[]);
|
|
|
|
void SetName(Local<String> name);
|
|
Local<Value> GetName() const;
|
|
|
|
/**
|
|
* Name inferred from variable or property assignment of this function.
|
|
* Used to facilitate debugging and profiling of JavaScript code written
|
|
* in an OO style, where many functions are anonymous but are assigned
|
|
* to object properties.
|
|
*/
|
|
Local<Value> GetInferredName() const;
|
|
|
|
/**
|
|
* displayName if it is set, otherwise name if it is configured, otherwise
|
|
* function name, otherwise inferred name.
|
|
*/
|
|
Local<Value> GetDebugName() const;
|
|
|
|
/**
|
|
* User-defined name assigned to the "displayName" property of this function.
|
|
* Used to facilitate debugging and profiling of JavaScript code.
|
|
*/
|
|
Local<Value> GetDisplayName() const;
|
|
|
|
/**
|
|
* Returns zero based line number of function body and
|
|
* kLineOffsetNotFound if no information available.
|
|
*/
|
|
int GetScriptLineNumber() const;
|
|
/**
|
|
* Returns zero based column number of function body and
|
|
* kLineOffsetNotFound if no information available.
|
|
*/
|
|
int GetScriptColumnNumber() const;
|
|
|
|
/**
|
|
* Tells whether this function is builtin.
|
|
*/
|
|
V8_DEPRECATED("this should no longer be used.", bool IsBuiltin() const);
|
|
|
|
/**
|
|
* Returns scriptId.
|
|
*/
|
|
int ScriptId() const;
|
|
|
|
/**
|
|
* Returns the original function if this function is bound, else returns
|
|
* v8::Undefined.
|
|
*/
|
|
Local<Value> GetBoundFunction() const;
|
|
|
|
ScriptOrigin GetScriptOrigin() const;
|
|
V8_INLINE static Function* Cast(Value* obj);
|
|
static const int kLineOffsetNotFound;
|
|
|
|
private:
|
|
Function();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Promise constructor (ES6 draft).
|
|
*/
|
|
class V8_EXPORT Promise : public Object {
|
|
public:
|
|
/**
|
|
* State of the promise. Each value corresponds to one of the possible values
|
|
* of the [[PromiseState]] field.
|
|
*/
|
|
enum PromiseState { kPending, kFulfilled, kRejected };
|
|
|
|
class V8_EXPORT Resolver : public Object {
|
|
public:
|
|
/**
|
|
* Create a new resolver, along with an associated promise in pending state.
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<Resolver> New(Isolate* isolate));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Resolver> New(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Extract the associated promise.
|
|
*/
|
|
Local<Promise> GetPromise();
|
|
|
|
/**
|
|
* Resolve/reject the associated promise with a given value.
|
|
* Ignored if the promise is no longer pending.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version", void Resolve(Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Resolve(Local<Context> context,
|
|
Local<Value> value);
|
|
|
|
V8_DEPRECATE_SOON("Use maybe version", void Reject(Local<Value> value));
|
|
V8_WARN_UNUSED_RESULT Maybe<bool> Reject(Local<Context> context,
|
|
Local<Value> value);
|
|
|
|
V8_INLINE static Resolver* Cast(Value* obj);
|
|
|
|
private:
|
|
Resolver();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* Register a resolution/rejection handler with a promise.
|
|
* The handler is given the respective resolution/rejection value as
|
|
* an argument. If the promise is already resolved/rejected, the handler is
|
|
* invoked at the end of turn.
|
|
*/
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Promise> Catch(Local<Function> handler));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context,
|
|
Local<Function> handler);
|
|
|
|
V8_DEPRECATED("Use maybe version",
|
|
Local<Promise> Then(Local<Function> handler));
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context,
|
|
Local<Function> handler);
|
|
|
|
/**
|
|
* Returns true if the promise has at least one derived promise, and
|
|
* therefore resolve/reject handlers (including default handler).
|
|
*/
|
|
bool HasHandler();
|
|
|
|
/**
|
|
* Returns the content of the [[PromiseResult]] field. The Promise must not
|
|
* be pending.
|
|
*/
|
|
Local<Value> Result();
|
|
|
|
/**
|
|
* Returns the value of the [[PromiseState]] field.
|
|
*/
|
|
PromiseState State();
|
|
|
|
V8_INLINE static Promise* Cast(Value* obj);
|
|
|
|
private:
|
|
Promise();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* An instance of a Property Descriptor, see Ecma-262 6.2.4.
|
|
*
|
|
* Properties in a descriptor are present or absent. If you do not set
|
|
* `enumerable`, `configurable`, and `writable`, they are absent. If `value`,
|
|
* `get`, or `set` are absent, but you must specify them in the constructor, use
|
|
* empty handles.
|
|
*
|
|
* Accessors `get` and `set` must be callable or undefined if they are present.
|
|
*
|
|
* \note Only query properties if they are present, i.e., call `x()` only if
|
|
* `has_x()` returns true.
|
|
*
|
|
* \code
|
|
* // var desc = {writable: false}
|
|
* v8::PropertyDescriptor d(Local<Value>()), false);
|
|
* d.value(); // error, value not set
|
|
* if (d.has_writable()) {
|
|
* d.writable(); // false
|
|
* }
|
|
*
|
|
* // var desc = {value: undefined}
|
|
* v8::PropertyDescriptor d(v8::Undefined(isolate));
|
|
*
|
|
* // var desc = {get: undefined}
|
|
* v8::PropertyDescriptor d(v8::Undefined(isolate), Local<Value>()));
|
|
* \endcode
|
|
*/
|
|
class V8_EXPORT PropertyDescriptor {
|
|
public:
|
|
// GenericDescriptor
|
|
PropertyDescriptor();
|
|
|
|
// DataDescriptor
|
|
PropertyDescriptor(Local<Value> value);
|
|
|
|
// DataDescriptor with writable property
|
|
PropertyDescriptor(Local<Value> value, bool writable);
|
|
|
|
// AccessorDescriptor
|
|
PropertyDescriptor(Local<Value> get, Local<Value> set);
|
|
|
|
~PropertyDescriptor();
|
|
|
|
Local<Value> value() const;
|
|
bool has_value() const;
|
|
|
|
Local<Value> get() const;
|
|
bool has_get() const;
|
|
Local<Value> set() const;
|
|
bool has_set() const;
|
|
|
|
void set_enumerable(bool enumerable);
|
|
bool enumerable() const;
|
|
bool has_enumerable() const;
|
|
|
|
void set_configurable(bool configurable);
|
|
bool configurable() const;
|
|
bool has_configurable() const;
|
|
|
|
bool writable() const;
|
|
bool has_writable() const;
|
|
|
|
struct PrivateData;
|
|
PrivateData* get_private() const { return private_; }
|
|
|
|
PropertyDescriptor(const PropertyDescriptor&) = delete;
|
|
void operator=(const PropertyDescriptor&) = delete;
|
|
|
|
private:
|
|
PrivateData* private_;
|
|
};
|
|
|
|
/**
|
|
* An instance of the built-in Proxy constructor (ECMA-262, 6th Edition,
|
|
* 26.2.1).
|
|
*/
|
|
class V8_EXPORT Proxy : public Object {
|
|
public:
|
|
Local<Object> GetTarget();
|
|
Local<Value> GetHandler();
|
|
bool IsRevoked();
|
|
void Revoke();
|
|
|
|
/**
|
|
* Creates a new Proxy for the target object.
|
|
*/
|
|
static MaybeLocal<Proxy> New(Local<Context> context,
|
|
Local<Object> local_target,
|
|
Local<Object> local_handler);
|
|
|
|
V8_INLINE static Proxy* Cast(Value* obj);
|
|
|
|
private:
|
|
Proxy();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
// TODO(mtrofin): rename WasmCompiledModule to WasmModuleObject, for
|
|
// consistency with internal APIs.
|
|
class V8_EXPORT WasmCompiledModule : public Object {
|
|
public:
|
|
typedef std::pair<std::unique_ptr<const uint8_t[]>, size_t> SerializedModule;
|
|
// A buffer that is owned by the caller.
|
|
typedef std::pair<const uint8_t*, size_t> CallerOwnedBuffer;
|
|
|
|
// An opaque, native heap object for transferring wasm modules. It
|
|
// supports move semantics, and does not support copy semantics.
|
|
class TransferrableModule final {
|
|
public:
|
|
TransferrableModule(TransferrableModule&& src) = default;
|
|
TransferrableModule(const TransferrableModule& src) = delete;
|
|
|
|
TransferrableModule& operator=(TransferrableModule&& src) = default;
|
|
TransferrableModule& operator=(const TransferrableModule& src) = delete;
|
|
|
|
private:
|
|
typedef std::pair<std::unique_ptr<const uint8_t[]>, size_t> OwnedBuffer;
|
|
friend class WasmCompiledModule;
|
|
TransferrableModule(OwnedBuffer&& code, OwnedBuffer&& bytes)
|
|
: compiled_code(std::move(code)), wire_bytes(std::move(bytes)) {}
|
|
|
|
OwnedBuffer compiled_code = {nullptr, 0};
|
|
OwnedBuffer wire_bytes = {nullptr, 0};
|
|
};
|
|
|
|
// Get an in-memory, non-persistable, and context-independent (meaning,
|
|
// suitable for transfer to another Isolate and Context) representation
|
|
// of this wasm compiled module.
|
|
TransferrableModule GetTransferrableModule();
|
|
|
|
// Efficiently re-create a WasmCompiledModule, without recompiling, from
|
|
// a TransferrableModule.
|
|
static MaybeLocal<WasmCompiledModule> FromTransferrableModule(
|
|
Isolate* isolate, const TransferrableModule&);
|
|
|
|
// Get the wasm-encoded bytes that were used to compile this module.
|
|
Local<String> GetWasmWireBytes();
|
|
|
|
// Serialize the compiled module. The serialized data does not include the
|
|
// uncompiled bytes.
|
|
SerializedModule Serialize();
|
|
|
|
// If possible, deserialize the module, otherwise compile it from the provided
|
|
// uncompiled bytes.
|
|
static MaybeLocal<WasmCompiledModule> DeserializeOrCompile(
|
|
Isolate* isolate, const CallerOwnedBuffer& serialized_module,
|
|
const CallerOwnedBuffer& wire_bytes);
|
|
V8_INLINE static WasmCompiledModule* Cast(Value* obj);
|
|
|
|
private:
|
|
// TODO(ahaas): please remove the friend once streamed compilation is
|
|
// implemented
|
|
friend class WasmModuleObjectBuilder;
|
|
|
|
static MaybeLocal<WasmCompiledModule> Deserialize(
|
|
Isolate* isolate, const CallerOwnedBuffer& serialized_module,
|
|
const CallerOwnedBuffer& wire_bytes);
|
|
static MaybeLocal<WasmCompiledModule> Compile(Isolate* isolate,
|
|
const uint8_t* start,
|
|
size_t length);
|
|
static CallerOwnedBuffer AsCallerOwned(
|
|
const TransferrableModule::OwnedBuffer& buff) {
|
|
return {buff.first.get(), buff.second};
|
|
}
|
|
|
|
WasmCompiledModule();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
class V8_EXPORT WasmModuleObjectBuilder final {
|
|
public:
|
|
WasmModuleObjectBuilder(Isolate* isolate) : isolate_(isolate) {}
|
|
// The buffer passed into OnBytesReceived is owned by the caller.
|
|
void OnBytesReceived(const uint8_t*, size_t size);
|
|
MaybeLocal<WasmCompiledModule> Finish();
|
|
|
|
private:
|
|
Isolate* isolate_ = nullptr;
|
|
// TODO(ahaas): We probably need none of this below here once streamed
|
|
// compilation is implemented.
|
|
typedef std::pair<std::unique_ptr<const uint8_t[]>, size_t> Buffer;
|
|
|
|
// Disable copy semantics *in this implementation*. We can choose to
|
|
// relax this, albeit it's not clear why.
|
|
WasmModuleObjectBuilder(const WasmModuleObjectBuilder&) = delete;
|
|
WasmModuleObjectBuilder(WasmModuleObjectBuilder&&) = default;
|
|
WasmModuleObjectBuilder& operator=(const WasmModuleObjectBuilder&) = delete;
|
|
WasmModuleObjectBuilder& operator=(WasmModuleObjectBuilder&&) = default;
|
|
|
|
std::vector<Buffer> received_buffers_;
|
|
size_t total_size_ = 0;
|
|
};
|
|
|
|
#ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT
|
|
// The number of required internal fields can be defined by embedder.
|
|
#define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2
|
|
#endif
|
|
|
|
|
|
enum class ArrayBufferCreationMode { kInternalized, kExternalized };
|
|
|
|
|
|
/**
|
|
* An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5).
|
|
*/
|
|
class V8_EXPORT ArrayBuffer : public Object {
|
|
public:
|
|
/**
|
|
* A thread-safe allocator that V8 uses to allocate |ArrayBuffer|'s memory.
|
|
* The allocator is a global V8 setting. It has to be set via
|
|
* Isolate::CreateParams.
|
|
*
|
|
* Memory allocated through this allocator by V8 is accounted for as external
|
|
* memory by V8. Note that V8 keeps track of the memory for all internalized
|
|
* |ArrayBuffer|s. Responsibility for tracking external memory (using
|
|
* Isolate::AdjustAmountOfExternalAllocatedMemory) is handed over to the
|
|
* embedder upon externalization and taken over upon internalization (creating
|
|
* an internalized buffer from an existing buffer).
|
|
*
|
|
* Note that it is unsafe to call back into V8 from any of the allocator
|
|
* functions.
|
|
*/
|
|
class V8_EXPORT Allocator { // NOLINT
|
|
public:
|
|
virtual ~Allocator() {}
|
|
|
|
/**
|
|
* Allocate |length| bytes. Return NULL if allocation is not successful.
|
|
* Memory should be initialized to zeroes.
|
|
*/
|
|
virtual void* Allocate(size_t length) = 0;
|
|
|
|
/**
|
|
* Allocate |length| bytes. Return NULL if allocation is not successful.
|
|
* Memory does not have to be initialized.
|
|
*/
|
|
virtual void* AllocateUninitialized(size_t length) = 0;
|
|
|
|
/**
|
|
* Free the memory block of size |length|, pointed to by |data|.
|
|
* That memory is guaranteed to be previously allocated by |Allocate|.
|
|
*/
|
|
virtual void Free(void* data, size_t length) = 0;
|
|
|
|
/**
|
|
* malloc/free based convenience allocator.
|
|
*
|
|
* Caller takes ownership, i.e. the returned object needs to be freed using
|
|
* |delete allocator| once it is no longer in use.
|
|
*/
|
|
static Allocator* NewDefaultAllocator();
|
|
};
|
|
|
|
/**
|
|
* The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer|
|
|
* returns an instance of this class, populated, with a pointer to data
|
|
* and byte length.
|
|
*
|
|
* The Data pointer of ArrayBuffer::Contents is always allocated with
|
|
* Allocator::Allocate that is set via Isolate::CreateParams.
|
|
*/
|
|
class V8_EXPORT Contents { // NOLINT
|
|
public:
|
|
Contents() : data_(NULL), byte_length_(0) {}
|
|
|
|
void* Data() const { return data_; }
|
|
size_t ByteLength() const { return byte_length_; }
|
|
|
|
private:
|
|
void* data_;
|
|
size_t byte_length_;
|
|
|
|
friend class ArrayBuffer;
|
|
};
|
|
|
|
|
|
/**
|
|
* Data length in bytes.
|
|
*/
|
|
size_t ByteLength() const;
|
|
|
|
/**
|
|
* Create a new ArrayBuffer. Allocate |byte_length| bytes.
|
|
* Allocated memory will be owned by a created ArrayBuffer and
|
|
* will be deallocated when it is garbage-collected,
|
|
* unless the object is externalized.
|
|
*/
|
|
static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length);
|
|
|
|
/**
|
|
* Create a new ArrayBuffer over an existing memory block.
|
|
* The created array buffer is by default immediately in externalized state.
|
|
* In externalized state, the memory block will not be reclaimed when a
|
|
* created ArrayBuffer is garbage-collected.
|
|
* In internalized state, the memory block will be released using
|
|
* |Allocator::Free| once all ArrayBuffers referencing it are collected by
|
|
* the garbage collector.
|
|
*/
|
|
static Local<ArrayBuffer> New(
|
|
Isolate* isolate, void* data, size_t byte_length,
|
|
ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
|
|
|
|
/**
|
|
* Returns true if ArrayBuffer is externalized, that is, does not
|
|
* own its memory block.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Returns true if this ArrayBuffer may be neutered.
|
|
*/
|
|
bool IsNeuterable() const;
|
|
|
|
/**
|
|
* Neuters this ArrayBuffer and all its views (typed arrays).
|
|
* Neutering sets the byte length of the buffer and all typed arrays to zero,
|
|
* preventing JavaScript from ever accessing underlying backing store.
|
|
* ArrayBuffer should have been externalized and must be neuterable.
|
|
*/
|
|
void Neuter();
|
|
|
|
/**
|
|
* Make this ArrayBuffer external. The pointer to underlying memory block
|
|
* and byte length are returned as |Contents| structure. After ArrayBuffer
|
|
* had been externalized, it does no longer own the memory block. The caller
|
|
* should take steps to free memory when it is no longer needed.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* that has been set via Isolate::CreateParams.
|
|
*/
|
|
Contents Externalize();
|
|
|
|
/**
|
|
* Get a pointer to the ArrayBuffer's underlying memory block without
|
|
* externalizing it. If the ArrayBuffer is not externalized, this pointer
|
|
* will become invalid as soon as the ArrayBuffer gets garbage collected.
|
|
*
|
|
* The embedder should make sure to hold a strong reference to the
|
|
* ArrayBuffer while accessing this pointer.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|.
|
|
*/
|
|
Contents GetContents();
|
|
|
|
V8_INLINE static ArrayBuffer* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
|
|
static const int kEmbedderFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
ArrayBuffer();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
#ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT
|
|
// The number of required internal fields can be defined by embedder.
|
|
#define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2
|
|
#endif
|
|
|
|
|
|
/**
|
|
* A base class for an instance of one of "views" over ArrayBuffer,
|
|
* including TypedArrays and DataView (ES6 draft 15.13).
|
|
*/
|
|
class V8_EXPORT ArrayBufferView : public Object {
|
|
public:
|
|
/**
|
|
* Returns underlying ArrayBuffer.
|
|
*/
|
|
Local<ArrayBuffer> Buffer();
|
|
/**
|
|
* Byte offset in |Buffer|.
|
|
*/
|
|
size_t ByteOffset();
|
|
/**
|
|
* Size of a view in bytes.
|
|
*/
|
|
size_t ByteLength();
|
|
|
|
/**
|
|
* Copy the contents of the ArrayBufferView's buffer to an embedder defined
|
|
* memory without additional overhead that calling ArrayBufferView::Buffer
|
|
* might incur.
|
|
*
|
|
* Will write at most min(|byte_length|, ByteLength) bytes starting at
|
|
* ByteOffset of the underlying buffer to the memory starting at |dest|.
|
|
* Returns the number of bytes actually written.
|
|
*/
|
|
size_t CopyContents(void* dest, size_t byte_length);
|
|
|
|
/**
|
|
* Returns true if ArrayBufferView's backing ArrayBuffer has already been
|
|
* allocated.
|
|
*/
|
|
bool HasBuffer() const;
|
|
|
|
V8_INLINE static ArrayBufferView* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount =
|
|
V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT;
|
|
static const int kEmbedderFieldCount =
|
|
V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
ArrayBufferView();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A base class for an instance of TypedArray series of constructors
|
|
* (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT TypedArray : public ArrayBufferView {
|
|
public:
|
|
/**
|
|
* Number of elements in this typed array
|
|
* (e.g. for Int16Array, |ByteLength|/2).
|
|
*/
|
|
size_t Length();
|
|
|
|
V8_INLINE static TypedArray* Cast(Value* obj);
|
|
|
|
private:
|
|
TypedArray();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint8Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Uint8Array : public TypedArray {
|
|
public:
|
|
static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint8Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint8Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Uint8ClampedArray : public TypedArray {
|
|
public:
|
|
static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint8ClampedArray> New(
|
|
Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset,
|
|
size_t length);
|
|
V8_INLINE static Uint8ClampedArray* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint8ClampedArray();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
/**
|
|
* An instance of Int8Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Int8Array : public TypedArray {
|
|
public:
|
|
static Local<Int8Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int8Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int8Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint16Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Uint16Array : public TypedArray {
|
|
public:
|
|
static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint16Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint16Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Int16Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Int16Array : public TypedArray {
|
|
public:
|
|
static Local<Int16Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int16Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int16Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Uint32Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Uint32Array : public TypedArray {
|
|
public:
|
|
static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Uint32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Uint32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Int32Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Int32Array : public TypedArray {
|
|
public:
|
|
static Local<Int32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Int32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Int32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Float32Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Float32Array : public TypedArray {
|
|
public:
|
|
static Local<Float32Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Float32Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Float32Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of Float64Array constructor (ES6 draft 15.13.6).
|
|
*/
|
|
class V8_EXPORT Float64Array : public TypedArray {
|
|
public:
|
|
static Local<Float64Array> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static Float64Array* Cast(Value* obj);
|
|
|
|
private:
|
|
Float64Array();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of DataView constructor (ES6 draft 15.13.7).
|
|
*/
|
|
class V8_EXPORT DataView : public ArrayBufferView {
|
|
public:
|
|
static Local<DataView> New(Local<ArrayBuffer> array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer,
|
|
size_t byte_offset, size_t length);
|
|
V8_INLINE static DataView* Cast(Value* obj);
|
|
|
|
private:
|
|
DataView();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in SharedArrayBuffer constructor.
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT SharedArrayBuffer : public Object {
|
|
public:
|
|
/**
|
|
* The contents of an |SharedArrayBuffer|. Externalization of
|
|
* |SharedArrayBuffer| returns an instance of this class, populated, with a
|
|
* pointer to data and byte length.
|
|
*
|
|
* The Data pointer of SharedArrayBuffer::Contents is always allocated with
|
|
* |ArrayBuffer::Allocator::Allocate| by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*
|
|
* This API is experimental and may change significantly.
|
|
*/
|
|
class V8_EXPORT Contents { // NOLINT
|
|
public:
|
|
Contents() : data_(NULL), byte_length_(0) {}
|
|
|
|
void* Data() const { return data_; }
|
|
size_t ByteLength() const { return byte_length_; }
|
|
|
|
private:
|
|
void* data_;
|
|
size_t byte_length_;
|
|
|
|
friend class SharedArrayBuffer;
|
|
};
|
|
|
|
|
|
/**
|
|
* Data length in bytes.
|
|
*/
|
|
size_t ByteLength() const;
|
|
|
|
/**
|
|
* Create a new SharedArrayBuffer. Allocate |byte_length| bytes.
|
|
* Allocated memory will be owned by a created SharedArrayBuffer and
|
|
* will be deallocated when it is garbage-collected,
|
|
* unless the object is externalized.
|
|
*/
|
|
static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length);
|
|
|
|
/**
|
|
* Create a new SharedArrayBuffer over an existing memory block. The created
|
|
* array buffer is immediately in externalized state unless otherwise
|
|
* specified. The memory block will not be reclaimed when a created
|
|
* SharedArrayBuffer is garbage-collected.
|
|
*/
|
|
static Local<SharedArrayBuffer> New(
|
|
Isolate* isolate, void* data, size_t byte_length,
|
|
ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
|
|
|
|
/**
|
|
* Returns true if SharedArrayBuffer is externalized, that is, does not
|
|
* own its memory block.
|
|
*/
|
|
bool IsExternal() const;
|
|
|
|
/**
|
|
* Make this SharedArrayBuffer external. The pointer to underlying memory
|
|
* block and byte length are returned as |Contents| structure. After
|
|
* SharedArrayBuffer had been externalized, it does no longer own the memory
|
|
* block. The caller should take steps to free memory when it is no longer
|
|
* needed.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*
|
|
*/
|
|
Contents Externalize();
|
|
|
|
/**
|
|
* Get a pointer to the ArrayBuffer's underlying memory block without
|
|
* externalizing it. If the ArrayBuffer is not externalized, this pointer
|
|
* will become invalid as soon as the ArrayBuffer became garbage collected.
|
|
*
|
|
* The embedder should make sure to hold a strong reference to the
|
|
* ArrayBuffer while accessing this pointer.
|
|
*
|
|
* The memory block is guaranteed to be allocated with |Allocator::Allocate|
|
|
* by the allocator specified in
|
|
* v8::Isolate::CreateParams::array_buffer_allocator.
|
|
*/
|
|
Contents GetContents();
|
|
|
|
V8_INLINE static SharedArrayBuffer* Cast(Value* obj);
|
|
|
|
static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
|
|
|
|
private:
|
|
SharedArrayBuffer();
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in Date constructor (ECMA-262, 15.9).
|
|
*/
|
|
class V8_EXPORT Date : public Object {
|
|
public:
|
|
static V8_DEPRECATE_SOON("Use maybe version.",
|
|
Local<Value> New(Isolate* isolate, double time));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<Value> New(Local<Context> context,
|
|
double time);
|
|
|
|
/**
|
|
* A specialization of Value::NumberValue that is more efficient
|
|
* because we know the structure of this object.
|
|
*/
|
|
double ValueOf() const;
|
|
|
|
V8_INLINE static Date* Cast(Value* obj);
|
|
|
|
/**
|
|
* Notification that the embedder has changed the time zone,
|
|
* daylight savings time, or other date / time configuration
|
|
* parameters. V8 keeps a cache of various values used for
|
|
* date / time computation. This notification will reset
|
|
* those cached values for the current context so that date /
|
|
* time configuration changes would be reflected in the Date
|
|
* object.
|
|
*
|
|
* This API should not be called more than needed as it will
|
|
* negatively impact the performance of date operations.
|
|
*/
|
|
static void DateTimeConfigurationChangeNotification(Isolate* isolate);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Number object (ECMA-262, 4.3.21).
|
|
*/
|
|
class V8_EXPORT NumberObject : public Object {
|
|
public:
|
|
static Local<Value> New(Isolate* isolate, double value);
|
|
|
|
double ValueOf() const;
|
|
|
|
V8_INLINE static NumberObject* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Boolean object (ECMA-262, 4.3.15).
|
|
*/
|
|
class V8_EXPORT BooleanObject : public Object {
|
|
public:
|
|
static Local<Value> New(Isolate* isolate, bool value);
|
|
V8_DEPRECATED("Pass an isolate", static Local<Value> New(bool value));
|
|
|
|
bool ValueOf() const;
|
|
|
|
V8_INLINE static BooleanObject* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A String object (ECMA-262, 4.3.18).
|
|
*/
|
|
class V8_EXPORT StringObject : public Object {
|
|
public:
|
|
static Local<Value> New(Local<String> value);
|
|
|
|
Local<String> ValueOf() const;
|
|
|
|
V8_INLINE static StringObject* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A Symbol object (ECMA-262 edition 6).
|
|
*/
|
|
class V8_EXPORT SymbolObject : public Object {
|
|
public:
|
|
static Local<Value> New(Isolate* isolate, Local<Symbol> value);
|
|
|
|
Local<Symbol> ValueOf() const;
|
|
|
|
V8_INLINE static SymbolObject* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* An instance of the built-in RegExp constructor (ECMA-262, 15.10).
|
|
*/
|
|
class V8_EXPORT RegExp : public Object {
|
|
public:
|
|
/**
|
|
* Regular expression flag bits. They can be or'ed to enable a set
|
|
* of flags.
|
|
*/
|
|
enum Flags {
|
|
kNone = 0,
|
|
kGlobal = 1 << 0,
|
|
kIgnoreCase = 1 << 1,
|
|
kMultiline = 1 << 2,
|
|
kSticky = 1 << 3,
|
|
kUnicode = 1 << 4,
|
|
kDotAll = 1 << 5,
|
|
};
|
|
|
|
/**
|
|
* Creates a regular expression from the given pattern string and
|
|
* the flags bit field. May throw a JavaScript exception as
|
|
* described in ECMA-262, 15.10.4.1.
|
|
*
|
|
* For example,
|
|
* RegExp::New(v8::String::New("foo"),
|
|
* static_cast<RegExp::Flags>(kGlobal | kMultiline))
|
|
* is equivalent to evaluating "/foo/gm".
|
|
*/
|
|
static V8_DEPRECATE_SOON("Use maybe version",
|
|
Local<RegExp> New(Local<String> pattern,
|
|
Flags flags));
|
|
static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context,
|
|
Local<String> pattern,
|
|
Flags flags);
|
|
|
|
/**
|
|
* Returns the value of the source property: a string representing
|
|
* the regular expression.
|
|
*/
|
|
Local<String> GetSource() const;
|
|
|
|
/**
|
|
* Returns the flags bit field.
|
|
*/
|
|
Flags GetFlags() const;
|
|
|
|
V8_INLINE static RegExp* Cast(Value* obj);
|
|
|
|
private:
|
|
static void CheckCast(Value* obj);
|
|
};
|
|
|
|
|
|
/**
|
|
* A JavaScript value that wraps a C++ void*. This type of value is mainly used
|
|
* to associate C++ data structures with JavaScript objects.
|
|
*/
|
|
class V8_EXPORT External : public Value {
|
|
public:
|
|
static Local<External> New(Isolate* isolate, void* value);
|
|
V8_INLINE static External* Cast(Value* obj);
|
|
void* Value() const;
|
|
private:
|
|
static void CheckCast(v8::Value* obj);
|
|
};
|
|
|
|
#define V8_INTRINSICS_LIST(F) \
|
|
F(ArrayProto_entries, array_entries_iterator) \
|
|
F(ArrayProto_forEach, array_for_each_iterator) \
|
|
F(ArrayProto_keys, array_keys_iterator) \
|
|
F(ArrayProto_values, array_values_iterator) \
|
|
F(IteratorPrototype, initial_iterator_prototype)
|
|
|
|
enum Intrinsic {
|
|
#define V8_DECL_INTRINSIC(name, iname) k##name,
|
|
V8_INTRINSICS_LIST(V8_DECL_INTRINSIC)
|
|
#undef V8_DECL_INTRINSIC
|
|
};
|
|
|
|
|
|
// --- Templates ---
|
|
|
|
|
|
/**
|
|
* The superclass of object and function templates.
|
|
*/
|
|
class V8_EXPORT Template : public Data {
|
|
public:
|
|
/**
|
|
* Adds a property to each instance created by this template.
|
|
*
|
|
* The property must be defined either as a primitive value, or a template.
|
|
*/
|
|
void Set(Local<Name> name, Local<Data> value,
|
|
PropertyAttribute attributes = None);
|
|
void SetPrivate(Local<Private> name, Local<Data> value,
|
|
PropertyAttribute attributes = None);
|
|
V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value);
|
|
|
|
void SetAccessorProperty(
|
|
Local<Name> name,
|
|
Local<FunctionTemplate> getter = Local<FunctionTemplate>(),
|
|
Local<FunctionTemplate> setter = Local<FunctionTemplate>(),
|
|
PropertyAttribute attribute = None,
|
|
AccessControl settings = DEFAULT);
|
|
|
|
/**
|
|
* Whenever the property with the given name is accessed on objects
|
|
* created from this Template the getter and setter callbacks
|
|
* are called instead of getting and setting the property directly
|
|
* on the JavaScript object.
|
|
*
|
|
* \param name The name of the property for which an accessor is added.
|
|
* \param getter The callback to invoke when getting the property.
|
|
* \param setter The callback to invoke when setting the property.
|
|
* \param data A piece of data that will be passed to the getter and setter
|
|
* callbacks whenever they are invoked.
|
|
* \param settings Access control settings for the accessor. This is a bit
|
|
* field consisting of one of more of
|
|
* DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
|
|
* The default is to not allow cross-context access.
|
|
* ALL_CAN_READ means that all cross-context reads are allowed.
|
|
* ALL_CAN_WRITE means that all cross-context writes are allowed.
|
|
* The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
|
|
* cross-context access.
|
|
* \param attribute The attributes of the property for which an accessor
|
|
* is added.
|
|
* \param signature The signature describes valid receivers for the accessor
|
|
* and is used to perform implicit instance checks against them. If the
|
|
* receiver is incompatible (i.e. is not an instance of the constructor as
|
|
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
|
|
* thrown and no callback is invoked.
|
|
*/
|
|
void SetNativeDataProperty(
|
|
Local<String> name, AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0,
|
|
// TODO(dcarney): gcc can't handle Local below
|
|
Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>(),
|
|
AccessControl settings = DEFAULT);
|
|
void SetNativeDataProperty(
|
|
Local<Name> name, AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0,
|
|
// TODO(dcarney): gcc can't handle Local below
|
|
Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>(),
|
|
AccessControl settings = DEFAULT);
|
|
|
|
/**
|
|
* Like SetNativeDataProperty, but V8 will replace the native data property
|
|
* with a real data property on first access.
|
|
*/
|
|
void SetLazyDataProperty(Local<Name> name, AccessorNameGetterCallback getter,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyAttribute attribute = None);
|
|
|
|
/**
|
|
* During template instantiation, sets the value with the intrinsic property
|
|
* from the correct context.
|
|
*/
|
|
void SetIntrinsicDataProperty(Local<Name> name, Intrinsic intrinsic,
|
|
PropertyAttribute attribute = None);
|
|
|
|
private:
|
|
Template();
|
|
|
|
friend class ObjectTemplate;
|
|
friend class FunctionTemplate;
|
|
};
|
|
|
|
|
|
/**
|
|
* NamedProperty[Getter|Setter] are used as interceptors on object.
|
|
* See ObjectTemplate::SetNamedPropertyHandler.
|
|
*/
|
|
typedef void (*NamedPropertyGetterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns the value if the setter intercepts the request.
|
|
* Otherwise, returns an empty handle.
|
|
*/
|
|
typedef void (*NamedPropertySetterCallback)(
|
|
Local<String> property,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the interceptor intercepts the request.
|
|
* The result is an integer encoding property attributes (like v8::None,
|
|
* v8::DontEnum, etc.)
|
|
*/
|
|
typedef void (*NamedPropertyQueryCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Integer>& info);
|
|
|
|
|
|
/**
|
|
* Returns a non-empty handle if the deleter intercepts the request.
|
|
* The return value is true if the property could be deleted and false
|
|
* otherwise.
|
|
*/
|
|
typedef void (*NamedPropertyDeleterCallback)(
|
|
Local<String> property,
|
|
const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
|
|
/**
|
|
* Returns an array containing the names of the properties the named
|
|
* property getter intercepts.
|
|
*/
|
|
typedef void (*NamedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
|
|
// TODO(dcarney): Deprecate and remove previous typedefs, and replace
|
|
// GenericNamedPropertyFooCallback with just NamedPropertyFooCallback.
|
|
|
|
/**
|
|
* Interceptor for get requests on an object.
|
|
*
|
|
* Use `info.GetReturnValue().Set()` to set the return value of the
|
|
* intercepted get request.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \param info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict`' mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* \code
|
|
* void GetterCallback(
|
|
* Local<Name> name,
|
|
* const v8::PropertyCallbackInfo<v8::Value>& info) {
|
|
* info.GetReturnValue().Set(v8_num(42));
|
|
* }
|
|
*
|
|
* v8::Local<v8::FunctionTemplate> templ =
|
|
* v8::FunctionTemplate::New(isolate);
|
|
* templ->InstanceTemplate()->SetHandler(
|
|
* v8::NamedPropertyHandlerConfiguration(GetterCallback));
|
|
* LocalContext env;
|
|
* env->Global()
|
|
* ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local())
|
|
* .ToLocalChecked()
|
|
* ->NewInstance(env.local())
|
|
* .ToLocalChecked())
|
|
* .FromJust();
|
|
* v8::Local<v8::Value> result = CompileRun("obj.a = 17; obj.a");
|
|
* CHECK(v8_num(42)->Equals(env.local(), result).FromJust());
|
|
* \endcode
|
|
*
|
|
* See also `ObjectTemplate::SetHandler`.
|
|
*/
|
|
typedef void (*GenericNamedPropertyGetterCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* Interceptor for set requests on an object.
|
|
*
|
|
* Use `info.GetReturnValue()` to indicate whether the request was intercepted
|
|
* or not. If the setter successfully intercepts the request, i.e., if the
|
|
* request should not be further executed, call
|
|
* `info.GetReturnValue().Set(value)`. If the setter
|
|
* did not intercept the request, i.e., if the request should be handled as
|
|
* if no interceptor is present, do not not call `Set()`.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \param value The value which the property will have if the request
|
|
* is not intercepted.
|
|
* \param info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict'` mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* See also
|
|
* `ObjectTemplate::SetHandler.`
|
|
*/
|
|
typedef void (*GenericNamedPropertySetterCallback)(
|
|
Local<Name> property, Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* Intercepts all requests that query the attributes of the
|
|
* property, e.g., getOwnPropertyDescriptor(), propertyIsEnumerable(), and
|
|
* defineProperty().
|
|
*
|
|
* Use `info.GetReturnValue().Set(value)` to set the property attributes. The
|
|
* value is an interger encoding a `v8::PropertyAttribute`.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \param info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict'` mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* \note Some functions query the property attributes internally, even though
|
|
* they do not return the attributes. For example, `hasOwnProperty()` can
|
|
* trigger this interceptor depending on the state of the object.
|
|
*
|
|
* See also
|
|
* `ObjectTemplate::SetHandler.`
|
|
*/
|
|
typedef void (*GenericNamedPropertyQueryCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Integer>& info);
|
|
|
|
/**
|
|
* Interceptor for delete requests on an object.
|
|
*
|
|
* Use `info.GetReturnValue()` to indicate whether the request was intercepted
|
|
* or not. If the deleter successfully intercepts the request, i.e., if the
|
|
* request should not be further executed, call
|
|
* `info.GetReturnValue().Set(value)` with a boolean `value`. The `value` is
|
|
* used as the return value of `delete`.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \param info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict'` mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* \note If you need to mimic the behavior of `delete`, i.e., throw in strict
|
|
* mode instead of returning false, use `info.ShouldThrowOnError()` to determine
|
|
* if you are in strict mode.
|
|
*
|
|
* See also `ObjectTemplate::SetHandler.`
|
|
*/
|
|
typedef void (*GenericNamedPropertyDeleterCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
|
|
/**
|
|
* Returns an array containing the names of the properties the named
|
|
* property getter intercepts.
|
|
*/
|
|
typedef void (*GenericNamedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
/**
|
|
* Interceptor for defineProperty requests on an object.
|
|
*
|
|
* Use `info.GetReturnValue()` to indicate whether the request was intercepted
|
|
* or not. If the definer successfully intercepts the request, i.e., if the
|
|
* request should not be further executed, call
|
|
* `info.GetReturnValue().Set(value)`. If the definer
|
|
* did not intercept the request, i.e., if the request should be handled as
|
|
* if no interceptor is present, do not not call `Set()`.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \param desc The property descriptor which is used to define the
|
|
* property if the request is not intercepted.
|
|
* \param info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict'` mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* See also `ObjectTemplate::SetHandler`.
|
|
*/
|
|
typedef void (*GenericNamedPropertyDefinerCallback)(
|
|
Local<Name> property, const PropertyDescriptor& desc,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* Interceptor for getOwnPropertyDescriptor requests on an object.
|
|
*
|
|
* Use `info.GetReturnValue().Set()` to set the return value of the
|
|
* intercepted request. The return value must be an object that
|
|
* can be converted to a PropertyDescriptor, e.g., a `v8::value` returned from
|
|
* `v8::Object::getOwnPropertyDescriptor`.
|
|
*
|
|
* \param property The name of the property for which the request was
|
|
* intercepted.
|
|
* \info Information about the intercepted request, such as
|
|
* isolate, receiver, return value, or whether running in `'use strict'` mode.
|
|
* See `PropertyCallbackInfo`.
|
|
*
|
|
* \note If GetOwnPropertyDescriptor is intercepted, it will
|
|
* always return true, i.e., indicate that the property was found.
|
|
*
|
|
* See also `ObjectTemplate::SetHandler`.
|
|
*/
|
|
typedef void (*GenericNamedPropertyDescriptorCallback)(
|
|
Local<Name> property, const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyGetterCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyGetterCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertySetterCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertySetterCallback)(
|
|
uint32_t index,
|
|
Local<Value> value,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyQueryCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyQueryCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Integer>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyDeleterCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyDeleterCallback)(
|
|
uint32_t index,
|
|
const PropertyCallbackInfo<Boolean>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyEnumeratorCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyEnumeratorCallback)(
|
|
const PropertyCallbackInfo<Array>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyDefinerCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyDefinerCallback)(
|
|
uint32_t index, const PropertyDescriptor& desc,
|
|
const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* See `v8::GenericNamedPropertyDescriptorCallback`.
|
|
*/
|
|
typedef void (*IndexedPropertyDescriptorCallback)(
|
|
uint32_t index, const PropertyCallbackInfo<Value>& info);
|
|
|
|
/**
|
|
* Access type specification.
|
|
*/
|
|
enum AccessType {
|
|
ACCESS_GET,
|
|
ACCESS_SET,
|
|
ACCESS_HAS,
|
|
ACCESS_DELETE,
|
|
ACCESS_KEYS
|
|
};
|
|
|
|
|
|
/**
|
|
* Returns true if the given context should be allowed to access the given
|
|
* object.
|
|
*/
|
|
typedef bool (*AccessCheckCallback)(Local<Context> accessing_context,
|
|
Local<Object> accessed_object,
|
|
Local<Value> data);
|
|
|
|
/**
|
|
* A FunctionTemplate is used to create functions at runtime. There
|
|
* can only be one function created from a FunctionTemplate in a
|
|
* context. The lifetime of the created function is equal to the
|
|
* lifetime of the context. So in case the embedder needs to create
|
|
* temporary functions that can be collected using Scripts is
|
|
* preferred.
|
|
*
|
|
* Any modification of a FunctionTemplate after first instantiation will trigger
|
|
* a crash.
|
|
*
|
|
* A FunctionTemplate can have properties, these properties are added to the
|
|
* function object when it is created.
|
|
*
|
|
* A FunctionTemplate has a corresponding instance template which is
|
|
* used to create object instances when the function is used as a
|
|
* constructor. Properties added to the instance template are added to
|
|
* each object instance.
|
|
*
|
|
* A FunctionTemplate can have a prototype template. The prototype template
|
|
* is used to create the prototype object of the function.
|
|
*
|
|
* The following example shows how to use a FunctionTemplate:
|
|
*
|
|
* \code
|
|
* v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New(isolate);
|
|
* t->Set(isolate, "func_property", v8::Number::New(isolate, 1));
|
|
*
|
|
* v8::Local<v8::Template> proto_t = t->PrototypeTemplate();
|
|
* proto_t->Set(isolate,
|
|
* "proto_method",
|
|
* v8::FunctionTemplate::New(isolate, InvokeCallback));
|
|
* proto_t->Set(isolate, "proto_const", v8::Number::New(isolate, 2));
|
|
*
|
|
* v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate();
|
|
* instance_t->SetAccessor(String::NewFromUtf8(isolate, "instance_accessor"),
|
|
* InstanceAccessorCallback);
|
|
* instance_t->SetNamedPropertyHandler(PropertyHandlerCallback);
|
|
* instance_t->Set(String::NewFromUtf8(isolate, "instance_property"),
|
|
* Number::New(isolate, 3));
|
|
*
|
|
* v8::Local<v8::Function> function = t->GetFunction();
|
|
* v8::Local<v8::Object> instance = function->NewInstance();
|
|
* \endcode
|
|
*
|
|
* Let's use "function" as the JS variable name of the function object
|
|
* and "instance" for the instance object created above. The function
|
|
* and the instance will have the following properties:
|
|
*
|
|
* \code
|
|
* func_property in function == true;
|
|
* function.func_property == 1;
|
|
*
|
|
* function.prototype.proto_method() invokes 'InvokeCallback'
|
|
* function.prototype.proto_const == 2;
|
|
*
|
|
* instance instanceof function == true;
|
|
* instance.instance_accessor calls 'InstanceAccessorCallback'
|
|
* instance.instance_property == 3;
|
|
* \endcode
|
|
*
|
|
* A FunctionTemplate can inherit from another one by calling the
|
|
* FunctionTemplate::Inherit method. The following graph illustrates
|
|
* the semantics of inheritance:
|
|
*
|
|
* \code
|
|
* FunctionTemplate Parent -> Parent() . prototype -> { }
|
|
* ^ ^
|
|
* | Inherit(Parent) | .__proto__
|
|
* | |
|
|
* FunctionTemplate Child -> Child() . prototype -> { }
|
|
* \endcode
|
|
*
|
|
* A FunctionTemplate 'Child' inherits from 'Parent', the prototype
|
|
* object of the Child() function has __proto__ pointing to the
|
|
* Parent() function's prototype object. An instance of the Child
|
|
* function has all properties on Parent's instance templates.
|
|
*
|
|
* Let Parent be the FunctionTemplate initialized in the previous
|
|
* section and create a Child FunctionTemplate by:
|
|
*
|
|
* \code
|
|
* Local<FunctionTemplate> parent = t;
|
|
* Local<FunctionTemplate> child = FunctionTemplate::New();
|
|
* child->Inherit(parent);
|
|
*
|
|
* Local<Function> child_function = child->GetFunction();
|
|
* Local<Object> child_instance = child_function->NewInstance();
|
|
* \endcode
|
|
*
|
|
* The Child function and Child instance will have the following
|
|
* properties:
|
|
*
|
|
* \code
|
|
* child_func.prototype.__proto__ == function.prototype;
|
|
* child_instance.instance_accessor calls 'InstanceAccessorCallback'
|
|
* child_instance.instance_property == 3;
|
|
* \endcode
|
|
*/
|
|
class V8_EXPORT FunctionTemplate : public Template {
|
|
public:
|
|
/** Creates a function template.*/
|
|
static Local<FunctionTemplate> New(
|
|
Isolate* isolate, FunctionCallback callback = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
Local<Signature> signature = Local<Signature>(), int length = 0,
|
|
ConstructorBehavior behavior = ConstructorBehavior::kAllow);
|
|
|
|
/** Get a template included in the snapshot by index. */
|
|
static MaybeLocal<FunctionTemplate> FromSnapshot(Isolate* isolate,
|
|
size_t index);
|
|
|
|
/**
|
|
* Creates a function template backed/cached by a private property.
|
|
*/
|
|
static Local<FunctionTemplate> NewWithCache(
|
|
Isolate* isolate, FunctionCallback callback,
|
|
Local<Private> cache_property, Local<Value> data = Local<Value>(),
|
|
Local<Signature> signature = Local<Signature>(), int length = 0);
|
|
|
|
/** Returns the unique function instance in the current execution context.*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Function> GetFunction(
|
|
Local<Context> context);
|
|
|
|
/**
|
|
* Similar to Context::NewRemoteContext, this creates an instance that
|
|
* isn't backed by an actual object.
|
|
*
|
|
* The InstanceTemplate of this FunctionTemplate must have access checks with
|
|
* handlers installed.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewRemoteInstance();
|
|
|
|
/**
|
|
* Set the call-handler callback for a FunctionTemplate. This
|
|
* callback is called whenever the function created from this
|
|
* FunctionTemplate is called.
|
|
*/
|
|
void SetCallHandler(FunctionCallback callback,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/** Set the predefined length property for the FunctionTemplate. */
|
|
void SetLength(int length);
|
|
|
|
/** Get the InstanceTemplate. */
|
|
Local<ObjectTemplate> InstanceTemplate();
|
|
|
|
/**
|
|
* Causes the function template to inherit from a parent function template.
|
|
* This means the the function's prototype.__proto__ is set to the parent
|
|
* function's prototype.
|
|
**/
|
|
void Inherit(Local<FunctionTemplate> parent);
|
|
|
|
/**
|
|
* A PrototypeTemplate is the template used to create the prototype object
|
|
* of the function created by this template.
|
|
*/
|
|
Local<ObjectTemplate> PrototypeTemplate();
|
|
|
|
/**
|
|
* A PrototypeProviderTemplate is another function template whose prototype
|
|
* property is used for this template. This is mutually exclusive with setting
|
|
* a prototype template indirectly by calling PrototypeTemplate() or using
|
|
* Inherit().
|
|
**/
|
|
void SetPrototypeProviderTemplate(Local<FunctionTemplate> prototype_provider);
|
|
|
|
/**
|
|
* Set the class name of the FunctionTemplate. This is used for
|
|
* printing objects created with the function created from the
|
|
* FunctionTemplate as its constructor.
|
|
*/
|
|
void SetClassName(Local<String> name);
|
|
|
|
|
|
/**
|
|
* When set to true, no access check will be performed on the receiver of a
|
|
* function call. Currently defaults to true, but this is subject to change.
|
|
*/
|
|
void SetAcceptAnyReceiver(bool value);
|
|
|
|
/**
|
|
* Determines whether the __proto__ accessor ignores instances of
|
|
* the function template. If instances of the function template are
|
|
* ignored, __proto__ skips all instances and instead returns the
|
|
* next object in the prototype chain.
|
|
*
|
|
* Call with a value of true to make the __proto__ accessor ignore
|
|
* instances of the function template. Call with a value of false
|
|
* to make the __proto__ accessor not ignore instances of the
|
|
* function template. By default, instances of a function template
|
|
* are not ignored.
|
|
*/
|
|
void SetHiddenPrototype(bool value);
|
|
|
|
/**
|
|
* Sets the ReadOnly flag in the attributes of the 'prototype' property
|
|
* of functions created from this FunctionTemplate to true.
|
|
*/
|
|
void ReadOnlyPrototype();
|
|
|
|
/**
|
|
* Removes the prototype property from functions created from this
|
|
* FunctionTemplate.
|
|
*/
|
|
void RemovePrototype();
|
|
|
|
/**
|
|
* Returns true if the given object is an instance of this function
|
|
* template.
|
|
*/
|
|
bool HasInstance(Local<Value> object);
|
|
|
|
private:
|
|
FunctionTemplate();
|
|
friend class Context;
|
|
friend class ObjectTemplate;
|
|
};
|
|
|
|
/**
|
|
* Configuration flags for v8::NamedPropertyHandlerConfiguration or
|
|
* v8::IndexedPropertyHandlerConfiguration.
|
|
*/
|
|
enum class PropertyHandlerFlags {
|
|
/**
|
|
* None.
|
|
*/
|
|
kNone = 0,
|
|
|
|
/**
|
|
* See ALL_CAN_READ above.
|
|
*/
|
|
kAllCanRead = 1,
|
|
|
|
/** Will not call into interceptor for properties on the receiver or prototype
|
|
* chain, i.e., only call into interceptor for properties that do not exist.
|
|
* Currently only valid for named interceptors.
|
|
*/
|
|
kNonMasking = 1 << 1,
|
|
|
|
/**
|
|
* Will not call into interceptor for symbol lookup. Only meaningful for
|
|
* named interceptors.
|
|
*/
|
|
kOnlyInterceptStrings = 1 << 2,
|
|
};
|
|
|
|
struct NamedPropertyHandlerConfiguration {
|
|
NamedPropertyHandlerConfiguration(
|
|
/** Note: getter is required */
|
|
GenericNamedPropertyGetterCallback getter = 0,
|
|
GenericNamedPropertySetterCallback setter = 0,
|
|
GenericNamedPropertyQueryCallback query = 0,
|
|
GenericNamedPropertyDeleterCallback deleter = 0,
|
|
GenericNamedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(query),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
definer(0),
|
|
descriptor(0),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
NamedPropertyHandlerConfiguration(
|
|
GenericNamedPropertyGetterCallback getter,
|
|
GenericNamedPropertySetterCallback setter,
|
|
GenericNamedPropertyDescriptorCallback descriptor,
|
|
GenericNamedPropertyDeleterCallback deleter,
|
|
GenericNamedPropertyEnumeratorCallback enumerator,
|
|
GenericNamedPropertyDefinerCallback definer,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(0),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
definer(definer),
|
|
descriptor(descriptor),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
GenericNamedPropertyGetterCallback getter;
|
|
GenericNamedPropertySetterCallback setter;
|
|
GenericNamedPropertyQueryCallback query;
|
|
GenericNamedPropertyDeleterCallback deleter;
|
|
GenericNamedPropertyEnumeratorCallback enumerator;
|
|
GenericNamedPropertyDefinerCallback definer;
|
|
GenericNamedPropertyDescriptorCallback descriptor;
|
|
Local<Value> data;
|
|
PropertyHandlerFlags flags;
|
|
};
|
|
|
|
|
|
struct IndexedPropertyHandlerConfiguration {
|
|
IndexedPropertyHandlerConfiguration(
|
|
/** Note: getter is required */
|
|
IndexedPropertyGetterCallback getter = 0,
|
|
IndexedPropertySetterCallback setter = 0,
|
|
IndexedPropertyQueryCallback query = 0,
|
|
IndexedPropertyDeleterCallback deleter = 0,
|
|
IndexedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(query),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
definer(0),
|
|
descriptor(0),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
IndexedPropertyHandlerConfiguration(
|
|
IndexedPropertyGetterCallback getter,
|
|
IndexedPropertySetterCallback setter,
|
|
IndexedPropertyDescriptorCallback descriptor,
|
|
IndexedPropertyDeleterCallback deleter,
|
|
IndexedPropertyEnumeratorCallback enumerator,
|
|
IndexedPropertyDefinerCallback definer,
|
|
Local<Value> data = Local<Value>(),
|
|
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
|
|
: getter(getter),
|
|
setter(setter),
|
|
query(0),
|
|
deleter(deleter),
|
|
enumerator(enumerator),
|
|
definer(definer),
|
|
descriptor(descriptor),
|
|
data(data),
|
|
flags(flags) {}
|
|
|
|
IndexedPropertyGetterCallback getter;
|
|
IndexedPropertySetterCallback setter;
|
|
IndexedPropertyQueryCallback query;
|
|
IndexedPropertyDeleterCallback deleter;
|
|
IndexedPropertyEnumeratorCallback enumerator;
|
|
IndexedPropertyDefinerCallback definer;
|
|
IndexedPropertyDescriptorCallback descriptor;
|
|
Local<Value> data;
|
|
PropertyHandlerFlags flags;
|
|
};
|
|
|
|
|
|
/**
|
|
* An ObjectTemplate is used to create objects at runtime.
|
|
*
|
|
* Properties added to an ObjectTemplate are added to each object
|
|
* created from the ObjectTemplate.
|
|
*/
|
|
class V8_EXPORT ObjectTemplate : public Template {
|
|
public:
|
|
/** Creates an ObjectTemplate. */
|
|
static Local<ObjectTemplate> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> constructor = Local<FunctionTemplate>());
|
|
static V8_DEPRECATED("Use isolate version", Local<ObjectTemplate> New());
|
|
|
|
/** Get a template included in the snapshot by index. */
|
|
static MaybeLocal<ObjectTemplate> FromSnapshot(Isolate* isolate,
|
|
size_t index);
|
|
|
|
/** Creates a new instance of this template.*/
|
|
V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance());
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(Local<Context> context);
|
|
|
|
/**
|
|
* Sets an accessor on the object template.
|
|
*
|
|
* Whenever the property with the given name is accessed on objects
|
|
* created from this ObjectTemplate the getter and setter callbacks
|
|
* are called instead of getting and setting the property directly
|
|
* on the JavaScript object.
|
|
*
|
|
* \param name The name of the property for which an accessor is added.
|
|
* \param getter The callback to invoke when getting the property.
|
|
* \param setter The callback to invoke when setting the property.
|
|
* \param data A piece of data that will be passed to the getter and setter
|
|
* callbacks whenever they are invoked.
|
|
* \param settings Access control settings for the accessor. This is a bit
|
|
* field consisting of one of more of
|
|
* DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
|
|
* The default is to not allow cross-context access.
|
|
* ALL_CAN_READ means that all cross-context reads are allowed.
|
|
* ALL_CAN_WRITE means that all cross-context writes are allowed.
|
|
* The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
|
|
* cross-context access.
|
|
* \param attribute The attributes of the property for which an accessor
|
|
* is added.
|
|
* \param signature The signature describes valid receivers for the accessor
|
|
* and is used to perform implicit instance checks against them. If the
|
|
* receiver is incompatible (i.e. is not an instance of the constructor as
|
|
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
|
|
* thrown and no callback is invoked.
|
|
*/
|
|
void SetAccessor(
|
|
Local<String> name, AccessorGetterCallback getter,
|
|
AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>());
|
|
void SetAccessor(
|
|
Local<Name> name, AccessorNameGetterCallback getter,
|
|
AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(),
|
|
AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
|
|
Local<AccessorSignature> signature = Local<AccessorSignature>());
|
|
|
|
/**
|
|
* Sets a named property handler on the object template.
|
|
*
|
|
* Whenever a property whose name is a string is accessed on objects created
|
|
* from this object template, the provided callback is invoked instead of
|
|
* accessing the property directly on the JavaScript object.
|
|
*
|
|
* SetNamedPropertyHandler() is different from SetHandler(), in
|
|
* that the latter can intercept symbol-named properties as well as
|
|
* string-named properties when called with a
|
|
* NamedPropertyHandlerConfiguration. New code should use SetHandler().
|
|
*
|
|
* \param getter The callback to invoke when getting a property.
|
|
* \param setter The callback to invoke when setting a property.
|
|
* \param query The callback to invoke to check if a property is present,
|
|
* and if present, get its attributes.
|
|
* \param deleter The callback to invoke when deleting a property.
|
|
* \param enumerator The callback to invoke to enumerate all the named
|
|
* properties of an object.
|
|
* \param data A piece of data that will be passed to the callbacks
|
|
* whenever they are invoked.
|
|
*/
|
|
// TODO(dcarney): deprecate
|
|
void SetNamedPropertyHandler(NamedPropertyGetterCallback getter,
|
|
NamedPropertySetterCallback setter = 0,
|
|
NamedPropertyQueryCallback query = 0,
|
|
NamedPropertyDeleterCallback deleter = 0,
|
|
NamedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Sets a named property handler on the object template.
|
|
*
|
|
* Whenever a property whose name is a string or a symbol is accessed on
|
|
* objects created from this object template, the provided callback is
|
|
* invoked instead of accessing the property directly on the JavaScript
|
|
* object.
|
|
*
|
|
* @param configuration The NamedPropertyHandlerConfiguration that defines the
|
|
* callbacks to invoke when accessing a property.
|
|
*/
|
|
void SetHandler(const NamedPropertyHandlerConfiguration& configuration);
|
|
|
|
/**
|
|
* Sets an indexed property handler on the object template.
|
|
*
|
|
* Whenever an indexed property is accessed on objects created from
|
|
* this object template, the provided callback is invoked instead of
|
|
* accessing the property directly on the JavaScript object.
|
|
*
|
|
* \param getter The callback to invoke when getting a property.
|
|
* \param setter The callback to invoke when setting a property.
|
|
* \param query The callback to invoke to check if an object has a property.
|
|
* \param deleter The callback to invoke when deleting a property.
|
|
* \param enumerator The callback to invoke to enumerate all the indexed
|
|
* properties of an object.
|
|
* \param data A piece of data that will be passed to the callbacks
|
|
* whenever they are invoked.
|
|
*/
|
|
// TODO(dcarney): deprecate
|
|
void SetIndexedPropertyHandler(
|
|
IndexedPropertyGetterCallback getter,
|
|
IndexedPropertySetterCallback setter = 0,
|
|
IndexedPropertyQueryCallback query = 0,
|
|
IndexedPropertyDeleterCallback deleter = 0,
|
|
IndexedPropertyEnumeratorCallback enumerator = 0,
|
|
Local<Value> data = Local<Value>()) {
|
|
SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query,
|
|
deleter, enumerator, data));
|
|
}
|
|
|
|
/**
|
|
* Sets an indexed property handler on the object template.
|
|
*
|
|
* Whenever an indexed property is accessed on objects created from
|
|
* this object template, the provided callback is invoked instead of
|
|
* accessing the property directly on the JavaScript object.
|
|
*
|
|
* @param configuration The IndexedPropertyHandlerConfiguration that defines
|
|
* the callbacks to invoke when accessing a property.
|
|
*/
|
|
void SetHandler(const IndexedPropertyHandlerConfiguration& configuration);
|
|
|
|
/**
|
|
* Sets the callback to be used when calling instances created from
|
|
* this template as a function. If no callback is set, instances
|
|
* behave like normal JavaScript objects that cannot be called as a
|
|
* function.
|
|
*/
|
|
void SetCallAsFunctionHandler(FunctionCallback callback,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Mark object instances of the template as undetectable.
|
|
*
|
|
* In many ways, undetectable objects behave as though they are not
|
|
* there. They behave like 'undefined' in conditionals and when
|
|
* printed. However, properties can be accessed and called as on
|
|
* normal objects.
|
|
*/
|
|
void MarkAsUndetectable();
|
|
|
|
/**
|
|
* Sets access check callback on the object template and enables access
|
|
* checks.
|
|
*
|
|
* When accessing properties on instances of this object template,
|
|
* the access check callback will be called to determine whether or
|
|
* not to allow cross-context access to the properties.
|
|
*/
|
|
void SetAccessCheckCallback(AccessCheckCallback callback,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Like SetAccessCheckCallback but invokes an interceptor on failed access
|
|
* checks instead of looking up all-can-read properties. You can only use
|
|
* either this method or SetAccessCheckCallback, but not both at the same
|
|
* time.
|
|
*/
|
|
void SetAccessCheckCallbackAndHandler(
|
|
AccessCheckCallback callback,
|
|
const NamedPropertyHandlerConfiguration& named_handler,
|
|
const IndexedPropertyHandlerConfiguration& indexed_handler,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Gets the number of internal fields for objects generated from
|
|
* this template.
|
|
*/
|
|
int InternalFieldCount();
|
|
|
|
/**
|
|
* Sets the number of internal fields for objects generated from
|
|
* this template.
|
|
*/
|
|
void SetInternalFieldCount(int value);
|
|
|
|
/**
|
|
* Returns true if the object will be an immutable prototype exotic object.
|
|
*/
|
|
bool IsImmutableProto();
|
|
|
|
/**
|
|
* Makes the ObjectTempate for an immutable prototype exotic object, with an
|
|
* immutable __proto__.
|
|
*/
|
|
void SetImmutableProto();
|
|
|
|
private:
|
|
ObjectTemplate();
|
|
static Local<ObjectTemplate> New(internal::Isolate* isolate,
|
|
Local<FunctionTemplate> constructor);
|
|
friend class FunctionTemplate;
|
|
};
|
|
|
|
/**
|
|
* A Signature specifies which receiver is valid for a function.
|
|
*
|
|
* A receiver matches a given signature if the receiver (or any of its
|
|
* hidden prototypes) was created from the signature's FunctionTemplate, or
|
|
* from a FunctionTemplate that inherits directly or indirectly from the
|
|
* signature's FunctionTemplate.
|
|
*/
|
|
class V8_EXPORT Signature : public Data {
|
|
public:
|
|
static Local<Signature> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
|
|
|
|
private:
|
|
Signature();
|
|
};
|
|
|
|
|
|
/**
|
|
* An AccessorSignature specifies which receivers are valid parameters
|
|
* to an accessor callback.
|
|
*/
|
|
class V8_EXPORT AccessorSignature : public Data {
|
|
public:
|
|
static Local<AccessorSignature> New(
|
|
Isolate* isolate,
|
|
Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
|
|
|
|
private:
|
|
AccessorSignature();
|
|
};
|
|
|
|
|
|
// --- Extensions ---
|
|
|
|
class V8_EXPORT ExternalOneByteStringResourceImpl
|
|
: public String::ExternalOneByteStringResource {
|
|
public:
|
|
ExternalOneByteStringResourceImpl() : data_(0), length_(0) {}
|
|
ExternalOneByteStringResourceImpl(const char* data, size_t length)
|
|
: data_(data), length_(length) {}
|
|
const char* data() const { return data_; }
|
|
size_t length() const { return length_; }
|
|
|
|
private:
|
|
const char* data_;
|
|
size_t length_;
|
|
};
|
|
|
|
/**
|
|
* Ignore
|
|
*/
|
|
class V8_EXPORT Extension { // NOLINT
|
|
public:
|
|
// Note that the strings passed into this constructor must live as long
|
|
// as the Extension itself.
|
|
Extension(const char* name,
|
|
const char* source = 0,
|
|
int dep_count = 0,
|
|
const char** deps = 0,
|
|
int source_length = -1);
|
|
virtual ~Extension() { }
|
|
virtual Local<FunctionTemplate> GetNativeFunctionTemplate(
|
|
Isolate* isolate, Local<String> name) {
|
|
return Local<FunctionTemplate>();
|
|
}
|
|
|
|
const char* name() const { return name_; }
|
|
size_t source_length() const { return source_length_; }
|
|
const String::ExternalOneByteStringResource* source() const {
|
|
return &source_; }
|
|
int dependency_count() { return dep_count_; }
|
|
const char** dependencies() { return deps_; }
|
|
void set_auto_enable(bool value) { auto_enable_ = value; }
|
|
bool auto_enable() { return auto_enable_; }
|
|
|
|
// Disallow copying and assigning.
|
|
Extension(const Extension&) = delete;
|
|
void operator=(const Extension&) = delete;
|
|
|
|
private:
|
|
const char* name_;
|
|
size_t source_length_; // expected to initialize before source_
|
|
ExternalOneByteStringResourceImpl source_;
|
|
int dep_count_;
|
|
const char** deps_;
|
|
bool auto_enable_;
|
|
};
|
|
|
|
|
|
void V8_EXPORT RegisterExtension(Extension* extension);
|
|
|
|
|
|
// --- Statics ---
|
|
|
|
V8_INLINE Local<Primitive> Undefined(Isolate* isolate);
|
|
V8_INLINE Local<Primitive> Null(Isolate* isolate);
|
|
V8_INLINE Local<Boolean> True(Isolate* isolate);
|
|
V8_INLINE Local<Boolean> False(Isolate* isolate);
|
|
|
|
/**
|
|
* A set of constraints that specifies the limits of the runtime's memory use.
|
|
* You must set the heap size before initializing the VM - the size cannot be
|
|
* adjusted after the VM is initialized.
|
|
*
|
|
* If you are using threads then you should hold the V8::Locker lock while
|
|
* setting the stack limit and you must set a non-default stack limit separately
|
|
* for each thread.
|
|
*
|
|
* The arguments for set_max_semi_space_size, set_max_old_space_size,
|
|
* set_max_executable_size, set_code_range_size specify limits in MB.
|
|
*/
|
|
class V8_EXPORT ResourceConstraints {
|
|
public:
|
|
ResourceConstraints();
|
|
|
|
/**
|
|
* Configures the constraints with reasonable default values based on the
|
|
* capabilities of the current device the VM is running on.
|
|
*
|
|
* \param physical_memory The total amount of physical memory on the current
|
|
* device, in bytes.
|
|
* \param virtual_memory_limit The amount of virtual memory on the current
|
|
* device, in bytes, or zero, if there is no limit.
|
|
*/
|
|
void ConfigureDefaults(uint64_t physical_memory,
|
|
uint64_t virtual_memory_limit);
|
|
|
|
int max_semi_space_size() const { return max_semi_space_size_; }
|
|
void set_max_semi_space_size(int limit_in_mb) {
|
|
max_semi_space_size_ = limit_in_mb;
|
|
}
|
|
int max_old_space_size() const { return max_old_space_size_; }
|
|
void set_max_old_space_size(int limit_in_mb) {
|
|
max_old_space_size_ = limit_in_mb;
|
|
}
|
|
V8_DEPRECATE_SOON("max_executable_size_ is subsumed by max_old_space_size_",
|
|
int max_executable_size() const) {
|
|
return max_executable_size_;
|
|
}
|
|
V8_DEPRECATE_SOON("max_executable_size_ is subsumed by max_old_space_size_",
|
|
void set_max_executable_size(int limit_in_mb)) {
|
|
max_executable_size_ = limit_in_mb;
|
|
}
|
|
uint32_t* stack_limit() const { return stack_limit_; }
|
|
// Sets an address beyond which the VM's stack may not grow.
|
|
void set_stack_limit(uint32_t* value) { stack_limit_ = value; }
|
|
size_t code_range_size() const { return code_range_size_; }
|
|
void set_code_range_size(size_t limit_in_mb) {
|
|
code_range_size_ = limit_in_mb;
|
|
}
|
|
size_t max_zone_pool_size() const { return max_zone_pool_size_; }
|
|
void set_max_zone_pool_size(const size_t bytes) {
|
|
max_zone_pool_size_ = bytes;
|
|
}
|
|
|
|
private:
|
|
int max_semi_space_size_;
|
|
int max_old_space_size_;
|
|
int max_executable_size_;
|
|
uint32_t* stack_limit_;
|
|
size_t code_range_size_;
|
|
size_t max_zone_pool_size_;
|
|
};
|
|
|
|
|
|
// --- Exceptions ---
|
|
|
|
|
|
typedef void (*FatalErrorCallback)(const char* location, const char* message);
|
|
|
|
typedef void (*OOMErrorCallback)(const char* location, bool is_heap_oom);
|
|
|
|
typedef void (*MessageCallback)(Local<Message> message, Local<Value> data);
|
|
|
|
// --- Tracing ---
|
|
|
|
typedef void (*LogEventCallback)(const char* name, int event);
|
|
|
|
/**
|
|
* Create new error objects by calling the corresponding error object
|
|
* constructor with the message.
|
|
*/
|
|
class V8_EXPORT Exception {
|
|
public:
|
|
static Local<Value> RangeError(Local<String> message);
|
|
static Local<Value> ReferenceError(Local<String> message);
|
|
static Local<Value> SyntaxError(Local<String> message);
|
|
static Local<Value> TypeError(Local<String> message);
|
|
static Local<Value> Error(Local<String> message);
|
|
|
|
/**
|
|
* Creates an error message for the given exception.
|
|
* Will try to reconstruct the original stack trace from the exception value,
|
|
* or capture the current stack trace if not available.
|
|
*/
|
|
static Local<Message> CreateMessage(Isolate* isolate, Local<Value> exception);
|
|
V8_DEPRECATED("Use version with an Isolate*",
|
|
static Local<Message> CreateMessage(Local<Value> exception));
|
|
|
|
/**
|
|
* Returns the original stack trace that was captured at the creation time
|
|
* of a given exception, or an empty handle if not available.
|
|
*/
|
|
static Local<StackTrace> GetStackTrace(Local<Value> exception);
|
|
};
|
|
|
|
|
|
// --- Counters Callbacks ---
|
|
|
|
typedef int* (*CounterLookupCallback)(const char* name);
|
|
|
|
typedef void* (*CreateHistogramCallback)(const char* name,
|
|
int min,
|
|
int max,
|
|
size_t buckets);
|
|
|
|
typedef void (*AddHistogramSampleCallback)(void* histogram, int sample);
|
|
|
|
// --- Memory Allocation Callback ---
|
|
enum ObjectSpace {
|
|
kObjectSpaceNewSpace = 1 << 0,
|
|
kObjectSpaceOldSpace = 1 << 1,
|
|
kObjectSpaceCodeSpace = 1 << 2,
|
|
kObjectSpaceMapSpace = 1 << 3,
|
|
kObjectSpaceLoSpace = 1 << 4,
|
|
kObjectSpaceAll = kObjectSpaceNewSpace | kObjectSpaceOldSpace |
|
|
kObjectSpaceCodeSpace | kObjectSpaceMapSpace |
|
|
kObjectSpaceLoSpace
|
|
};
|
|
|
|
enum AllocationAction {
|
|
kAllocationActionAllocate = 1 << 0,
|
|
kAllocationActionFree = 1 << 1,
|
|
kAllocationActionAll = kAllocationActionAllocate | kAllocationActionFree
|
|
};
|
|
|
|
// --- Enter/Leave Script Callback ---
|
|
typedef void (*BeforeCallEnteredCallback)(Isolate*);
|
|
typedef void (*CallCompletedCallback)(Isolate*);
|
|
typedef void (*DeprecatedCallCompletedCallback)();
|
|
|
|
/**
|
|
* HostImportDynamicallyCallback is called when we require the
|
|
* embedder to load a module. This is used as part of the dynamic
|
|
* import syntax. The behavior of this callback is not specified in
|
|
* EcmaScript.
|
|
*
|
|
* The referrer is the name of the file which calls the dynamic
|
|
* import. The referrer can be used to resolve the module location.
|
|
*
|
|
* The specifier is the name of the module that should be imported.
|
|
*
|
|
* The DynamicImportResult object is used to signal success or failure
|
|
* by calling it's respective methods.
|
|
*
|
|
*/
|
|
typedef void (*HostImportModuleDynamicallyCallback)(
|
|
Isolate* isolate, Local<String> referrer, Local<String> specifier,
|
|
Local<DynamicImportResult> result);
|
|
|
|
/**
|
|
* PromiseHook with type kInit is called when a new promise is
|
|
* created. When a new promise is created as part of the chain in the
|
|
* case of Promise.then or in the intermediate promises created by
|
|
* Promise.{race, all}/AsyncFunctionAwait, we pass the parent promise
|
|
* otherwise we pass undefined.
|
|
*
|
|
* PromiseHook with type kResolve is called at the beginning of
|
|
* resolve or reject function defined by CreateResolvingFunctions.
|
|
*
|
|
* PromiseHook with type kBefore is called at the beginning of the
|
|
* PromiseReactionJob.
|
|
*
|
|
* PromiseHook with type kAfter is called right at the end of the
|
|
* PromiseReactionJob.
|
|
*/
|
|
enum class PromiseHookType { kInit, kResolve, kBefore, kAfter };
|
|
|
|
typedef void (*PromiseHook)(PromiseHookType type, Local<Promise> promise,
|
|
Local<Value> parent);
|
|
|
|
// --- Promise Reject Callback ---
|
|
enum PromiseRejectEvent {
|
|
kPromiseRejectWithNoHandler = 0,
|
|
kPromiseHandlerAddedAfterReject = 1
|
|
};
|
|
|
|
class PromiseRejectMessage {
|
|
public:
|
|
PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event,
|
|
Local<Value> value, Local<StackTrace> stack_trace)
|
|
: promise_(promise),
|
|
event_(event),
|
|
value_(value),
|
|
stack_trace_(stack_trace) {}
|
|
|
|
V8_INLINE Local<Promise> GetPromise() const { return promise_; }
|
|
V8_INLINE PromiseRejectEvent GetEvent() const { return event_; }
|
|
V8_INLINE Local<Value> GetValue() const { return value_; }
|
|
|
|
V8_DEPRECATED("Use v8::Exception::CreateMessage(GetValue())->GetStackTrace()",
|
|
V8_INLINE Local<StackTrace> GetStackTrace() const) {
|
|
return stack_trace_;
|
|
}
|
|
|
|
private:
|
|
Local<Promise> promise_;
|
|
PromiseRejectEvent event_;
|
|
Local<Value> value_;
|
|
Local<StackTrace> stack_trace_;
|
|
};
|
|
|
|
typedef void (*PromiseRejectCallback)(PromiseRejectMessage message);
|
|
|
|
// --- Microtasks Callbacks ---
|
|
typedef void (*MicrotasksCompletedCallback)(Isolate*);
|
|
typedef void (*MicrotaskCallback)(void* data);
|
|
|
|
|
|
/**
|
|
* Policy for running microtasks:
|
|
* - explicit: microtasks are invoked with Isolate::RunMicrotasks() method;
|
|
* - scoped: microtasks invocation is controlled by MicrotasksScope objects;
|
|
* - auto: microtasks are invoked when the script call depth decrements
|
|
* to zero.
|
|
*/
|
|
enum class MicrotasksPolicy { kExplicit, kScoped, kAuto };
|
|
|
|
|
|
/**
|
|
* This scope is used to control microtasks when kScopeMicrotasksInvocation
|
|
* is used on Isolate. In this mode every non-primitive call to V8 should be
|
|
* done inside some MicrotasksScope.
|
|
* Microtasks are executed when topmost MicrotasksScope marked as kRunMicrotasks
|
|
* exits.
|
|
* kDoNotRunMicrotasks should be used to annotate calls not intended to trigger
|
|
* microtasks.
|
|
*/
|
|
class V8_EXPORT MicrotasksScope {
|
|
public:
|
|
enum Type { kRunMicrotasks, kDoNotRunMicrotasks };
|
|
|
|
MicrotasksScope(Isolate* isolate, Type type);
|
|
~MicrotasksScope();
|
|
|
|
/**
|
|
* Runs microtasks if no kRunMicrotasks scope is currently active.
|
|
*/
|
|
static void PerformCheckpoint(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns current depth of nested kRunMicrotasks scopes.
|
|
*/
|
|
static int GetCurrentDepth(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns true while microtasks are being executed.
|
|
*/
|
|
static bool IsRunningMicrotasks(Isolate* isolate);
|
|
|
|
// Prevent copying.
|
|
MicrotasksScope(const MicrotasksScope&) = delete;
|
|
MicrotasksScope& operator=(const MicrotasksScope&) = delete;
|
|
|
|
private:
|
|
internal::Isolate* const isolate_;
|
|
bool run_;
|
|
};
|
|
|
|
|
|
// --- Failed Access Check Callback ---
|
|
typedef void (*FailedAccessCheckCallback)(Local<Object> target,
|
|
AccessType type,
|
|
Local<Value> data);
|
|
|
|
// --- AllowCodeGenerationFromStrings callbacks ---
|
|
|
|
/**
|
|
* Callback to check if code generation from strings is allowed. See
|
|
* Context::AllowCodeGenerationFromStrings.
|
|
*/
|
|
typedef bool (*AllowCodeGenerationFromStringsCallback)(Local<Context> context);
|
|
|
|
// --- WASM compilation callbacks ---
|
|
typedef bool (*ExtensionCallback)(const FunctionCallbackInfo<Value>&);
|
|
|
|
// --- Garbage Collection Callbacks ---
|
|
|
|
/**
|
|
* Applications can register callback functions which will be called before and
|
|
* after certain garbage collection operations. Allocations are not allowed in
|
|
* the callback functions, you therefore cannot manipulate objects (set or
|
|
* delete properties for example) since it is possible such operations will
|
|
* result in the allocation of objects.
|
|
*/
|
|
enum GCType {
|
|
kGCTypeScavenge = 1 << 0,
|
|
kGCTypeMarkSweepCompact = 1 << 1,
|
|
kGCTypeIncrementalMarking = 1 << 2,
|
|
kGCTypeProcessWeakCallbacks = 1 << 3,
|
|
kGCTypeAll = kGCTypeScavenge | kGCTypeMarkSweepCompact |
|
|
kGCTypeIncrementalMarking | kGCTypeProcessWeakCallbacks
|
|
};
|
|
|
|
/**
|
|
* GCCallbackFlags is used to notify additional information about the GC
|
|
* callback.
|
|
* - kGCCallbackFlagConstructRetainedObjectInfos: The GC callback is for
|
|
* constructing retained object infos.
|
|
* - kGCCallbackFlagForced: The GC callback is for a forced GC for testing.
|
|
* - kGCCallbackFlagSynchronousPhantomCallbackProcessing: The GC callback
|
|
* is called synchronously without getting posted to an idle task.
|
|
* - kGCCallbackFlagCollectAllAvailableGarbage: The GC callback is called
|
|
* in a phase where V8 is trying to collect all available garbage
|
|
* (e.g., handling a low memory notification).
|
|
* - kGCCallbackScheduleIdleGarbageCollection: The GC callback is called to
|
|
* trigger an idle garbage collection.
|
|
*/
|
|
enum GCCallbackFlags {
|
|
kNoGCCallbackFlags = 0,
|
|
kGCCallbackFlagConstructRetainedObjectInfos = 1 << 1,
|
|
kGCCallbackFlagForced = 1 << 2,
|
|
kGCCallbackFlagSynchronousPhantomCallbackProcessing = 1 << 3,
|
|
kGCCallbackFlagCollectAllAvailableGarbage = 1 << 4,
|
|
kGCCallbackFlagCollectAllExternalMemory = 1 << 5,
|
|
kGCCallbackScheduleIdleGarbageCollection = 1 << 6,
|
|
};
|
|
|
|
typedef void (*GCCallback)(GCType type, GCCallbackFlags flags);
|
|
|
|
typedef void (*InterruptCallback)(Isolate* isolate, void* data);
|
|
|
|
|
|
/**
|
|
* Collection of V8 heap information.
|
|
*
|
|
* Instances of this class can be passed to v8::V8::HeapStatistics to
|
|
* get heap statistics from V8.
|
|
*/
|
|
class V8_EXPORT HeapStatistics {
|
|
public:
|
|
HeapStatistics();
|
|
size_t total_heap_size() { return total_heap_size_; }
|
|
size_t total_heap_size_executable() { return total_heap_size_executable_; }
|
|
size_t total_physical_size() { return total_physical_size_; }
|
|
size_t total_available_size() { return total_available_size_; }
|
|
size_t used_heap_size() { return used_heap_size_; }
|
|
size_t heap_size_limit() { return heap_size_limit_; }
|
|
size_t malloced_memory() { return malloced_memory_; }
|
|
size_t peak_malloced_memory() { return peak_malloced_memory_; }
|
|
|
|
/**
|
|
* Returns a 0/1 boolean, which signifies whether the V8 overwrite heap
|
|
* garbage with a bit pattern.
|
|
*/
|
|
size_t does_zap_garbage() { return does_zap_garbage_; }
|
|
|
|
private:
|
|
size_t total_heap_size_;
|
|
size_t total_heap_size_executable_;
|
|
size_t total_physical_size_;
|
|
size_t total_available_size_;
|
|
size_t used_heap_size_;
|
|
size_t heap_size_limit_;
|
|
size_t malloced_memory_;
|
|
size_t peak_malloced_memory_;
|
|
bool does_zap_garbage_;
|
|
|
|
friend class V8;
|
|
friend class Isolate;
|
|
};
|
|
|
|
|
|
class V8_EXPORT HeapSpaceStatistics {
|
|
public:
|
|
HeapSpaceStatistics();
|
|
const char* space_name() { return space_name_; }
|
|
size_t space_size() { return space_size_; }
|
|
size_t space_used_size() { return space_used_size_; }
|
|
size_t space_available_size() { return space_available_size_; }
|
|
size_t physical_space_size() { return physical_space_size_; }
|
|
|
|
private:
|
|
const char* space_name_;
|
|
size_t space_size_;
|
|
size_t space_used_size_;
|
|
size_t space_available_size_;
|
|
size_t physical_space_size_;
|
|
|
|
friend class Isolate;
|
|
};
|
|
|
|
|
|
class V8_EXPORT HeapObjectStatistics {
|
|
public:
|
|
HeapObjectStatistics();
|
|
const char* object_type() { return object_type_; }
|
|
const char* object_sub_type() { return object_sub_type_; }
|
|
size_t object_count() { return object_count_; }
|
|
size_t object_size() { return object_size_; }
|
|
|
|
private:
|
|
const char* object_type_;
|
|
const char* object_sub_type_;
|
|
size_t object_count_;
|
|
size_t object_size_;
|
|
|
|
friend class Isolate;
|
|
};
|
|
|
|
class V8_EXPORT HeapCodeStatistics {
|
|
public:
|
|
HeapCodeStatistics();
|
|
size_t code_and_metadata_size() { return code_and_metadata_size_; }
|
|
size_t bytecode_and_metadata_size() { return bytecode_and_metadata_size_; }
|
|
|
|
private:
|
|
size_t code_and_metadata_size_;
|
|
size_t bytecode_and_metadata_size_;
|
|
|
|
friend class Isolate;
|
|
};
|
|
|
|
class RetainedObjectInfo;
|
|
|
|
|
|
/**
|
|
* FunctionEntryHook is the type of the profile entry hook called at entry to
|
|
* any generated function when function-level profiling is enabled.
|
|
*
|
|
* \param function the address of the function that's being entered.
|
|
* \param return_addr_location points to a location on stack where the machine
|
|
* return address resides. This can be used to identify the caller of
|
|
* \p function, and/or modified to divert execution when \p function exits.
|
|
*
|
|
* \note the entry hook must not cause garbage collection.
|
|
*/
|
|
typedef void (*FunctionEntryHook)(uintptr_t function,
|
|
uintptr_t return_addr_location);
|
|
|
|
/**
|
|
* A JIT code event is issued each time code is added, moved or removed.
|
|
*
|
|
* \note removal events are not currently issued.
|
|
*/
|
|
struct JitCodeEvent {
|
|
enum EventType {
|
|
CODE_ADDED,
|
|
CODE_MOVED,
|
|
CODE_REMOVED,
|
|
CODE_ADD_LINE_POS_INFO,
|
|
CODE_START_LINE_INFO_RECORDING,
|
|
CODE_END_LINE_INFO_RECORDING
|
|
};
|
|
// Definition of the code position type. The "POSITION" type means the place
|
|
// in the source code which are of interest when making stack traces to
|
|
// pin-point the source location of a stack frame as close as possible.
|
|
// The "STATEMENT_POSITION" means the place at the beginning of each
|
|
// statement, and is used to indicate possible break locations.
|
|
enum PositionType { POSITION, STATEMENT_POSITION };
|
|
|
|
// Type of event.
|
|
EventType type;
|
|
// Start of the instructions.
|
|
void* code_start;
|
|
// Size of the instructions.
|
|
size_t code_len;
|
|
// Script info for CODE_ADDED event.
|
|
Local<UnboundScript> script;
|
|
// User-defined data for *_LINE_INFO_* event. It's used to hold the source
|
|
// code line information which is returned from the
|
|
// CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent
|
|
// CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events.
|
|
void* user_data;
|
|
|
|
struct name_t {
|
|
// Name of the object associated with the code, note that the string is not
|
|
// zero-terminated.
|
|
const char* str;
|
|
// Number of chars in str.
|
|
size_t len;
|
|
};
|
|
|
|
struct line_info_t {
|
|
// PC offset
|
|
size_t offset;
|
|
// Code postion
|
|
size_t pos;
|
|
// The position type.
|
|
PositionType position_type;
|
|
};
|
|
|
|
union {
|
|
// Only valid for CODE_ADDED.
|
|
struct name_t name;
|
|
|
|
// Only valid for CODE_ADD_LINE_POS_INFO
|
|
struct line_info_t line_info;
|
|
|
|
// New location of instructions. Only valid for CODE_MOVED.
|
|
void* new_code_start;
|
|
};
|
|
};
|
|
|
|
/**
|
|
* Option flags passed to the SetRAILMode function.
|
|
* See documentation https://developers.google.com/web/tools/chrome-devtools/
|
|
* profile/evaluate-performance/rail
|
|
*/
|
|
enum RAILMode {
|
|
// Response performance mode: In this mode very low virtual machine latency
|
|
// is provided. V8 will try to avoid JavaScript execution interruptions.
|
|
// Throughput may be throttled.
|
|
PERFORMANCE_RESPONSE,
|
|
// Animation performance mode: In this mode low virtual machine latency is
|
|
// provided. V8 will try to avoid as many JavaScript execution interruptions
|
|
// as possible. Throughput may be throttled. This is the default mode.
|
|
PERFORMANCE_ANIMATION,
|
|
// Idle performance mode: The embedder is idle. V8 can complete deferred work
|
|
// in this mode.
|
|
PERFORMANCE_IDLE,
|
|
// Load performance mode: In this mode high throughput is provided. V8 may
|
|
// turn off latency optimizations.
|
|
PERFORMANCE_LOAD
|
|
};
|
|
|
|
/**
|
|
* Option flags passed to the SetJitCodeEventHandler function.
|
|
*/
|
|
enum JitCodeEventOptions {
|
|
kJitCodeEventDefault = 0,
|
|
// Generate callbacks for already existent code.
|
|
kJitCodeEventEnumExisting = 1
|
|
};
|
|
|
|
|
|
/**
|
|
* Callback function passed to SetJitCodeEventHandler.
|
|
*
|
|
* \param event code add, move or removal event.
|
|
*/
|
|
typedef void (*JitCodeEventHandler)(const JitCodeEvent* event);
|
|
|
|
|
|
/**
|
|
* Interface for iterating through all external resources in the heap.
|
|
*/
|
|
class V8_EXPORT ExternalResourceVisitor { // NOLINT
|
|
public:
|
|
virtual ~ExternalResourceVisitor() {}
|
|
virtual void VisitExternalString(Local<String> string) {}
|
|
};
|
|
|
|
|
|
/**
|
|
* Interface for iterating through all the persistent handles in the heap.
|
|
*/
|
|
class V8_EXPORT PersistentHandleVisitor { // NOLINT
|
|
public:
|
|
virtual ~PersistentHandleVisitor() {}
|
|
virtual void VisitPersistentHandle(Persistent<Value>* value,
|
|
uint16_t class_id) {}
|
|
};
|
|
|
|
/**
|
|
* Memory pressure level for the MemoryPressureNotification.
|
|
* kNone hints V8 that there is no memory pressure.
|
|
* kModerate hints V8 to speed up incremental garbage collection at the cost of
|
|
* of higher latency due to garbage collection pauses.
|
|
* kCritical hints V8 to free memory as soon as possible. Garbage collection
|
|
* pauses at this level will be large.
|
|
*/
|
|
enum class MemoryPressureLevel { kNone, kModerate, kCritical };
|
|
|
|
/**
|
|
* Interface for tracing through the embedder heap. During a v8 garbage
|
|
* collection, v8 collects hidden fields of all potential wrappers, and at the
|
|
* end of its marking phase iterates the collection and asks the embedder to
|
|
* trace through its heap and use reporter to report each JavaScript object
|
|
* reachable from any of the given wrappers.
|
|
*
|
|
* Before the first call to the TraceWrappersFrom function TracePrologue will be
|
|
* called. When the garbage collection cycle is finished, TraceEpilogue will be
|
|
* called.
|
|
*/
|
|
class V8_EXPORT EmbedderHeapTracer {
|
|
public:
|
|
enum ForceCompletionAction { FORCE_COMPLETION, DO_NOT_FORCE_COMPLETION };
|
|
|
|
struct AdvanceTracingActions {
|
|
explicit AdvanceTracingActions(ForceCompletionAction force_completion_)
|
|
: force_completion(force_completion_) {}
|
|
|
|
ForceCompletionAction force_completion;
|
|
};
|
|
|
|
/**
|
|
* Called by v8 to register internal fields of found wrappers.
|
|
*
|
|
* The embedder is expected to store them somewhere and trace reachable
|
|
* wrappers from them when called through |AdvanceTracing|.
|
|
*/
|
|
virtual void RegisterV8References(
|
|
const std::vector<std::pair<void*, void*> >& embedder_fields) = 0;
|
|
|
|
/**
|
|
* Called at the beginning of a GC cycle.
|
|
*/
|
|
virtual void TracePrologue() = 0;
|
|
|
|
/**
|
|
* Called to to make a tracing step in the embedder.
|
|
*
|
|
* The embedder is expected to trace its heap starting from wrappers reported
|
|
* by RegisterV8References method, and report back all reachable wrappers.
|
|
* Furthermore, the embedder is expected to stop tracing by the given
|
|
* deadline.
|
|
*
|
|
* Returns true if there is still work to do.
|
|
*/
|
|
virtual bool AdvanceTracing(double deadline_in_ms,
|
|
AdvanceTracingActions actions) = 0;
|
|
|
|
/**
|
|
* Called at the end of a GC cycle.
|
|
*
|
|
* Note that allocation is *not* allowed within |TraceEpilogue|.
|
|
*/
|
|
virtual void TraceEpilogue() = 0;
|
|
|
|
/**
|
|
* Called upon entering the final marking pause. No more incremental marking
|
|
* steps will follow this call.
|
|
*/
|
|
virtual void EnterFinalPause() = 0;
|
|
|
|
/**
|
|
* Called when tracing is aborted.
|
|
*
|
|
* The embedder is expected to throw away all intermediate data and reset to
|
|
* the initial state.
|
|
*/
|
|
virtual void AbortTracing() = 0;
|
|
|
|
/**
|
|
* Returns the number of wrappers that are still to be traced by the embedder.
|
|
*/
|
|
virtual size_t NumberOfWrappersToTrace() { return 0; }
|
|
|
|
protected:
|
|
virtual ~EmbedderHeapTracer() = default;
|
|
};
|
|
|
|
/**
|
|
* Callback and supporting data used in SnapshotCreator to implement embedder
|
|
* logic to serialize internal fields.
|
|
*/
|
|
struct SerializeInternalFieldsCallback {
|
|
typedef StartupData (*CallbackFunction)(Local<Object> holder, int index,
|
|
void* data);
|
|
SerializeInternalFieldsCallback(CallbackFunction function = nullptr,
|
|
void* data_arg = nullptr)
|
|
: callback(function), data(data_arg) {}
|
|
CallbackFunction callback;
|
|
void* data;
|
|
};
|
|
// Note that these fields are called "internal fields" in the API and called
|
|
// "embedder fields" within V8.
|
|
typedef SerializeInternalFieldsCallback SerializeEmbedderFieldsCallback;
|
|
|
|
/**
|
|
* Callback and supporting data used to implement embedder logic to deserialize
|
|
* internal fields.
|
|
*/
|
|
struct DeserializeInternalFieldsCallback {
|
|
typedef void (*CallbackFunction)(Local<Object> holder, int index,
|
|
StartupData payload, void* data);
|
|
DeserializeInternalFieldsCallback(CallbackFunction function = nullptr,
|
|
void* data_arg = nullptr)
|
|
: callback(function), data(data_arg) {}
|
|
void (*callback)(Local<Object> holder, int index, StartupData payload,
|
|
void* data);
|
|
void* data;
|
|
};
|
|
typedef DeserializeInternalFieldsCallback DeserializeEmbedderFieldsCallback;
|
|
|
|
/**
|
|
* Isolate represents an isolated instance of the V8 engine. V8 isolates have
|
|
* completely separate states. Objects from one isolate must not be used in
|
|
* other isolates. The embedder can create multiple isolates and use them in
|
|
* parallel in multiple threads. An isolate can be entered by at most one
|
|
* thread at any given time. The Locker/Unlocker API must be used to
|
|
* synchronize.
|
|
*/
|
|
class V8_EXPORT Isolate {
|
|
public:
|
|
/**
|
|
* Initial configuration parameters for a new Isolate.
|
|
*/
|
|
struct CreateParams {
|
|
CreateParams()
|
|
: entry_hook(nullptr),
|
|
code_event_handler(nullptr),
|
|
snapshot_blob(nullptr),
|
|
counter_lookup_callback(nullptr),
|
|
create_histogram_callback(nullptr),
|
|
add_histogram_sample_callback(nullptr),
|
|
array_buffer_allocator(nullptr),
|
|
external_references(nullptr),
|
|
allow_atomics_wait(true),
|
|
host_import_module_dynamically_callback_(nullptr) {}
|
|
|
|
/**
|
|
* The optional entry_hook allows the host application to provide the
|
|
* address of a function that's invoked on entry to every V8-generated
|
|
* function. Note that entry_hook is invoked at the very start of each
|
|
* generated function.
|
|
* An entry_hook can only be provided in no-snapshot builds; in snapshot
|
|
* builds it must be nullptr.
|
|
*/
|
|
FunctionEntryHook entry_hook;
|
|
|
|
/**
|
|
* Allows the host application to provide the address of a function that is
|
|
* notified each time code is added, moved or removed.
|
|
*/
|
|
JitCodeEventHandler code_event_handler;
|
|
|
|
/**
|
|
* ResourceConstraints to use for the new Isolate.
|
|
*/
|
|
ResourceConstraints constraints;
|
|
|
|
/**
|
|
* Explicitly specify a startup snapshot blob. The embedder owns the blob.
|
|
*/
|
|
StartupData* snapshot_blob;
|
|
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* statistics counters.
|
|
*/
|
|
CounterLookupCallback counter_lookup_callback;
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* histograms. The CreateHistogram function returns a
|
|
* histogram which will later be passed to the AddHistogramSample
|
|
* function.
|
|
*/
|
|
CreateHistogramCallback create_histogram_callback;
|
|
AddHistogramSampleCallback add_histogram_sample_callback;
|
|
|
|
/**
|
|
* The ArrayBuffer::Allocator to use for allocating and freeing the backing
|
|
* store of ArrayBuffers.
|
|
*/
|
|
ArrayBuffer::Allocator* array_buffer_allocator;
|
|
|
|
/**
|
|
* Specifies an optional nullptr-terminated array of raw addresses in the
|
|
* embedder that V8 can match against during serialization and use for
|
|
* deserialization. This array and its content must stay valid for the
|
|
* entire lifetime of the isolate.
|
|
*/
|
|
intptr_t* external_references;
|
|
|
|
/**
|
|
* Whether calling Atomics.wait (a function that may block) is allowed in
|
|
* this isolate. This can also be configured via SetAllowAtomicsWait.
|
|
*/
|
|
bool allow_atomics_wait;
|
|
|
|
/**
|
|
* This is an unfinished experimental feature, and is only exposed
|
|
* here for internal testing purposes. DO NOT USE.
|
|
*
|
|
* This specifies the callback called by the upcoming dynamic
|
|
* import() language feature to load modules.
|
|
*/
|
|
HostImportModuleDynamicallyCallback
|
|
host_import_module_dynamically_callback_;
|
|
};
|
|
|
|
|
|
/**
|
|
* Stack-allocated class which sets the isolate for all operations
|
|
* executed within a local scope.
|
|
*/
|
|
class V8_EXPORT Scope {
|
|
public:
|
|
explicit Scope(Isolate* isolate) : isolate_(isolate) {
|
|
isolate->Enter();
|
|
}
|
|
|
|
~Scope() { isolate_->Exit(); }
|
|
|
|
// Prevent copying of Scope objects.
|
|
Scope(const Scope&) = delete;
|
|
Scope& operator=(const Scope&) = delete;
|
|
|
|
private:
|
|
Isolate* const isolate_;
|
|
};
|
|
|
|
|
|
/**
|
|
* Assert that no Javascript code is invoked.
|
|
*/
|
|
class V8_EXPORT DisallowJavascriptExecutionScope {
|
|
public:
|
|
enum OnFailure { CRASH_ON_FAILURE, THROW_ON_FAILURE };
|
|
|
|
DisallowJavascriptExecutionScope(Isolate* isolate, OnFailure on_failure);
|
|
~DisallowJavascriptExecutionScope();
|
|
|
|
// Prevent copying of Scope objects.
|
|
DisallowJavascriptExecutionScope(const DisallowJavascriptExecutionScope&) =
|
|
delete;
|
|
DisallowJavascriptExecutionScope& operator=(
|
|
const DisallowJavascriptExecutionScope&) = delete;
|
|
|
|
private:
|
|
bool on_failure_;
|
|
void* internal_;
|
|
};
|
|
|
|
|
|
/**
|
|
* Introduce exception to DisallowJavascriptExecutionScope.
|
|
*/
|
|
class V8_EXPORT AllowJavascriptExecutionScope {
|
|
public:
|
|
explicit AllowJavascriptExecutionScope(Isolate* isolate);
|
|
~AllowJavascriptExecutionScope();
|
|
|
|
// Prevent copying of Scope objects.
|
|
AllowJavascriptExecutionScope(const AllowJavascriptExecutionScope&) =
|
|
delete;
|
|
AllowJavascriptExecutionScope& operator=(
|
|
const AllowJavascriptExecutionScope&) = delete;
|
|
|
|
private:
|
|
void* internal_throws_;
|
|
void* internal_assert_;
|
|
};
|
|
|
|
/**
|
|
* Do not run microtasks while this scope is active, even if microtasks are
|
|
* automatically executed otherwise.
|
|
*/
|
|
class V8_EXPORT SuppressMicrotaskExecutionScope {
|
|
public:
|
|
explicit SuppressMicrotaskExecutionScope(Isolate* isolate);
|
|
~SuppressMicrotaskExecutionScope();
|
|
|
|
// Prevent copying of Scope objects.
|
|
SuppressMicrotaskExecutionScope(const SuppressMicrotaskExecutionScope&) =
|
|
delete;
|
|
SuppressMicrotaskExecutionScope& operator=(
|
|
const SuppressMicrotaskExecutionScope&) = delete;
|
|
|
|
private:
|
|
internal::Isolate* const isolate_;
|
|
};
|
|
|
|
/**
|
|
* Types of garbage collections that can be requested via
|
|
* RequestGarbageCollectionForTesting.
|
|
*/
|
|
enum GarbageCollectionType {
|
|
kFullGarbageCollection,
|
|
kMinorGarbageCollection
|
|
};
|
|
|
|
/**
|
|
* Features reported via the SetUseCounterCallback callback. Do not change
|
|
* assigned numbers of existing items; add new features to the end of this
|
|
* list.
|
|
*/
|
|
enum UseCounterFeature {
|
|
kUseAsm = 0,
|
|
kBreakIterator = 1,
|
|
kLegacyConst = 2,
|
|
kMarkDequeOverflow = 3,
|
|
kStoreBufferOverflow = 4,
|
|
kSlotsBufferOverflow = 5,
|
|
kObjectObserve = 6,
|
|
kForcedGC = 7,
|
|
kSloppyMode = 8,
|
|
kStrictMode = 9,
|
|
kStrongMode = 10,
|
|
kRegExpPrototypeStickyGetter = 11,
|
|
kRegExpPrototypeToString = 12,
|
|
kRegExpPrototypeUnicodeGetter = 13,
|
|
kIntlV8Parse = 14,
|
|
kIntlPattern = 15,
|
|
kIntlResolved = 16,
|
|
kPromiseChain = 17,
|
|
kPromiseAccept = 18,
|
|
kPromiseDefer = 19,
|
|
kHtmlCommentInExternalScript = 20,
|
|
kHtmlComment = 21,
|
|
kSloppyModeBlockScopedFunctionRedefinition = 22,
|
|
kForInInitializer = 23,
|
|
kArrayProtectorDirtied = 24,
|
|
kArraySpeciesModified = 25,
|
|
kArrayPrototypeConstructorModified = 26,
|
|
kArrayInstanceProtoModified = 27,
|
|
kArrayInstanceConstructorModified = 28,
|
|
kLegacyFunctionDeclaration = 29,
|
|
kRegExpPrototypeSourceGetter = 30,
|
|
kRegExpPrototypeOldFlagGetter = 31,
|
|
kDecimalWithLeadingZeroInStrictMode = 32,
|
|
kLegacyDateParser = 33,
|
|
kDefineGetterOrSetterWouldThrow = 34,
|
|
kFunctionConstructorReturnedUndefined = 35,
|
|
kAssigmentExpressionLHSIsCallInSloppy = 36,
|
|
kAssigmentExpressionLHSIsCallInStrict = 37,
|
|
kPromiseConstructorReturnedUndefined = 38,
|
|
|
|
// If you add new values here, you'll also need to update Chromium's:
|
|
// UseCounter.h, V8PerIsolateData.cpp, histograms.xml
|
|
kUseCounterFeatureCount // This enum value must be last.
|
|
};
|
|
|
|
enum MessageErrorLevel {
|
|
kMessageLog = (1 << 0),
|
|
kMessageDebug = (1 << 1),
|
|
kMessageInfo = (1 << 2),
|
|
kMessageError = (1 << 3),
|
|
kMessageWarning = (1 << 4),
|
|
kMessageAll = kMessageLog | kMessageDebug | kMessageInfo | kMessageError |
|
|
kMessageWarning,
|
|
};
|
|
|
|
typedef void (*UseCounterCallback)(Isolate* isolate,
|
|
UseCounterFeature feature);
|
|
|
|
|
|
/**
|
|
* Creates a new isolate. Does not change the currently entered
|
|
* isolate.
|
|
*
|
|
* When an isolate is no longer used its resources should be freed
|
|
* by calling Dispose(). Using the delete operator is not allowed.
|
|
*
|
|
* V8::Initialize() must have run prior to this.
|
|
*/
|
|
static Isolate* New(const CreateParams& params);
|
|
|
|
/**
|
|
* Returns the entered isolate for the current thread or NULL in
|
|
* case there is no current isolate.
|
|
*
|
|
* This method must not be invoked before V8::Initialize() was invoked.
|
|
*/
|
|
static Isolate* GetCurrent();
|
|
|
|
/**
|
|
* Custom callback used by embedders to help V8 determine if it should abort
|
|
* when it throws and no internal handler is predicted to catch the
|
|
* exception. If --abort-on-uncaught-exception is used on the command line,
|
|
* then V8 will abort if either:
|
|
* - no custom callback is set.
|
|
* - the custom callback set returns true.
|
|
* Otherwise, the custom callback will not be called and V8 will not abort.
|
|
*/
|
|
typedef bool (*AbortOnUncaughtExceptionCallback)(Isolate*);
|
|
void SetAbortOnUncaughtExceptionCallback(
|
|
AbortOnUncaughtExceptionCallback callback);
|
|
|
|
/**
|
|
* Optional notification that the system is running low on memory.
|
|
* V8 uses these notifications to guide heuristics.
|
|
* It is allowed to call this function from another thread while
|
|
* the isolate is executing long running JavaScript code.
|
|
*/
|
|
void MemoryPressureNotification(MemoryPressureLevel level);
|
|
|
|
/**
|
|
* Methods below this point require holding a lock (using Locker) in
|
|
* a multi-threaded environment.
|
|
*/
|
|
|
|
/**
|
|
* Sets this isolate as the entered one for the current thread.
|
|
* Saves the previously entered one (if any), so that it can be
|
|
* restored when exiting. Re-entering an isolate is allowed.
|
|
*/
|
|
void Enter();
|
|
|
|
/**
|
|
* Exits this isolate by restoring the previously entered one in the
|
|
* current thread. The isolate may still stay the same, if it was
|
|
* entered more than once.
|
|
*
|
|
* Requires: this == Isolate::GetCurrent().
|
|
*/
|
|
void Exit();
|
|
|
|
/**
|
|
* Disposes the isolate. The isolate must not be entered by any
|
|
* thread to be disposable.
|
|
*/
|
|
void Dispose();
|
|
|
|
/**
|
|
* Dumps activated low-level V8 internal stats. This can be used instead
|
|
* of performing a full isolate disposal.
|
|
*/
|
|
void DumpAndResetStats();
|
|
|
|
/**
|
|
* Discards all V8 thread-specific data for the Isolate. Should be used
|
|
* if a thread is terminating and it has used an Isolate that will outlive
|
|
* the thread -- all thread-specific data for an Isolate is discarded when
|
|
* an Isolate is disposed so this call is pointless if an Isolate is about
|
|
* to be Disposed.
|
|
*/
|
|
void DiscardThreadSpecificMetadata();
|
|
|
|
/**
|
|
* Associate embedder-specific data with the isolate. |slot| has to be
|
|
* between 0 and GetNumberOfDataSlots() - 1.
|
|
*/
|
|
V8_INLINE void SetData(uint32_t slot, void* data);
|
|
|
|
/**
|
|
* Retrieve embedder-specific data from the isolate.
|
|
* Returns NULL if SetData has never been called for the given |slot|.
|
|
*/
|
|
V8_INLINE void* GetData(uint32_t slot);
|
|
|
|
/**
|
|
* Returns the maximum number of available embedder data slots. Valid slots
|
|
* are in the range of 0 - GetNumberOfDataSlots() - 1.
|
|
*/
|
|
V8_INLINE static uint32_t GetNumberOfDataSlots();
|
|
|
|
/**
|
|
* Get statistics about the heap memory usage.
|
|
*/
|
|
void GetHeapStatistics(HeapStatistics* heap_statistics);
|
|
|
|
/**
|
|
* Returns the number of spaces in the heap.
|
|
*/
|
|
size_t NumberOfHeapSpaces();
|
|
|
|
/**
|
|
* Get the memory usage of a space in the heap.
|
|
*
|
|
* \param space_statistics The HeapSpaceStatistics object to fill in
|
|
* statistics.
|
|
* \param index The index of the space to get statistics from, which ranges
|
|
* from 0 to NumberOfHeapSpaces() - 1.
|
|
* \returns true on success.
|
|
*/
|
|
bool GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics,
|
|
size_t index);
|
|
|
|
/**
|
|
* Returns the number of types of objects tracked in the heap at GC.
|
|
*/
|
|
size_t NumberOfTrackedHeapObjectTypes();
|
|
|
|
/**
|
|
* Get statistics about objects in the heap.
|
|
*
|
|
* \param object_statistics The HeapObjectStatistics object to fill in
|
|
* statistics of objects of given type, which were live in the previous GC.
|
|
* \param type_index The index of the type of object to fill details about,
|
|
* which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1.
|
|
* \returns true on success.
|
|
*/
|
|
bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics,
|
|
size_t type_index);
|
|
|
|
/**
|
|
* Get statistics about code and its metadata in the heap.
|
|
*
|
|
* \param object_statistics The HeapCodeStatistics object to fill in
|
|
* statistics of code, bytecode and their metadata.
|
|
* \returns true on success.
|
|
*/
|
|
bool GetHeapCodeAndMetadataStatistics(HeapCodeStatistics* object_statistics);
|
|
|
|
/**
|
|
* Get a call stack sample from the isolate.
|
|
* \param state Execution state.
|
|
* \param frames Caller allocated buffer to store stack frames.
|
|
* \param frames_limit Maximum number of frames to capture. The buffer must
|
|
* be large enough to hold the number of frames.
|
|
* \param sample_info The sample info is filled up by the function
|
|
* provides number of actual captured stack frames and
|
|
* the current VM state.
|
|
* \note GetStackSample should only be called when the JS thread is paused or
|
|
* interrupted. Otherwise the behavior is undefined.
|
|
*/
|
|
void GetStackSample(const RegisterState& state, void** frames,
|
|
size_t frames_limit, SampleInfo* sample_info);
|
|
|
|
/**
|
|
* Adjusts the amount of registered external memory. Used to give V8 an
|
|
* indication of the amount of externally allocated memory that is kept alive
|
|
* by JavaScript objects. V8 uses this to decide when to perform global
|
|
* garbage collections. Registering externally allocated memory will trigger
|
|
* global garbage collections more often than it would otherwise in an attempt
|
|
* to garbage collect the JavaScript objects that keep the externally
|
|
* allocated memory alive.
|
|
*
|
|
* \param change_in_bytes the change in externally allocated memory that is
|
|
* kept alive by JavaScript objects.
|
|
* \returns the adjusted value.
|
|
*/
|
|
V8_INLINE int64_t
|
|
AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes);
|
|
|
|
/**
|
|
* Returns the number of phantom handles without callbacks that were reset
|
|
* by the garbage collector since the last call to this function.
|
|
*/
|
|
size_t NumberOfPhantomHandleResetsSinceLastCall();
|
|
|
|
/**
|
|
* Returns heap profiler for this isolate. Will return NULL until the isolate
|
|
* is initialized.
|
|
*/
|
|
HeapProfiler* GetHeapProfiler();
|
|
|
|
/**
|
|
* Returns CPU profiler for this isolate. Will return NULL unless the isolate
|
|
* is initialized. It is the embedder's responsibility to stop all CPU
|
|
* profiling activities if it has started any.
|
|
*/
|
|
V8_DEPRECATE_SOON("CpuProfiler should be created with CpuProfiler::New call.",
|
|
CpuProfiler* GetCpuProfiler());
|
|
|
|
/** Returns true if this isolate has a current context. */
|
|
bool InContext();
|
|
|
|
/**
|
|
* Returns the context of the currently running JavaScript, or the context
|
|
* on the top of the stack if no JavaScript is running.
|
|
*/
|
|
Local<Context> GetCurrentContext();
|
|
|
|
/**
|
|
* Returns the context of the calling JavaScript code. That is the
|
|
* context of the top-most JavaScript frame. If there are no
|
|
* JavaScript frames an empty handle is returned.
|
|
*/
|
|
V8_DEPRECATE_SOON(
|
|
"Calling context concept is not compatible with tail calls, and will be "
|
|
"removed.",
|
|
Local<Context> GetCallingContext());
|
|
|
|
/** Returns the last context entered through V8's C++ API. */
|
|
Local<Context> GetEnteredContext();
|
|
|
|
/**
|
|
* Returns either the last context entered through V8's C++ API, or the
|
|
* context of the currently running microtask while processing microtasks.
|
|
* If a context is entered while executing a microtask, that context is
|
|
* returned.
|
|
*/
|
|
Local<Context> GetEnteredOrMicrotaskContext();
|
|
|
|
/**
|
|
* Schedules an exception to be thrown when returning to JavaScript. When an
|
|
* exception has been scheduled it is illegal to invoke any JavaScript
|
|
* operation; the caller must return immediately and only after the exception
|
|
* has been handled does it become legal to invoke JavaScript operations.
|
|
*/
|
|
Local<Value> ThrowException(Local<Value> exception);
|
|
|
|
typedef void (*GCCallback)(Isolate* isolate, GCType type,
|
|
GCCallbackFlags flags);
|
|
|
|
/**
|
|
* Enables the host application to receive a notification before a
|
|
* garbage collection. Allocations are allowed in the callback function,
|
|
* but the callback is not re-entrant: if the allocation inside it will
|
|
* trigger the garbage collection, the callback won't be called again.
|
|
* It is possible to specify the GCType filter for your callback. But it is
|
|
* not possible to register the same callback function two times with
|
|
* different GCType filters.
|
|
*/
|
|
void AddGCPrologueCallback(GCCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll);
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCPrologueCallback function.
|
|
*/
|
|
void RemoveGCPrologueCallback(GCCallback callback);
|
|
|
|
/**
|
|
* Sets the embedder heap tracer for the isolate.
|
|
*/
|
|
void SetEmbedderHeapTracer(EmbedderHeapTracer* tracer);
|
|
|
|
/**
|
|
* Enables the host application to receive a notification after a
|
|
* garbage collection. Allocations are allowed in the callback function,
|
|
* but the callback is not re-entrant: if the allocation inside it will
|
|
* trigger the garbage collection, the callback won't be called again.
|
|
* It is possible to specify the GCType filter for your callback. But it is
|
|
* not possible to register the same callback function two times with
|
|
* different GCType filters.
|
|
*/
|
|
void AddGCEpilogueCallback(GCCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll);
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCEpilogueCallback function.
|
|
*/
|
|
void RemoveGCEpilogueCallback(GCCallback callback);
|
|
|
|
/**
|
|
* Forcefully terminate the current thread of JavaScript execution
|
|
* in the given isolate.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*/
|
|
void TerminateExecution();
|
|
|
|
/**
|
|
* Is V8 terminating JavaScript execution.
|
|
*
|
|
* Returns true if JavaScript execution is currently terminating
|
|
* because of a call to TerminateExecution. In that case there are
|
|
* still JavaScript frames on the stack and the termination
|
|
* exception is still active.
|
|
*/
|
|
bool IsExecutionTerminating();
|
|
|
|
/**
|
|
* Resume execution capability in the given isolate, whose execution
|
|
* was previously forcefully terminated using TerminateExecution().
|
|
*
|
|
* When execution is forcefully terminated using TerminateExecution(),
|
|
* the isolate can not resume execution until all JavaScript frames
|
|
* have propagated the uncatchable exception which is generated. This
|
|
* method allows the program embedding the engine to handle the
|
|
* termination event and resume execution capability, even if
|
|
* JavaScript frames remain on the stack.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*/
|
|
void CancelTerminateExecution();
|
|
|
|
/**
|
|
* Request V8 to interrupt long running JavaScript code and invoke
|
|
* the given |callback| passing the given |data| to it. After |callback|
|
|
* returns control will be returned to the JavaScript code.
|
|
* There may be a number of interrupt requests in flight.
|
|
* Can be called from another thread without acquiring a |Locker|.
|
|
* Registered |callback| must not reenter interrupted Isolate.
|
|
*/
|
|
void RequestInterrupt(InterruptCallback callback, void* data);
|
|
|
|
/**
|
|
* Request garbage collection in this Isolate. It is only valid to call this
|
|
* function if --expose_gc was specified.
|
|
*
|
|
* This should only be used for testing purposes and not to enforce a garbage
|
|
* collection schedule. It has strong negative impact on the garbage
|
|
* collection performance. Use IdleNotificationDeadline() or
|
|
* LowMemoryNotification() instead to influence the garbage collection
|
|
* schedule.
|
|
*/
|
|
void RequestGarbageCollectionForTesting(GarbageCollectionType type);
|
|
|
|
/**
|
|
* Set the callback to invoke for logging event.
|
|
*/
|
|
void SetEventLogger(LogEventCallback that);
|
|
|
|
/**
|
|
* Adds a callback to notify the host application right before a script
|
|
* is about to run. If a script re-enters the runtime during executing, the
|
|
* BeforeCallEnteredCallback is invoked for each re-entrance.
|
|
* Executing scripts inside the callback will re-trigger the callback.
|
|
*/
|
|
void AddBeforeCallEnteredCallback(BeforeCallEnteredCallback callback);
|
|
|
|
/**
|
|
* Removes callback that was installed by AddBeforeCallEnteredCallback.
|
|
*/
|
|
void RemoveBeforeCallEnteredCallback(BeforeCallEnteredCallback callback);
|
|
|
|
/**
|
|
* Adds a callback to notify the host application when a script finished
|
|
* running. If a script re-enters the runtime during executing, the
|
|
* CallCompletedCallback is only invoked when the outer-most script
|
|
* execution ends. Executing scripts inside the callback do not trigger
|
|
* further callbacks.
|
|
*/
|
|
void AddCallCompletedCallback(CallCompletedCallback callback);
|
|
V8_DEPRECATE_SOON(
|
|
"Use callback with parameter",
|
|
void AddCallCompletedCallback(DeprecatedCallCompletedCallback callback));
|
|
|
|
/**
|
|
* Removes callback that was installed by AddCallCompletedCallback.
|
|
*/
|
|
void RemoveCallCompletedCallback(CallCompletedCallback callback);
|
|
V8_DEPRECATE_SOON(
|
|
"Use callback with parameter",
|
|
void RemoveCallCompletedCallback(
|
|
DeprecatedCallCompletedCallback callback));
|
|
|
|
/**
|
|
* Experimental: Set the PromiseHook callback for various promise
|
|
* lifecycle events.
|
|
*/
|
|
void SetPromiseHook(PromiseHook hook);
|
|
|
|
/**
|
|
* Set callback to notify about promise reject with no handler, or
|
|
* revocation of such a previous notification once the handler is added.
|
|
*/
|
|
void SetPromiseRejectCallback(PromiseRejectCallback callback);
|
|
|
|
/**
|
|
* Experimental: Runs the Microtask Work Queue until empty
|
|
* Any exceptions thrown by microtask callbacks are swallowed.
|
|
*/
|
|
void RunMicrotasks();
|
|
|
|
/**
|
|
* Experimental: Enqueues the callback to the Microtask Work Queue
|
|
*/
|
|
void EnqueueMicrotask(Local<Function> microtask);
|
|
|
|
/**
|
|
* Experimental: Enqueues the callback to the Microtask Work Queue
|
|
*/
|
|
void EnqueueMicrotask(MicrotaskCallback microtask, void* data = NULL);
|
|
|
|
/**
|
|
* Experimental: Controls how Microtasks are invoked. See MicrotasksPolicy
|
|
* for details.
|
|
*/
|
|
void SetMicrotasksPolicy(MicrotasksPolicy policy);
|
|
V8_DEPRECATE_SOON("Use SetMicrotasksPolicy",
|
|
void SetAutorunMicrotasks(bool autorun));
|
|
|
|
/**
|
|
* Experimental: Returns the policy controlling how Microtasks are invoked.
|
|
*/
|
|
MicrotasksPolicy GetMicrotasksPolicy() const;
|
|
V8_DEPRECATE_SOON("Use GetMicrotasksPolicy",
|
|
bool WillAutorunMicrotasks() const);
|
|
|
|
/**
|
|
* Experimental: adds a callback to notify the host application after
|
|
* microtasks were run. The callback is triggered by explicit RunMicrotasks
|
|
* call or automatic microtasks execution (see SetAutorunMicrotasks).
|
|
*
|
|
* Callback will trigger even if microtasks were attempted to run,
|
|
* but the microtasks queue was empty and no single microtask was actually
|
|
* executed.
|
|
*
|
|
* Executing scriptsinside the callback will not re-trigger microtasks and
|
|
* the callback.
|
|
*/
|
|
void AddMicrotasksCompletedCallback(MicrotasksCompletedCallback callback);
|
|
|
|
/**
|
|
* Removes callback that was installed by AddMicrotasksCompletedCallback.
|
|
*/
|
|
void RemoveMicrotasksCompletedCallback(MicrotasksCompletedCallback callback);
|
|
|
|
/**
|
|
* Sets a callback for counting the number of times a feature of V8 is used.
|
|
*/
|
|
void SetUseCounterCallback(UseCounterCallback callback);
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* statistics counters.
|
|
*/
|
|
void SetCounterFunction(CounterLookupCallback);
|
|
|
|
/**
|
|
* Enables the host application to provide a mechanism for recording
|
|
* histograms. The CreateHistogram function returns a
|
|
* histogram which will later be passed to the AddHistogramSample
|
|
* function.
|
|
*/
|
|
void SetCreateHistogramFunction(CreateHistogramCallback);
|
|
void SetAddHistogramSampleFunction(AddHistogramSampleCallback);
|
|
|
|
/**
|
|
* Optional notification that the embedder is idle.
|
|
* V8 uses the notification to perform garbage collection.
|
|
* This call can be used repeatedly if the embedder remains idle.
|
|
* Returns true if the embedder should stop calling IdleNotificationDeadline
|
|
* until real work has been done. This indicates that V8 has done
|
|
* as much cleanup as it will be able to do.
|
|
*
|
|
* The deadline_in_seconds argument specifies the deadline V8 has to finish
|
|
* garbage collection work. deadline_in_seconds is compared with
|
|
* MonotonicallyIncreasingTime() and should be based on the same timebase as
|
|
* that function. There is no guarantee that the actual work will be done
|
|
* within the time limit.
|
|
*/
|
|
bool IdleNotificationDeadline(double deadline_in_seconds);
|
|
|
|
V8_DEPRECATED("use IdleNotificationDeadline()",
|
|
bool IdleNotification(int idle_time_in_ms));
|
|
|
|
/**
|
|
* Optional notification that the system is running low on memory.
|
|
* V8 uses these notifications to attempt to free memory.
|
|
*/
|
|
void LowMemoryNotification();
|
|
|
|
/**
|
|
* Optional notification that a context has been disposed. V8 uses
|
|
* these notifications to guide the GC heuristic. Returns the number
|
|
* of context disposals - including this one - since the last time
|
|
* V8 had a chance to clean up.
|
|
*
|
|
* The optional parameter |dependant_context| specifies whether the disposed
|
|
* context was depending on state from other contexts or not.
|
|
*/
|
|
int ContextDisposedNotification(bool dependant_context = true);
|
|
|
|
/**
|
|
* Optional notification that the isolate switched to the foreground.
|
|
* V8 uses these notifications to guide heuristics.
|
|
*/
|
|
void IsolateInForegroundNotification();
|
|
|
|
/**
|
|
* Optional notification that the isolate switched to the background.
|
|
* V8 uses these notifications to guide heuristics.
|
|
*/
|
|
void IsolateInBackgroundNotification();
|
|
|
|
/**
|
|
* Optional notification to tell V8 the current performance requirements
|
|
* of the embedder based on RAIL.
|
|
* V8 uses these notifications to guide heuristics.
|
|
* This is an unfinished experimental feature. Semantics and implementation
|
|
* may change frequently.
|
|
*/
|
|
void SetRAILMode(RAILMode rail_mode);
|
|
|
|
/**
|
|
* Optional notification to tell V8 the current isolate is used for debugging
|
|
* and requires higher heap limit.
|
|
*/
|
|
void IncreaseHeapLimitForDebugging();
|
|
|
|
/**
|
|
* Restores the original heap limit after IncreaseHeapLimitForDebugging().
|
|
*/
|
|
void RestoreOriginalHeapLimit();
|
|
|
|
/**
|
|
* Returns true if the heap limit was increased for debugging and the
|
|
* original heap limit was not restored yet.
|
|
*/
|
|
bool IsHeapLimitIncreasedForDebugging();
|
|
|
|
/**
|
|
* Allows the host application to provide the address of a function that is
|
|
* notified each time code is added, moved or removed.
|
|
*
|
|
* \param options options for the JIT code event handler.
|
|
* \param event_handler the JIT code event handler, which will be invoked
|
|
* each time code is added, moved or removed.
|
|
* \note \p event_handler won't get notified of existent code.
|
|
* \note since code removal notifications are not currently issued, the
|
|
* \p event_handler may get notifications of code that overlaps earlier
|
|
* code notifications. This happens when code areas are reused, and the
|
|
* earlier overlapping code areas should therefore be discarded.
|
|
* \note the events passed to \p event_handler and the strings they point to
|
|
* are not guaranteed to live past each call. The \p event_handler must
|
|
* copy strings and other parameters it needs to keep around.
|
|
* \note the set of events declared in JitCodeEvent::EventType is expected to
|
|
* grow over time, and the JitCodeEvent structure is expected to accrue
|
|
* new members. The \p event_handler function must ignore event codes
|
|
* it does not recognize to maintain future compatibility.
|
|
* \note Use Isolate::CreateParams to get events for code executed during
|
|
* Isolate setup.
|
|
*/
|
|
void SetJitCodeEventHandler(JitCodeEventOptions options,
|
|
JitCodeEventHandler event_handler);
|
|
|
|
/**
|
|
* Modifies the stack limit for this Isolate.
|
|
*
|
|
* \param stack_limit An address beyond which the Vm's stack may not grow.
|
|
*
|
|
* \note If you are using threads then you should hold the V8::Locker lock
|
|
* while setting the stack limit and you must set a non-default stack
|
|
* limit separately for each thread.
|
|
*/
|
|
void SetStackLimit(uintptr_t stack_limit);
|
|
|
|
/**
|
|
* Returns a memory range that can potentially contain jitted code.
|
|
*
|
|
* On Win64, embedders are advised to install function table callbacks for
|
|
* these ranges, as default SEH won't be able to unwind through jitted code.
|
|
*
|
|
* The first page of the code range is reserved for the embedder and is
|
|
* committed, writable, and executable.
|
|
*
|
|
* Might be empty on other platforms.
|
|
*
|
|
* https://code.google.com/p/v8/issues/detail?id=3598
|
|
*/
|
|
void GetCodeRange(void** start, size_t* length_in_bytes);
|
|
|
|
/** Set the callback to invoke in case of fatal errors. */
|
|
void SetFatalErrorHandler(FatalErrorCallback that);
|
|
|
|
/** Set the callback to invoke in case of OOM errors. */
|
|
void SetOOMErrorHandler(OOMErrorCallback that);
|
|
|
|
/**
|
|
* Set the callback to invoke to check if code generation from
|
|
* strings should be allowed.
|
|
*/
|
|
void SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback callback);
|
|
|
|
/**
|
|
* Embedder over{ride|load} injection points for wasm APIs.
|
|
*/
|
|
void SetWasmModuleCallback(ExtensionCallback callback);
|
|
void SetWasmCompileCallback(ExtensionCallback callback);
|
|
void SetWasmInstanceCallback(ExtensionCallback callback);
|
|
void SetWasmInstantiateCallback(ExtensionCallback callback);
|
|
|
|
/**
|
|
* Check if V8 is dead and therefore unusable. This is the case after
|
|
* fatal errors such as out-of-memory situations.
|
|
*/
|
|
bool IsDead();
|
|
|
|
/**
|
|
* Adds a message listener (errors only).
|
|
*
|
|
* The same message listener can be added more than once and in that
|
|
* case it will be called more than once for each message.
|
|
*
|
|
* If data is specified, it will be passed to the callback when it is called.
|
|
* Otherwise, the exception object will be passed to the callback instead.
|
|
*/
|
|
bool AddMessageListener(MessageCallback that,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Adds a message listener.
|
|
*
|
|
* The same message listener can be added more than once and in that
|
|
* case it will be called more than once for each message.
|
|
*
|
|
* If data is specified, it will be passed to the callback when it is called.
|
|
* Otherwise, the exception object will be passed to the callback instead.
|
|
*
|
|
* A listener can listen for particular error levels by providing a mask.
|
|
*/
|
|
bool AddMessageListenerWithErrorLevel(MessageCallback that,
|
|
int message_levels,
|
|
Local<Value> data = Local<Value>());
|
|
|
|
/**
|
|
* Remove all message listeners from the specified callback function.
|
|
*/
|
|
void RemoveMessageListeners(MessageCallback that);
|
|
|
|
/** Callback function for reporting failed access checks.*/
|
|
void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback);
|
|
|
|
/**
|
|
* Tells V8 to capture current stack trace when uncaught exception occurs
|
|
* and report it to the message listeners. The option is off by default.
|
|
*/
|
|
void SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit = 10,
|
|
StackTrace::StackTraceOptions options = StackTrace::kOverview);
|
|
|
|
/**
|
|
* Iterates through all external resources referenced from current isolate
|
|
* heap. GC is not invoked prior to iterating, therefore there is no
|
|
* guarantee that visited objects are still alive.
|
|
*/
|
|
void VisitExternalResources(ExternalResourceVisitor* visitor);
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids.
|
|
*/
|
|
void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor);
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids and are candidates to be marked as partially dependent
|
|
* handles. This will visit handles to young objects created since the last
|
|
* garbage collection but is free to visit an arbitrary superset of these
|
|
* objects.
|
|
*/
|
|
void VisitHandlesForPartialDependence(PersistentHandleVisitor* visitor);
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids and are weak to be marked as inactive if there is no
|
|
* pending activity for the handle.
|
|
*/
|
|
void VisitWeakHandles(PersistentHandleVisitor* visitor);
|
|
|
|
/**
|
|
* Check if this isolate is in use.
|
|
* True if at least one thread Enter'ed this isolate.
|
|
*/
|
|
bool IsInUse();
|
|
|
|
/**
|
|
* Set whether calling Atomics.wait (a function that may block) is allowed in
|
|
* this isolate. This can also be configured via
|
|
* CreateParams::allow_atomics_wait.
|
|
*/
|
|
void SetAllowAtomicsWait(bool allow);
|
|
|
|
Isolate() = delete;
|
|
~Isolate() = delete;
|
|
Isolate(const Isolate&) = delete;
|
|
Isolate& operator=(const Isolate&) = delete;
|
|
void* operator new(size_t size) = delete;
|
|
void operator delete(void*, size_t) = delete;
|
|
|
|
private:
|
|
template <class K, class V, class Traits>
|
|
friend class PersistentValueMapBase;
|
|
|
|
void ReportExternalAllocationLimitReached();
|
|
};
|
|
|
|
class V8_EXPORT StartupData {
|
|
public:
|
|
const char* data;
|
|
int raw_size;
|
|
};
|
|
|
|
|
|
/**
|
|
* EntropySource is used as a callback function when v8 needs a source
|
|
* of entropy.
|
|
*/
|
|
typedef bool (*EntropySource)(unsigned char* buffer, size_t length);
|
|
|
|
/**
|
|
* ReturnAddressLocationResolver is used as a callback function when v8 is
|
|
* resolving the location of a return address on the stack. Profilers that
|
|
* change the return address on the stack can use this to resolve the stack
|
|
* location to whereever the profiler stashed the original return address.
|
|
*
|
|
* \param return_addr_location A location on stack where a machine
|
|
* return address resides.
|
|
* \returns Either return_addr_location, or else a pointer to the profiler's
|
|
* copy of the original return address.
|
|
*
|
|
* \note The resolver function must not cause garbage collection.
|
|
*/
|
|
typedef uintptr_t (*ReturnAddressLocationResolver)(
|
|
uintptr_t return_addr_location);
|
|
|
|
|
|
/**
|
|
* Container class for static utility functions.
|
|
*/
|
|
class V8_EXPORT V8 {
|
|
public:
|
|
/** Set the callback to invoke in case of fatal errors. */
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void SetFatalErrorHandler(FatalErrorCallback that));
|
|
|
|
/**
|
|
* Set the callback to invoke to check if code generation from
|
|
* strings should be allowed.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version", void SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback that));
|
|
|
|
/**
|
|
* Check if V8 is dead and therefore unusable. This is the case after
|
|
* fatal errors such as out-of-memory situations.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED("Use isolate version", bool IsDead());
|
|
|
|
/**
|
|
* Hand startup data to V8, in case the embedder has chosen to build
|
|
* V8 with external startup data.
|
|
*
|
|
* Note:
|
|
* - By default the startup data is linked into the V8 library, in which
|
|
* case this function is not meaningful.
|
|
* - If this needs to be called, it needs to be called before V8
|
|
* tries to make use of its built-ins.
|
|
* - To avoid unnecessary copies of data, V8 will point directly into the
|
|
* given data blob, so pretty please keep it around until V8 exit.
|
|
* - Compression of the startup blob might be useful, but needs to
|
|
* handled entirely on the embedders' side.
|
|
* - The call will abort if the data is invalid.
|
|
*/
|
|
static void SetNativesDataBlob(StartupData* startup_blob);
|
|
static void SetSnapshotDataBlob(StartupData* startup_blob);
|
|
|
|
/**
|
|
* Bootstrap an isolate and a context from scratch to create a startup
|
|
* snapshot. Include the side-effects of running the optional script.
|
|
* Returns { NULL, 0 } on failure.
|
|
* The caller acquires ownership of the data array in the return value.
|
|
*/
|
|
static StartupData CreateSnapshotDataBlob(const char* embedded_source = NULL);
|
|
|
|
/**
|
|
* Bootstrap an isolate and a context from the cold startup blob, run the
|
|
* warm-up script to trigger code compilation. The side effects are then
|
|
* discarded. The resulting startup snapshot will include compiled code.
|
|
* Returns { NULL, 0 } on failure.
|
|
* The caller acquires ownership of the data array in the return value.
|
|
* The argument startup blob is untouched.
|
|
*/
|
|
static StartupData WarmUpSnapshotDataBlob(StartupData cold_startup_blob,
|
|
const char* warmup_source);
|
|
|
|
/**
|
|
* Adds a message listener.
|
|
*
|
|
* The same message listener can be added more than once and in that
|
|
* case it will be called more than once for each message.
|
|
*
|
|
* If data is specified, it will be passed to the callback when it is called.
|
|
* Otherwise, the exception object will be passed to the callback instead.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
bool AddMessageListener(MessageCallback that,
|
|
Local<Value> data = Local<Value>()));
|
|
|
|
/**
|
|
* Remove all message listeners from the specified callback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version", void RemoveMessageListeners(MessageCallback that));
|
|
|
|
/**
|
|
* Tells V8 to capture current stack trace when uncaught exception occurs
|
|
* and report it to the message listeners. The option is off by default.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit = 10,
|
|
StackTrace::StackTraceOptions options = StackTrace::kOverview));
|
|
|
|
/**
|
|
* Sets V8 flags from a string.
|
|
*/
|
|
static void SetFlagsFromString(const char* str, int length);
|
|
|
|
/**
|
|
* Sets V8 flags from the command line.
|
|
*/
|
|
static void SetFlagsFromCommandLine(int* argc,
|
|
char** argv,
|
|
bool remove_flags);
|
|
|
|
/** Get the version string. */
|
|
static const char* GetVersion();
|
|
|
|
/** Callback function for reporting failed access checks.*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback));
|
|
|
|
/**
|
|
* Enables the host application to receive a notification before a
|
|
* garbage collection. Allocations are not allowed in the
|
|
* callback function, you therefore cannot manipulate objects (set
|
|
* or delete properties for example) since it is possible such
|
|
* operations will result in the allocation of objects. It is possible
|
|
* to specify the GCType filter for your callback. But it is not possible to
|
|
* register the same callback function two times with different
|
|
* GCType filters.
|
|
*/
|
|
static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void AddGCPrologueCallback(GCCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll));
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCPrologueCallback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void RemoveGCPrologueCallback(GCCallback callback));
|
|
|
|
/**
|
|
* Enables the host application to receive a notification after a
|
|
* garbage collection. Allocations are not allowed in the
|
|
* callback function, you therefore cannot manipulate objects (set
|
|
* or delete properties for example) since it is possible such
|
|
* operations will result in the allocation of objects. It is possible
|
|
* to specify the GCType filter for your callback. But it is not possible to
|
|
* register the same callback function two times with different
|
|
* GCType filters.
|
|
*/
|
|
static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void AddGCEpilogueCallback(GCCallback callback,
|
|
GCType gc_type_filter = kGCTypeAll));
|
|
|
|
/**
|
|
* This function removes callback which was installed by
|
|
* AddGCEpilogueCallback function.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void RemoveGCEpilogueCallback(GCCallback callback));
|
|
|
|
/**
|
|
* Initializes V8. This function needs to be called before the first Isolate
|
|
* is created. It always returns true.
|
|
*/
|
|
static bool Initialize();
|
|
|
|
/**
|
|
* Allows the host application to provide a callback which can be used
|
|
* as a source of entropy for random number generators.
|
|
*/
|
|
static void SetEntropySource(EntropySource source);
|
|
|
|
/**
|
|
* Allows the host application to provide a callback that allows v8 to
|
|
* cooperate with a profiler that rewrites return addresses on stack.
|
|
*/
|
|
static void SetReturnAddressLocationResolver(
|
|
ReturnAddressLocationResolver return_address_resolver);
|
|
|
|
/**
|
|
* Forcefully terminate the current thread of JavaScript execution
|
|
* in the given isolate.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*
|
|
* \param isolate The isolate in which to terminate the current JS execution.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED("Use isolate version",
|
|
void TerminateExecution(Isolate* isolate));
|
|
|
|
/**
|
|
* Is V8 terminating JavaScript execution.
|
|
*
|
|
* Returns true if JavaScript execution is currently terminating
|
|
* because of a call to TerminateExecution. In that case there are
|
|
* still JavaScript frames on the stack and the termination
|
|
* exception is still active.
|
|
*
|
|
* \param isolate The isolate in which to check.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
bool IsExecutionTerminating(Isolate* isolate = NULL));
|
|
|
|
/**
|
|
* Resume execution capability in the given isolate, whose execution
|
|
* was previously forcefully terminated using TerminateExecution().
|
|
*
|
|
* When execution is forcefully terminated using TerminateExecution(),
|
|
* the isolate can not resume execution until all JavaScript frames
|
|
* have propagated the uncatchable exception which is generated. This
|
|
* method allows the program embedding the engine to handle the
|
|
* termination event and resume execution capability, even if
|
|
* JavaScript frames remain on the stack.
|
|
*
|
|
* This method can be used by any thread even if that thread has not
|
|
* acquired the V8 lock with a Locker object.
|
|
*
|
|
* \param isolate The isolate in which to resume execution capability.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version", void CancelTerminateExecution(Isolate* isolate));
|
|
|
|
/**
|
|
* Releases any resources used by v8 and stops any utility threads
|
|
* that may be running. Note that disposing v8 is permanent, it
|
|
* cannot be reinitialized.
|
|
*
|
|
* It should generally not be necessary to dispose v8 before exiting
|
|
* a process, this should happen automatically. It is only necessary
|
|
* to use if the process needs the resources taken up by v8.
|
|
*/
|
|
static bool Dispose();
|
|
|
|
/**
|
|
* Iterates through all external resources referenced from current isolate
|
|
* heap. GC is not invoked prior to iterating, therefore there is no
|
|
* guarantee that visited objects are still alive.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void VisitExternalResources(ExternalResourceVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in isolate's heap that have
|
|
* class_ids.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void VisitHandlesWithClassIds(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Iterates through all the persistent handles in the current isolate's heap
|
|
* that have class_ids and are candidates to be marked as partially dependent
|
|
* handles. This will visit handles to young objects created since the last
|
|
* garbage collection but is free to visit an arbitrary superset of these
|
|
* objects.
|
|
*/
|
|
V8_INLINE static V8_DEPRECATED(
|
|
"Use isolate version",
|
|
void VisitHandlesForPartialDependence(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor));
|
|
|
|
/**
|
|
* Initialize the ICU library bundled with V8. The embedder should only
|
|
* invoke this method when using the bundled ICU. Returns true on success.
|
|
*
|
|
* If V8 was compiled with the ICU data in an external file, the location
|
|
* of the data file has to be provided.
|
|
*/
|
|
V8_DEPRECATE_SOON(
|
|
"Use version with default location.",
|
|
static bool InitializeICU(const char* icu_data_file = nullptr));
|
|
|
|
/**
|
|
* Initialize the ICU library bundled with V8. The embedder should only
|
|
* invoke this method when using the bundled ICU. If V8 was compiled with
|
|
* the ICU data in an external file and when the default location of that
|
|
* file should be used, a path to the executable must be provided.
|
|
* Returns true on success.
|
|
*
|
|
* The default is a file called icudtl.dat side-by-side with the executable.
|
|
*
|
|
* Optionally, the location of the data file can be provided to override the
|
|
* default.
|
|
*/
|
|
static bool InitializeICUDefaultLocation(const char* exec_path,
|
|
const char* icu_data_file = nullptr);
|
|
|
|
/**
|
|
* Initialize the external startup data. The embedder only needs to
|
|
* invoke this method when external startup data was enabled in a build.
|
|
*
|
|
* If V8 was compiled with the startup data in an external file, then
|
|
* V8 needs to be given those external files during startup. There are
|
|
* three ways to do this:
|
|
* - InitializeExternalStartupData(const char*)
|
|
* This will look in the given directory for files "natives_blob.bin"
|
|
* and "snapshot_blob.bin" - which is what the default build calls them.
|
|
* - InitializeExternalStartupData(const char*, const char*)
|
|
* As above, but will directly use the two given file names.
|
|
* - Call SetNativesDataBlob, SetNativesDataBlob.
|
|
* This will read the blobs from the given data structures and will
|
|
* not perform any file IO.
|
|
*/
|
|
static void InitializeExternalStartupData(const char* directory_path);
|
|
static void InitializeExternalStartupData(const char* natives_blob,
|
|
const char* snapshot_blob);
|
|
/**
|
|
* Sets the v8::Platform to use. This should be invoked before V8 is
|
|
* initialized.
|
|
*/
|
|
static void InitializePlatform(Platform* platform);
|
|
|
|
/**
|
|
* Clears all references to the v8::Platform. This should be invoked after
|
|
* V8 was disposed.
|
|
*/
|
|
static void ShutdownPlatform();
|
|
|
|
#if V8_OS_LINUX && V8_TARGET_ARCH_X64 && !V8_OS_ANDROID
|
|
/**
|
|
* Give the V8 signal handler a chance to handle a fault.
|
|
*
|
|
* This function determines whether a memory access violation can be recovered
|
|
* by V8. If so, it will return true and modify context to return to a code
|
|
* fragment that can recover from the fault. Otherwise, TryHandleSignal will
|
|
* return false.
|
|
*
|
|
* The parameters to this function correspond to those passed to a Linux
|
|
* signal handler.
|
|
*
|
|
* \param signal_number The signal number.
|
|
*
|
|
* \param info A pointer to the siginfo_t structure provided to the signal
|
|
* handler.
|
|
*
|
|
* \param context The third argument passed to the Linux signal handler, which
|
|
* points to a ucontext_t structure.
|
|
*/
|
|
static bool TryHandleSignal(int signal_number, void* info, void* context);
|
|
#endif // V8_OS_LINUX
|
|
|
|
/**
|
|
* Enable the default signal handler rather than using one provided by the
|
|
* embedder.
|
|
*/
|
|
static bool RegisterDefaultSignalHandler();
|
|
|
|
private:
|
|
V8();
|
|
|
|
static internal::Object** GlobalizeReference(internal::Isolate* isolate,
|
|
internal::Object** handle);
|
|
static internal::Object** CopyPersistent(internal::Object** handle);
|
|
static void DisposeGlobal(internal::Object** global_handle);
|
|
static void MakeWeak(internal::Object** location, void* data,
|
|
WeakCallbackInfo<void>::Callback weak_callback,
|
|
WeakCallbackType type);
|
|
static void MakeWeak(internal::Object** location, void* data,
|
|
// Must be 0 or -1.
|
|
int internal_field_index1,
|
|
// Must be 1 or -1.
|
|
int internal_field_index2,
|
|
WeakCallbackInfo<void>::Callback weak_callback);
|
|
static void MakeWeak(internal::Object*** location_addr);
|
|
static void* ClearWeak(internal::Object** location);
|
|
static Value* Eternalize(Isolate* isolate, Value* handle);
|
|
|
|
static void RegisterExternallyReferencedObject(internal::Object** object,
|
|
internal::Isolate* isolate);
|
|
|
|
template <class K, class V, class T>
|
|
friend class PersistentValueMapBase;
|
|
|
|
static void FromJustIsNothing();
|
|
static void ToLocalEmpty();
|
|
static void InternalFieldOutOfBounds(int index);
|
|
template <class T> friend class Local;
|
|
template <class T>
|
|
friend class MaybeLocal;
|
|
template <class T>
|
|
friend class Maybe;
|
|
template <class T>
|
|
friend class WeakCallbackInfo;
|
|
template <class T> friend class Eternal;
|
|
template <class T> friend class PersistentBase;
|
|
template <class T, class M> friend class Persistent;
|
|
friend class Context;
|
|
};
|
|
|
|
/**
|
|
* Helper class to create a snapshot data blob.
|
|
*/
|
|
class V8_EXPORT SnapshotCreator {
|
|
public:
|
|
enum class FunctionCodeHandling { kClear, kKeep };
|
|
|
|
/**
|
|
* Create and enter an isolate, and set it up for serialization.
|
|
* The isolate is either created from scratch or from an existing snapshot.
|
|
* The caller keeps ownership of the argument snapshot.
|
|
* \param existing_blob existing snapshot from which to create this one.
|
|
* \param external_references a null-terminated array of external references
|
|
* that must be equivalent to CreateParams::external_references.
|
|
*/
|
|
SnapshotCreator(intptr_t* external_references = nullptr,
|
|
StartupData* existing_blob = nullptr);
|
|
|
|
~SnapshotCreator();
|
|
|
|
/**
|
|
* \returns the isolate prepared by the snapshot creator.
|
|
*/
|
|
Isolate* GetIsolate();
|
|
|
|
/**
|
|
* Set the default context to be included in the snapshot blob.
|
|
* The snapshot will not contain the global proxy, and we expect one or a
|
|
* global object template to create one, to be provided upon deserialization.
|
|
*/
|
|
void SetDefaultContext(Local<Context> context);
|
|
|
|
/**
|
|
* Add additional context to be included in the snapshot blob.
|
|
* The snapshot will include the global proxy.
|
|
*
|
|
* \param callback optional callback to serialize internal fields.
|
|
*
|
|
* \returns the index of the context in the snapshot blob.
|
|
*/
|
|
size_t AddContext(Local<Context> context,
|
|
SerializeInternalFieldsCallback callback =
|
|
SerializeInternalFieldsCallback());
|
|
|
|
/**
|
|
* Add a template to be included in the snapshot blob.
|
|
* \returns the index of the template in the snapshot blob.
|
|
*/
|
|
size_t AddTemplate(Local<Template> template_obj);
|
|
|
|
/**
|
|
* Created a snapshot data blob.
|
|
* This must not be called from within a handle scope.
|
|
* \param function_code_handling whether to include compiled function code
|
|
* in the snapshot.
|
|
* \returns { nullptr, 0 } on failure, and a startup snapshot on success. The
|
|
* caller acquires ownership of the data array in the return value.
|
|
*/
|
|
StartupData CreateBlob(FunctionCodeHandling function_code_handling);
|
|
|
|
// Disallow copying and assigning.
|
|
SnapshotCreator(const SnapshotCreator&) = delete;
|
|
void operator=(const SnapshotCreator&) = delete;
|
|
|
|
private:
|
|
void* data_;
|
|
};
|
|
|
|
/**
|
|
* A simple Maybe type, representing an object which may or may not have a
|
|
* value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html.
|
|
*
|
|
* If an API method returns a Maybe<>, the API method can potentially fail
|
|
* either because an exception is thrown, or because an exception is pending,
|
|
* e.g. because a previous API call threw an exception that hasn't been caught
|
|
* yet, or because a TerminateExecution exception was thrown. In that case, a
|
|
* "Nothing" value is returned.
|
|
*/
|
|
template <class T>
|
|
class Maybe {
|
|
public:
|
|
V8_INLINE bool IsNothing() const { return !has_value_; }
|
|
V8_INLINE bool IsJust() const { return has_value_; }
|
|
|
|
/**
|
|
* An alias for |FromJust|. Will crash if the Maybe<> is nothing.
|
|
*/
|
|
V8_INLINE T ToChecked() const { return FromJust(); }
|
|
|
|
/**
|
|
* Converts this Maybe<> to a value of type T. If this Maybe<> is
|
|
* nothing (empty), |false| is returned and |out| is left untouched.
|
|
*/
|
|
V8_WARN_UNUSED_RESULT V8_INLINE bool To(T* out) const {
|
|
if (V8_LIKELY(IsJust())) *out = value_;
|
|
return IsJust();
|
|
}
|
|
|
|
/**
|
|
* Converts this Maybe<> to a value of type T. If this Maybe<> is
|
|
* nothing (empty), V8 will crash the process.
|
|
*/
|
|
V8_INLINE T FromJust() const {
|
|
if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing();
|
|
return value_;
|
|
}
|
|
|
|
/**
|
|
* Converts this Maybe<> to a value of type T, using a default value if this
|
|
* Maybe<> is nothing (empty).
|
|
*/
|
|
V8_INLINE T FromMaybe(const T& default_value) const {
|
|
return has_value_ ? value_ : default_value;
|
|
}
|
|
|
|
V8_INLINE bool operator==(const Maybe& other) const {
|
|
return (IsJust() == other.IsJust()) &&
|
|
(!IsJust() || FromJust() == other.FromJust());
|
|
}
|
|
|
|
V8_INLINE bool operator!=(const Maybe& other) const {
|
|
return !operator==(other);
|
|
}
|
|
|
|
private:
|
|
Maybe() : has_value_(false) {}
|
|
explicit Maybe(const T& t) : has_value_(true), value_(t) {}
|
|
|
|
bool has_value_;
|
|
T value_;
|
|
|
|
template <class U>
|
|
friend Maybe<U> Nothing();
|
|
template <class U>
|
|
friend Maybe<U> Just(const U& u);
|
|
};
|
|
|
|
|
|
template <class T>
|
|
inline Maybe<T> Nothing() {
|
|
return Maybe<T>();
|
|
}
|
|
|
|
|
|
template <class T>
|
|
inline Maybe<T> Just(const T& t) {
|
|
return Maybe<T>(t);
|
|
}
|
|
|
|
|
|
/**
|
|
* An external exception handler.
|
|
*/
|
|
class V8_EXPORT TryCatch {
|
|
public:
|
|
/**
|
|
* Creates a new try/catch block and registers it with v8. Note that
|
|
* all TryCatch blocks should be stack allocated because the memory
|
|
* location itself is compared against JavaScript try/catch blocks.
|
|
*/
|
|
V8_DEPRECATED("Use isolate version", TryCatch());
|
|
|
|
/**
|
|
* Creates a new try/catch block and registers it with v8. Note that
|
|
* all TryCatch blocks should be stack allocated because the memory
|
|
* location itself is compared against JavaScript try/catch blocks.
|
|
*/
|
|
TryCatch(Isolate* isolate);
|
|
|
|
/**
|
|
* Unregisters and deletes this try/catch block.
|
|
*/
|
|
~TryCatch();
|
|
|
|
/**
|
|
* Returns true if an exception has been caught by this try/catch block.
|
|
*/
|
|
bool HasCaught() const;
|
|
|
|
/**
|
|
* For certain types of exceptions, it makes no sense to continue execution.
|
|
*
|
|
* If CanContinue returns false, the correct action is to perform any C++
|
|
* cleanup needed and then return. If CanContinue returns false and
|
|
* HasTerminated returns true, it is possible to call
|
|
* CancelTerminateExecution in order to continue calling into the engine.
|
|
*/
|
|
bool CanContinue() const;
|
|
|
|
/**
|
|
* Returns true if an exception has been caught due to script execution
|
|
* being terminated.
|
|
*
|
|
* There is no JavaScript representation of an execution termination
|
|
* exception. Such exceptions are thrown when the TerminateExecution
|
|
* methods are called to terminate a long-running script.
|
|
*
|
|
* If such an exception has been thrown, HasTerminated will return true,
|
|
* indicating that it is possible to call CancelTerminateExecution in order
|
|
* to continue calling into the engine.
|
|
*/
|
|
bool HasTerminated() const;
|
|
|
|
/**
|
|
* Throws the exception caught by this TryCatch in a way that avoids
|
|
* it being caught again by this same TryCatch. As with ThrowException
|
|
* it is illegal to execute any JavaScript operations after calling
|
|
* ReThrow; the caller must return immediately to where the exception
|
|
* is caught.
|
|
*/
|
|
Local<Value> ReThrow();
|
|
|
|
/**
|
|
* Returns the exception caught by this try/catch block. If no exception has
|
|
* been caught an empty handle is returned.
|
|
*
|
|
* The returned handle is valid until this TryCatch block has been destroyed.
|
|
*/
|
|
Local<Value> Exception() const;
|
|
|
|
/**
|
|
* Returns the .stack property of the thrown object. If no .stack
|
|
* property is present an empty handle is returned.
|
|
*/
|
|
V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace() const);
|
|
V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace(
|
|
Local<Context> context) const;
|
|
|
|
/**
|
|
* Returns the message associated with this exception. If there is
|
|
* no message associated an empty handle is returned.
|
|
*
|
|
* The returned handle is valid until this TryCatch block has been
|
|
* destroyed.
|
|
*/
|
|
Local<v8::Message> Message() const;
|
|
|
|
/**
|
|
* Clears any exceptions that may have been caught by this try/catch block.
|
|
* After this method has been called, HasCaught() will return false. Cancels
|
|
* the scheduled exception if it is caught and ReThrow() is not called before.
|
|
*
|
|
* It is not necessary to clear a try/catch block before using it again; if
|
|
* another exception is thrown the previously caught exception will just be
|
|
* overwritten. However, it is often a good idea since it makes it easier
|
|
* to determine which operation threw a given exception.
|
|
*/
|
|
void Reset();
|
|
|
|
/**
|
|
* Set verbosity of the external exception handler.
|
|
*
|
|
* By default, exceptions that are caught by an external exception
|
|
* handler are not reported. Call SetVerbose with true on an
|
|
* external exception handler to have exceptions caught by the
|
|
* handler reported as if they were not caught.
|
|
*/
|
|
void SetVerbose(bool value);
|
|
|
|
/**
|
|
* Returns true if verbosity is enabled.
|
|
*/
|
|
bool IsVerbose() const;
|
|
|
|
/**
|
|
* Set whether or not this TryCatch should capture a Message object
|
|
* which holds source information about where the exception
|
|
* occurred. True by default.
|
|
*/
|
|
void SetCaptureMessage(bool value);
|
|
|
|
/**
|
|
* There are cases when the raw address of C++ TryCatch object cannot be
|
|
* used for comparisons with addresses into the JS stack. The cases are:
|
|
* 1) ARM, ARM64 and MIPS simulators which have separate JS stack.
|
|
* 2) Address sanitizer allocates local C++ object in the heap when
|
|
* UseAfterReturn mode is enabled.
|
|
* This method returns address that can be used for comparisons with
|
|
* addresses into the JS stack. When neither simulator nor ASAN's
|
|
* UseAfterReturn is enabled, then the address returned will be the address
|
|
* of the C++ try catch handler itself.
|
|
*/
|
|
static void* JSStackComparableAddress(TryCatch* handler) {
|
|
if (handler == NULL) return NULL;
|
|
return handler->js_stack_comparable_address_;
|
|
}
|
|
|
|
TryCatch(const TryCatch&) = delete;
|
|
void operator=(const TryCatch&) = delete;
|
|
void* operator new(size_t size);
|
|
void operator delete(void*, size_t);
|
|
|
|
private:
|
|
void ResetInternal();
|
|
|
|
internal::Isolate* isolate_;
|
|
TryCatch* next_;
|
|
void* exception_;
|
|
void* message_obj_;
|
|
void* js_stack_comparable_address_;
|
|
bool is_verbose_ : 1;
|
|
bool can_continue_ : 1;
|
|
bool capture_message_ : 1;
|
|
bool rethrow_ : 1;
|
|
bool has_terminated_ : 1;
|
|
|
|
friend class internal::Isolate;
|
|
};
|
|
|
|
|
|
// --- Context ---
|
|
|
|
|
|
/**
|
|
* A container for extension names.
|
|
*/
|
|
class V8_EXPORT ExtensionConfiguration {
|
|
public:
|
|
ExtensionConfiguration() : name_count_(0), names_(NULL) { }
|
|
ExtensionConfiguration(int name_count, const char* names[])
|
|
: name_count_(name_count), names_(names) { }
|
|
|
|
const char** begin() const { return &names_[0]; }
|
|
const char** end() const { return &names_[name_count_]; }
|
|
|
|
private:
|
|
const int name_count_;
|
|
const char** names_;
|
|
};
|
|
|
|
/**
|
|
* A sandboxed execution context with its own set of built-in objects
|
|
* and functions.
|
|
*/
|
|
class V8_EXPORT Context {
|
|
public:
|
|
/**
|
|
* Returns the global proxy object.
|
|
*
|
|
* Global proxy object is a thin wrapper whose prototype points to actual
|
|
* context's global object with the properties like Object, etc. This is done
|
|
* that way for security reasons (for more details see
|
|
* https://wiki.mozilla.org/Gecko:SplitWindow).
|
|
*
|
|
* Please note that changes to global proxy object prototype most probably
|
|
* would break VM---v8 expects only global object as a prototype of global
|
|
* proxy object.
|
|
*/
|
|
Local<Object> Global();
|
|
|
|
/**
|
|
* Detaches the global object from its context before
|
|
* the global object can be reused to create a new context.
|
|
*/
|
|
void DetachGlobal();
|
|
|
|
/**
|
|
* Creates a new context and returns a handle to the newly allocated
|
|
* context.
|
|
*
|
|
* \param isolate The isolate in which to create the context.
|
|
*
|
|
* \param extensions An optional extension configuration containing
|
|
* the extensions to be installed in the newly created context.
|
|
*
|
|
* \param global_template An optional object template from which the
|
|
* global object for the newly created context will be created.
|
|
*
|
|
* \param global_object An optional global object to be reused for
|
|
* the newly created context. This global object must have been
|
|
* created by a previous call to Context::New with the same global
|
|
* template. The state of the global object will be completely reset
|
|
* and only object identify will remain.
|
|
*/
|
|
static Local<Context> New(
|
|
Isolate* isolate, ExtensionConfiguration* extensions = NULL,
|
|
MaybeLocal<ObjectTemplate> global_template = MaybeLocal<ObjectTemplate>(),
|
|
MaybeLocal<Value> global_object = MaybeLocal<Value>());
|
|
|
|
/**
|
|
* Create a new context from a (non-default) context snapshot. There
|
|
* is no way to provide a global object template since we do not create
|
|
* a new global object from template, but we can reuse a global object.
|
|
*
|
|
* \param isolate See v8::Context::New.
|
|
*
|
|
* \param context_snapshot_index The index of the context snapshot to
|
|
* deserialize from. Use v8::Context::New for the default snapshot.
|
|
*
|
|
* \param embedder_fields_deserializer Optional callback to deserialize
|
|
* internal fields. It should match the SerializeInternalFieldCallback used
|
|
* to serialize.
|
|
*
|
|
* \param extensions See v8::Context::New.
|
|
*
|
|
* \param global_object See v8::Context::New.
|
|
*/
|
|
|
|
static MaybeLocal<Context> FromSnapshot(
|
|
Isolate* isolate, size_t context_snapshot_index,
|
|
DeserializeInternalFieldsCallback embedder_fields_deserializer =
|
|
DeserializeInternalFieldsCallback(),
|
|
ExtensionConfiguration* extensions = nullptr,
|
|
MaybeLocal<Value> global_object = MaybeLocal<Value>());
|
|
|
|
/**
|
|
* Returns an global object that isn't backed by an actual context.
|
|
*
|
|
* The global template needs to have access checks with handlers installed.
|
|
* If an existing global object is passed in, the global object is detached
|
|
* from its context.
|
|
*
|
|
* Note that this is different from a detached context where all accesses to
|
|
* the global proxy will fail. Instead, the access check handlers are invoked.
|
|
*
|
|
* It is also not possible to detach an object returned by this method.
|
|
* Instead, the access check handlers need to return nothing to achieve the
|
|
* same effect.
|
|
*
|
|
* It is possible, however, to create a new context from the global object
|
|
* returned by this method.
|
|
*/
|
|
static MaybeLocal<Object> NewRemoteContext(
|
|
Isolate* isolate, Local<ObjectTemplate> global_template,
|
|
MaybeLocal<Value> global_object = MaybeLocal<Value>());
|
|
|
|
/**
|
|
* Sets the security token for the context. To access an object in
|
|
* another context, the security tokens must match.
|
|
*/
|
|
void SetSecurityToken(Local<Value> token);
|
|
|
|
/** Restores the security token to the default value. */
|
|
void UseDefaultSecurityToken();
|
|
|
|
/** Returns the security token of this context.*/
|
|
Local<Value> GetSecurityToken();
|
|
|
|
/**
|
|
* Enter this context. After entering a context, all code compiled
|
|
* and run is compiled and run in this context. If another context
|
|
* is already entered, this old context is saved so it can be
|
|
* restored when the new context is exited.
|
|
*/
|
|
void Enter();
|
|
|
|
/**
|
|
* Exit this context. Exiting the current context restores the
|
|
* context that was in place when entering the current context.
|
|
*/
|
|
void Exit();
|
|
|
|
/** Returns an isolate associated with a current context. */
|
|
Isolate* GetIsolate();
|
|
|
|
/**
|
|
* The field at kDebugIdIndex used to be reserved for the inspector.
|
|
* It now serves no purpose.
|
|
*/
|
|
enum EmbedderDataFields { kDebugIdIndex = 0 };
|
|
|
|
/**
|
|
* Gets the embedder data with the given index, which must have been set by a
|
|
* previous call to SetEmbedderData with the same index.
|
|
*/
|
|
V8_INLINE Local<Value> GetEmbedderData(int index);
|
|
|
|
/**
|
|
* Gets the binding object used by V8 extras. Extra natives get a reference
|
|
* to this object and can use it to "export" functionality by adding
|
|
* properties. Extra natives can also "import" functionality by accessing
|
|
* properties added by the embedder using the V8 API.
|
|
*/
|
|
Local<Object> GetExtrasBindingObject();
|
|
|
|
/**
|
|
* Sets the embedder data with the given index, growing the data as
|
|
* needed. Note that index 0 currently has a special meaning for Chrome's
|
|
* debugger.
|
|
*/
|
|
void SetEmbedderData(int index, Local<Value> value);
|
|
|
|
/**
|
|
* Gets a 2-byte-aligned native pointer from the embedder data with the given
|
|
* index, which must have been set by a previous call to
|
|
* SetAlignedPointerInEmbedderData with the same index. Note that index 0
|
|
* currently has a special meaning for Chrome's debugger.
|
|
*/
|
|
V8_INLINE void* GetAlignedPointerFromEmbedderData(int index);
|
|
|
|
/**
|
|
* Sets a 2-byte-aligned native pointer in the embedder data with the given
|
|
* index, growing the data as needed. Note that index 0 currently has a
|
|
* special meaning for Chrome's debugger.
|
|
*/
|
|
void SetAlignedPointerInEmbedderData(int index, void* value);
|
|
|
|
/**
|
|
* Control whether code generation from strings is allowed. Calling
|
|
* this method with false will disable 'eval' and the 'Function'
|
|
* constructor for code running in this context. If 'eval' or the
|
|
* 'Function' constructor are used an exception will be thrown.
|
|
*
|
|
* If code generation from strings is not allowed the
|
|
* V8::AllowCodeGenerationFromStrings callback will be invoked if
|
|
* set before blocking the call to 'eval' or the 'Function'
|
|
* constructor. If that callback returns true, the call will be
|
|
* allowed, otherwise an exception will be thrown. If no callback is
|
|
* set an exception will be thrown.
|
|
*/
|
|
void AllowCodeGenerationFromStrings(bool allow);
|
|
|
|
/**
|
|
* Returns true if code generation from strings is allowed for the context.
|
|
* For more details see AllowCodeGenerationFromStrings(bool) documentation.
|
|
*/
|
|
bool IsCodeGenerationFromStringsAllowed();
|
|
|
|
/**
|
|
* Sets the error description for the exception that is thrown when
|
|
* code generation from strings is not allowed and 'eval' or the 'Function'
|
|
* constructor are called.
|
|
*/
|
|
void SetErrorMessageForCodeGenerationFromStrings(Local<String> message);
|
|
|
|
/**
|
|
* Estimate the memory in bytes retained by this context.
|
|
*/
|
|
V8_DEPRECATED("no longer supported", size_t EstimatedSize());
|
|
|
|
/**
|
|
* Stack-allocated class which sets the execution context for all
|
|
* operations executed within a local scope.
|
|
*/
|
|
class Scope {
|
|
public:
|
|
explicit V8_INLINE Scope(Local<Context> context) : context_(context) {
|
|
context_->Enter();
|
|
}
|
|
V8_INLINE ~Scope() { context_->Exit(); }
|
|
|
|
private:
|
|
Local<Context> context_;
|
|
};
|
|
|
|
private:
|
|
friend class Value;
|
|
friend class Script;
|
|
friend class Object;
|
|
friend class Function;
|
|
|
|
Local<Value> SlowGetEmbedderData(int index);
|
|
void* SlowGetAlignedPointerFromEmbedderData(int index);
|
|
};
|
|
|
|
|
|
/**
|
|
* Multiple threads in V8 are allowed, but only one thread at a time is allowed
|
|
* to use any given V8 isolate, see the comments in the Isolate class. The
|
|
* definition of 'using a V8 isolate' includes accessing handles or holding onto
|
|
* object pointers obtained from V8 handles while in the particular V8 isolate.
|
|
* It is up to the user of V8 to ensure, perhaps with locking, that this
|
|
* constraint is not violated. In addition to any other synchronization
|
|
* mechanism that may be used, the v8::Locker and v8::Unlocker classes must be
|
|
* used to signal thread switches to V8.
|
|
*
|
|
* v8::Locker is a scoped lock object. While it's active, i.e. between its
|
|
* construction and destruction, the current thread is allowed to use the locked
|
|
* isolate. V8 guarantees that an isolate can be locked by at most one thread at
|
|
* any time. In other words, the scope of a v8::Locker is a critical section.
|
|
*
|
|
* Sample usage:
|
|
* \code
|
|
* ...
|
|
* {
|
|
* v8::Locker locker(isolate);
|
|
* v8::Isolate::Scope isolate_scope(isolate);
|
|
* ...
|
|
* // Code using V8 and isolate goes here.
|
|
* ...
|
|
* } // Destructor called here
|
|
* \endcode
|
|
*
|
|
* If you wish to stop using V8 in a thread A you can do this either by
|
|
* destroying the v8::Locker object as above or by constructing a v8::Unlocker
|
|
* object:
|
|
*
|
|
* \code
|
|
* {
|
|
* isolate->Exit();
|
|
* v8::Unlocker unlocker(isolate);
|
|
* ...
|
|
* // Code not using V8 goes here while V8 can run in another thread.
|
|
* ...
|
|
* } // Destructor called here.
|
|
* isolate->Enter();
|
|
* \endcode
|
|
*
|
|
* The Unlocker object is intended for use in a long-running callback from V8,
|
|
* where you want to release the V8 lock for other threads to use.
|
|
*
|
|
* The v8::Locker is a recursive lock, i.e. you can lock more than once in a
|
|
* given thread. This can be useful if you have code that can be called either
|
|
* from code that holds the lock or from code that does not. The Unlocker is
|
|
* not recursive so you can not have several Unlockers on the stack at once, and
|
|
* you can not use an Unlocker in a thread that is not inside a Locker's scope.
|
|
*
|
|
* An unlocker will unlock several lockers if it has to and reinstate the
|
|
* correct depth of locking on its destruction, e.g.:
|
|
*
|
|
* \code
|
|
* // V8 not locked.
|
|
* {
|
|
* v8::Locker locker(isolate);
|
|
* Isolate::Scope isolate_scope(isolate);
|
|
* // V8 locked.
|
|
* {
|
|
* v8::Locker another_locker(isolate);
|
|
* // V8 still locked (2 levels).
|
|
* {
|
|
* isolate->Exit();
|
|
* v8::Unlocker unlocker(isolate);
|
|
* // V8 not locked.
|
|
* }
|
|
* isolate->Enter();
|
|
* // V8 locked again (2 levels).
|
|
* }
|
|
* // V8 still locked (1 level).
|
|
* }
|
|
* // V8 Now no longer locked.
|
|
* \endcode
|
|
*/
|
|
class V8_EXPORT Unlocker {
|
|
public:
|
|
/**
|
|
* Initialize Unlocker for a given Isolate.
|
|
*/
|
|
V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); }
|
|
|
|
~Unlocker();
|
|
private:
|
|
void Initialize(Isolate* isolate);
|
|
|
|
internal::Isolate* isolate_;
|
|
};
|
|
|
|
|
|
class V8_EXPORT Locker {
|
|
public:
|
|
/**
|
|
* Initialize Locker for a given Isolate.
|
|
*/
|
|
V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); }
|
|
|
|
~Locker();
|
|
|
|
/**
|
|
* Returns whether or not the locker for a given isolate, is locked by the
|
|
* current thread.
|
|
*/
|
|
static bool IsLocked(Isolate* isolate);
|
|
|
|
/**
|
|
* Returns whether v8::Locker is being used by this V8 instance.
|
|
*/
|
|
static bool IsActive();
|
|
|
|
// Disallow copying and assigning.
|
|
Locker(const Locker&) = delete;
|
|
void operator=(const Locker&) = delete;
|
|
|
|
private:
|
|
void Initialize(Isolate* isolate);
|
|
|
|
bool has_lock_;
|
|
bool top_level_;
|
|
internal::Isolate* isolate_;
|
|
};
|
|
|
|
|
|
// --- Implementation ---
|
|
|
|
|
|
namespace internal {
|
|
|
|
const int kApiPointerSize = sizeof(void*); // NOLINT
|
|
const int kApiIntSize = sizeof(int); // NOLINT
|
|
const int kApiInt64Size = sizeof(int64_t); // NOLINT
|
|
|
|
// Tag information for HeapObject.
|
|
const int kHeapObjectTag = 1;
|
|
const int kHeapObjectTagSize = 2;
|
|
const intptr_t kHeapObjectTagMask = (1 << kHeapObjectTagSize) - 1;
|
|
|
|
// Tag information for Smi.
|
|
const int kSmiTag = 0;
|
|
const int kSmiTagSize = 1;
|
|
const intptr_t kSmiTagMask = (1 << kSmiTagSize) - 1;
|
|
|
|
template <size_t ptr_size> struct SmiTagging;
|
|
|
|
template<int kSmiShiftSize>
|
|
V8_INLINE internal::Object* IntToSmi(int value) {
|
|
int smi_shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
uintptr_t tagged_value =
|
|
(static_cast<uintptr_t>(value) << smi_shift_bits) | kSmiTag;
|
|
return reinterpret_cast<internal::Object*>(tagged_value);
|
|
}
|
|
|
|
// Smi constants for 32-bit systems.
|
|
template <> struct SmiTagging<4> {
|
|
enum { kSmiShiftSize = 0, kSmiValueSize = 31 };
|
|
static int SmiShiftSize() { return kSmiShiftSize; }
|
|
static int SmiValueSize() { return kSmiValueSize; }
|
|
V8_INLINE static int SmiToInt(const internal::Object* value) {
|
|
int shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
// Throw away top 32 bits and shift down (requires >> to be sign extending).
|
|
return static_cast<int>(reinterpret_cast<intptr_t>(value)) >> shift_bits;
|
|
}
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return internal::IntToSmi<kSmiShiftSize>(value);
|
|
}
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
// To be representable as an tagged small integer, the two
|
|
// most-significant bits of 'value' must be either 00 or 11 due to
|
|
// sign-extension. To check this we add 01 to the two
|
|
// most-significant bits, and check if the most-significant bit is 0
|
|
//
|
|
// CAUTION: The original code below:
|
|
// bool result = ((value + 0x40000000) & 0x80000000) == 0;
|
|
// may lead to incorrect results according to the C language spec, and
|
|
// in fact doesn't work correctly with gcc4.1.1 in some cases: The
|
|
// compiler may produce undefined results in case of signed integer
|
|
// overflow. The computation must be done w/ unsigned ints.
|
|
return static_cast<uintptr_t>(value + 0x40000000U) < 0x80000000U;
|
|
}
|
|
};
|
|
|
|
// Smi constants for 64-bit systems.
|
|
template <> struct SmiTagging<8> {
|
|
enum { kSmiShiftSize = 31, kSmiValueSize = 32 };
|
|
static int SmiShiftSize() { return kSmiShiftSize; }
|
|
static int SmiValueSize() { return kSmiValueSize; }
|
|
V8_INLINE static int SmiToInt(const internal::Object* value) {
|
|
int shift_bits = kSmiTagSize + kSmiShiftSize;
|
|
// Shift down and throw away top 32 bits.
|
|
return static_cast<int>(reinterpret_cast<intptr_t>(value) >> shift_bits);
|
|
}
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return internal::IntToSmi<kSmiShiftSize>(value);
|
|
}
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
// To be representable as a long smi, the value must be a 32-bit integer.
|
|
return (value == static_cast<int32_t>(value));
|
|
}
|
|
};
|
|
|
|
typedef SmiTagging<kApiPointerSize> PlatformSmiTagging;
|
|
const int kSmiShiftSize = PlatformSmiTagging::kSmiShiftSize;
|
|
const int kSmiValueSize = PlatformSmiTagging::kSmiValueSize;
|
|
V8_INLINE static bool SmiValuesAre31Bits() { return kSmiValueSize == 31; }
|
|
V8_INLINE static bool SmiValuesAre32Bits() { return kSmiValueSize == 32; }
|
|
|
|
/**
|
|
* This class exports constants and functionality from within v8 that
|
|
* is necessary to implement inline functions in the v8 api. Don't
|
|
* depend on functions and constants defined here.
|
|
*/
|
|
class Internals {
|
|
public:
|
|
// These values match non-compiler-dependent values defined within
|
|
// the implementation of v8.
|
|
static const int kHeapObjectMapOffset = 0;
|
|
static const int kMapInstanceTypeAndBitFieldOffset =
|
|
1 * kApiPointerSize + kApiIntSize;
|
|
static const int kStringResourceOffset = 3 * kApiPointerSize;
|
|
|
|
static const int kOddballKindOffset = 4 * kApiPointerSize + sizeof(double);
|
|
static const int kForeignAddressOffset = kApiPointerSize;
|
|
static const int kJSObjectHeaderSize = 3 * kApiPointerSize;
|
|
static const int kFixedArrayHeaderSize = 2 * kApiPointerSize;
|
|
static const int kContextHeaderSize = 2 * kApiPointerSize;
|
|
static const int kContextEmbedderDataIndex = 5;
|
|
static const int kFullStringRepresentationMask = 0x0f;
|
|
static const int kStringEncodingMask = 0x8;
|
|
static const int kExternalTwoByteRepresentationTag = 0x02;
|
|
static const int kExternalOneByteRepresentationTag = 0x0a;
|
|
|
|
static const int kIsolateEmbedderDataOffset = 0 * kApiPointerSize;
|
|
static const int kExternalMemoryOffset = 4 * kApiPointerSize;
|
|
static const int kExternalMemoryLimitOffset =
|
|
kExternalMemoryOffset + kApiInt64Size;
|
|
static const int kIsolateRootsOffset = kExternalMemoryLimitOffset +
|
|
kApiInt64Size + kApiInt64Size +
|
|
kApiPointerSize + kApiPointerSize;
|
|
static const int kUndefinedValueRootIndex = 4;
|
|
static const int kTheHoleValueRootIndex = 5;
|
|
static const int kNullValueRootIndex = 6;
|
|
static const int kTrueValueRootIndex = 7;
|
|
static const int kFalseValueRootIndex = 8;
|
|
static const int kEmptyStringRootIndex = 9;
|
|
|
|
static const int kNodeClassIdOffset = 1 * kApiPointerSize;
|
|
static const int kNodeFlagsOffset = 1 * kApiPointerSize + 3;
|
|
static const int kNodeStateMask = 0x7;
|
|
static const int kNodeStateIsWeakValue = 2;
|
|
static const int kNodeStateIsPendingValue = 3;
|
|
static const int kNodeStateIsNearDeathValue = 4;
|
|
static const int kNodeIsIndependentShift = 3;
|
|
static const int kNodeIsActiveShift = 4;
|
|
|
|
static const int kJSApiObjectType = 0xbb;
|
|
static const int kJSObjectType = 0xbc;
|
|
static const int kFirstNonstringType = 0x80;
|
|
static const int kOddballType = 0x82;
|
|
static const int kForeignType = 0x86;
|
|
|
|
static const int kUndefinedOddballKind = 5;
|
|
static const int kNullOddballKind = 3;
|
|
|
|
static const uint32_t kNumIsolateDataSlots = 4;
|
|
|
|
V8_EXPORT static void CheckInitializedImpl(v8::Isolate* isolate);
|
|
V8_INLINE static void CheckInitialized(v8::Isolate* isolate) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckInitializedImpl(isolate);
|
|
#endif
|
|
}
|
|
|
|
V8_INLINE static bool HasHeapObjectTag(const internal::Object* value) {
|
|
return ((reinterpret_cast<intptr_t>(value) & kHeapObjectTagMask) ==
|
|
kHeapObjectTag);
|
|
}
|
|
|
|
V8_INLINE static int SmiValue(const internal::Object* value) {
|
|
return PlatformSmiTagging::SmiToInt(value);
|
|
}
|
|
|
|
V8_INLINE static internal::Object* IntToSmi(int value) {
|
|
return PlatformSmiTagging::IntToSmi(value);
|
|
}
|
|
|
|
V8_INLINE static bool IsValidSmi(intptr_t value) {
|
|
return PlatformSmiTagging::IsValidSmi(value);
|
|
}
|
|
|
|
V8_INLINE static int GetInstanceType(const internal::Object* obj) {
|
|
typedef internal::Object O;
|
|
O* map = ReadField<O*>(obj, kHeapObjectMapOffset);
|
|
// Map::InstanceType is defined so that it will always be loaded into
|
|
// the LS 8 bits of one 16-bit word, regardless of endianess.
|
|
return ReadField<uint16_t>(map, kMapInstanceTypeAndBitFieldOffset) & 0xff;
|
|
}
|
|
|
|
V8_INLINE static int GetOddballKind(const internal::Object* obj) {
|
|
typedef internal::Object O;
|
|
return SmiValue(ReadField<O*>(obj, kOddballKindOffset));
|
|
}
|
|
|
|
V8_INLINE static bool IsExternalTwoByteString(int instance_type) {
|
|
int representation = (instance_type & kFullStringRepresentationMask);
|
|
return representation == kExternalTwoByteRepresentationTag;
|
|
}
|
|
|
|
V8_INLINE static uint8_t GetNodeFlag(internal::Object** obj, int shift) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
return *addr & static_cast<uint8_t>(1U << shift);
|
|
}
|
|
|
|
V8_INLINE static void UpdateNodeFlag(internal::Object** obj,
|
|
bool value, int shift) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
uint8_t mask = static_cast<uint8_t>(1U << shift);
|
|
*addr = static_cast<uint8_t>((*addr & ~mask) | (value << shift));
|
|
}
|
|
|
|
V8_INLINE static uint8_t GetNodeState(internal::Object** obj) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
return *addr & kNodeStateMask;
|
|
}
|
|
|
|
V8_INLINE static void UpdateNodeState(internal::Object** obj,
|
|
uint8_t value) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset;
|
|
*addr = static_cast<uint8_t>((*addr & ~kNodeStateMask) | value);
|
|
}
|
|
|
|
V8_INLINE static void SetEmbedderData(v8::Isolate* isolate,
|
|
uint32_t slot,
|
|
void* data) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) +
|
|
kIsolateEmbedderDataOffset + slot * kApiPointerSize;
|
|
*reinterpret_cast<void**>(addr) = data;
|
|
}
|
|
|
|
V8_INLINE static void* GetEmbedderData(const v8::Isolate* isolate,
|
|
uint32_t slot) {
|
|
const uint8_t* addr = reinterpret_cast<const uint8_t*>(isolate) +
|
|
kIsolateEmbedderDataOffset + slot * kApiPointerSize;
|
|
return *reinterpret_cast<void* const*>(addr);
|
|
}
|
|
|
|
V8_INLINE static internal::Object** GetRoot(v8::Isolate* isolate,
|
|
int index) {
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + kIsolateRootsOffset;
|
|
return reinterpret_cast<internal::Object**>(addr + index * kApiPointerSize);
|
|
}
|
|
|
|
template <typename T>
|
|
V8_INLINE static T ReadField(const internal::Object* ptr, int offset) {
|
|
const uint8_t* addr =
|
|
reinterpret_cast<const uint8_t*>(ptr) + offset - kHeapObjectTag;
|
|
return *reinterpret_cast<const T*>(addr);
|
|
}
|
|
|
|
template <typename T>
|
|
V8_INLINE static T ReadEmbedderData(const v8::Context* context, int index) {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* ctx = *reinterpret_cast<O* const*>(context);
|
|
int embedder_data_offset = I::kContextHeaderSize +
|
|
(internal::kApiPointerSize * I::kContextEmbedderDataIndex);
|
|
O* embedder_data = I::ReadField<O*>(ctx, embedder_data_offset);
|
|
int value_offset =
|
|
I::kFixedArrayHeaderSize + (internal::kApiPointerSize * index);
|
|
return I::ReadField<T>(embedder_data, value_offset);
|
|
}
|
|
};
|
|
|
|
} // namespace internal
|
|
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, Local<T> that) {
|
|
return New(isolate, that.val_);
|
|
}
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) {
|
|
return New(isolate, that.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
Local<T> Local<T>::New(Isolate* isolate, T* that) {
|
|
if (that == NULL) return Local<T>();
|
|
T* that_ptr = that;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that_ptr);
|
|
return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle(
|
|
reinterpret_cast<internal::Isolate*>(isolate), *p)));
|
|
}
|
|
|
|
|
|
template<class T>
|
|
template<class S>
|
|
void Eternal<T>::Set(Isolate* isolate, Local<S> handle) {
|
|
TYPE_CHECK(T, S);
|
|
val_ = reinterpret_cast<T*>(
|
|
V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle)));
|
|
}
|
|
|
|
template <class T>
|
|
Local<T> Eternal<T>::Get(Isolate* isolate) const {
|
|
// The eternal handle will never go away, so as with the roots, we don't even
|
|
// need to open a handle.
|
|
return Local<T>(val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
Local<T> MaybeLocal<T>::ToLocalChecked() {
|
|
if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty();
|
|
return Local<T>(val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void* WeakCallbackInfo<T>::GetInternalField(int index) const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
if (index < 0 || index >= kEmbedderFieldsInWeakCallback) {
|
|
V8::InternalFieldOutOfBounds(index);
|
|
}
|
|
#endif
|
|
return embedder_fields_[index];
|
|
}
|
|
|
|
|
|
template <class T>
|
|
T* PersistentBase<T>::New(Isolate* isolate, T* that) {
|
|
if (that == NULL) return NULL;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that);
|
|
return reinterpret_cast<T*>(
|
|
V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate),
|
|
p));
|
|
}
|
|
|
|
|
|
template <class T, class M>
|
|
template <class S, class M2>
|
|
void Persistent<T, M>::Copy(const Persistent<S, M2>& that) {
|
|
TYPE_CHECK(T, S);
|
|
this->Reset();
|
|
if (that.IsEmpty()) return;
|
|
internal::Object** p = reinterpret_cast<internal::Object**>(that.val_);
|
|
this->val_ = reinterpret_cast<T*>(V8::CopyPersistent(p));
|
|
M::Copy(that, this);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsIndependent() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
return I::GetNodeFlag(reinterpret_cast<internal::Object**>(this->val_),
|
|
I::kNodeIsIndependentShift);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsNearDeath() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
uint8_t node_state =
|
|
I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_));
|
|
return node_state == I::kNodeStateIsNearDeathValue ||
|
|
node_state == I::kNodeStateIsPendingValue;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
bool PersistentBase<T>::IsWeak() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return false;
|
|
return I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)) ==
|
|
I::kNodeStateIsWeakValue;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::Reset() {
|
|
if (this->IsEmpty()) return;
|
|
V8::DisposeGlobal(reinterpret_cast<internal::Object**>(this->val_));
|
|
val_ = 0;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <class S>
|
|
void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) {
|
|
TYPE_CHECK(T, S);
|
|
Reset();
|
|
if (other.IsEmpty()) return;
|
|
this->val_ = New(isolate, other.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <class S>
|
|
void PersistentBase<T>::Reset(Isolate* isolate,
|
|
const PersistentBase<S>& other) {
|
|
TYPE_CHECK(T, S);
|
|
Reset();
|
|
if (other.IsEmpty()) return;
|
|
this->val_ = New(isolate, other.val_);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
V8_INLINE void PersistentBase<T>::SetWeak(
|
|
P* parameter, typename WeakCallbackInfo<P>::Callback callback,
|
|
WeakCallbackType type) {
|
|
typedef typename WeakCallbackInfo<void>::Callback Callback;
|
|
V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter,
|
|
reinterpret_cast<Callback>(callback), type);
|
|
}
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::SetWeak() {
|
|
V8::MakeWeak(reinterpret_cast<internal::Object***>(&this->val_));
|
|
}
|
|
|
|
template <class T>
|
|
template <typename P>
|
|
P* PersistentBase<T>::ClearWeak() {
|
|
return reinterpret_cast<P*>(
|
|
V8::ClearWeak(reinterpret_cast<internal::Object**>(this->val_)));
|
|
}
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::RegisterExternalReference(Isolate* isolate) const {
|
|
if (IsEmpty()) return;
|
|
V8::RegisterExternallyReferencedObject(
|
|
reinterpret_cast<internal::Object**>(this->val_),
|
|
reinterpret_cast<internal::Isolate*>(isolate));
|
|
}
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::MarkIndependent() {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_),
|
|
true,
|
|
I::kNodeIsIndependentShift);
|
|
}
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::MarkActive() {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), true,
|
|
I::kNodeIsActiveShift);
|
|
}
|
|
|
|
|
|
template <class T>
|
|
void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return;
|
|
internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_);
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
|
|
*reinterpret_cast<uint16_t*>(addr) = class_id;
|
|
}
|
|
|
|
|
|
template <class T>
|
|
uint16_t PersistentBase<T>::WrapperClassId() const {
|
|
typedef internal::Internals I;
|
|
if (this->IsEmpty()) return 0;
|
|
internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_);
|
|
uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
|
|
return *reinterpret_cast<uint16_t*>(addr);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T>::ReturnValue(internal::Object** slot) : value_(slot) {}
|
|
|
|
template<typename T>
|
|
template<typename S>
|
|
void ReturnValue<T>::Set(const Persistent<S>& handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template <typename T>
|
|
template <typename S>
|
|
void ReturnValue<T>::Set(const Global<S>& handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template <typename T>
|
|
template <typename S>
|
|
void ReturnValue<T>::Set(const Local<S> handle) {
|
|
TYPE_CHECK(T, S);
|
|
if (V8_UNLIKELY(handle.IsEmpty())) {
|
|
*value_ = GetDefaultValue();
|
|
} else {
|
|
*value_ = *reinterpret_cast<internal::Object**>(*handle);
|
|
}
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(double i) {
|
|
TYPE_CHECK(T, Number);
|
|
Set(Number::New(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(int32_t i) {
|
|
TYPE_CHECK(T, Integer);
|
|
typedef internal::Internals I;
|
|
if (V8_LIKELY(I::IsValidSmi(i))) {
|
|
*value_ = I::IntToSmi(i);
|
|
return;
|
|
}
|
|
Set(Integer::New(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(uint32_t i) {
|
|
TYPE_CHECK(T, Integer);
|
|
// Can't simply use INT32_MAX here for whatever reason.
|
|
bool fits_into_int32_t = (i & (1U << 31)) == 0;
|
|
if (V8_LIKELY(fits_into_int32_t)) {
|
|
Set(static_cast<int32_t>(i));
|
|
return;
|
|
}
|
|
Set(Integer::NewFromUnsigned(GetIsolate(), i));
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::Set(bool value) {
|
|
TYPE_CHECK(T, Boolean);
|
|
typedef internal::Internals I;
|
|
int root_index;
|
|
if (value) {
|
|
root_index = I::kTrueValueRootIndex;
|
|
} else {
|
|
root_index = I::kFalseValueRootIndex;
|
|
}
|
|
*value_ = *I::GetRoot(GetIsolate(), root_index);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetNull() {
|
|
TYPE_CHECK(T, Primitive);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kNullValueRootIndex);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetUndefined() {
|
|
TYPE_CHECK(T, Primitive);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kUndefinedValueRootIndex);
|
|
}
|
|
|
|
template<typename T>
|
|
void ReturnValue<T>::SetEmptyString() {
|
|
TYPE_CHECK(T, String);
|
|
typedef internal::Internals I;
|
|
*value_ = *I::GetRoot(GetIsolate(), I::kEmptyStringRootIndex);
|
|
}
|
|
|
|
template <typename T>
|
|
Isolate* ReturnValue<T>::GetIsolate() const {
|
|
// Isolate is always the pointer below the default value on the stack.
|
|
return *reinterpret_cast<Isolate**>(&value_[-2]);
|
|
}
|
|
|
|
template <typename T>
|
|
Local<Value> ReturnValue<T>::Get() const {
|
|
typedef internal::Internals I;
|
|
if (*value_ == *I::GetRoot(GetIsolate(), I::kTheHoleValueRootIndex))
|
|
return Local<Value>(*Undefined(GetIsolate()));
|
|
return Local<Value>::New(GetIsolate(), reinterpret_cast<Value*>(value_));
|
|
}
|
|
|
|
template <typename T>
|
|
template <typename S>
|
|
void ReturnValue<T>::Set(S* whatever) {
|
|
// Uncompilable to prevent inadvertent misuse.
|
|
TYPE_CHECK(S*, Primitive);
|
|
}
|
|
|
|
template<typename T>
|
|
internal::Object* ReturnValue<T>::GetDefaultValue() {
|
|
// Default value is always the pointer below value_ on the stack.
|
|
return value_[-1];
|
|
}
|
|
|
|
template <typename T>
|
|
FunctionCallbackInfo<T>::FunctionCallbackInfo(internal::Object** implicit_args,
|
|
internal::Object** values,
|
|
int length)
|
|
: implicit_args_(implicit_args), values_(values), length_(length) {}
|
|
|
|
template<typename T>
|
|
Local<Value> FunctionCallbackInfo<T>::operator[](int i) const {
|
|
if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate()));
|
|
return Local<Value>(reinterpret_cast<Value*>(values_ - i));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Function> FunctionCallbackInfo<T>::Callee() const {
|
|
return Local<Function>(reinterpret_cast<Function*>(
|
|
&implicit_args_[kCalleeIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> FunctionCallbackInfo<T>::This() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(values_ + 1));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> FunctionCallbackInfo<T>::Holder() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(
|
|
&implicit_args_[kHolderIndex]));
|
|
}
|
|
|
|
template <typename T>
|
|
Local<Value> FunctionCallbackInfo<T>::NewTarget() const {
|
|
return Local<Value>(
|
|
reinterpret_cast<Value*>(&implicit_args_[kNewTargetIndex]));
|
|
}
|
|
|
|
template <typename T>
|
|
Local<Value> FunctionCallbackInfo<T>::Data() const {
|
|
return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Isolate* FunctionCallbackInfo<T>::GetIsolate() const {
|
|
return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T> FunctionCallbackInfo<T>::GetReturnValue() const {
|
|
return ReturnValue<T>(&implicit_args_[kReturnValueIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
bool FunctionCallbackInfo<T>::IsConstructCall() const {
|
|
return !NewTarget()->IsUndefined();
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
int FunctionCallbackInfo<T>::Length() const {
|
|
return length_;
|
|
}
|
|
|
|
ScriptOrigin::ScriptOrigin(Local<Value> resource_name,
|
|
Local<Integer> resource_line_offset,
|
|
Local<Integer> resource_column_offset,
|
|
Local<Boolean> resource_is_shared_cross_origin,
|
|
Local<Integer> script_id,
|
|
Local<Value> source_map_url,
|
|
Local<Boolean> resource_is_opaque,
|
|
Local<Boolean> is_wasm, Local<Boolean> is_module)
|
|
: resource_name_(resource_name),
|
|
resource_line_offset_(resource_line_offset),
|
|
resource_column_offset_(resource_column_offset),
|
|
options_(!resource_is_shared_cross_origin.IsEmpty() &&
|
|
resource_is_shared_cross_origin->IsTrue(),
|
|
!resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue(),
|
|
!is_wasm.IsEmpty() && is_wasm->IsTrue(),
|
|
!is_module.IsEmpty() && is_module->IsTrue()),
|
|
script_id_(script_id),
|
|
source_map_url_(source_map_url) {}
|
|
|
|
Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; }
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ResourceLineOffset() const {
|
|
return resource_line_offset_;
|
|
}
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ResourceColumnOffset() const {
|
|
return resource_column_offset_;
|
|
}
|
|
|
|
|
|
Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; }
|
|
|
|
|
|
Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; }
|
|
|
|
|
|
ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
|
|
CachedData* data)
|
|
: source_string(string),
|
|
resource_name(origin.ResourceName()),
|
|
resource_line_offset(origin.ResourceLineOffset()),
|
|
resource_column_offset(origin.ResourceColumnOffset()),
|
|
resource_options(origin.Options()),
|
|
source_map_url(origin.SourceMapUrl()),
|
|
cached_data(data) {}
|
|
|
|
|
|
ScriptCompiler::Source::Source(Local<String> string,
|
|
CachedData* data)
|
|
: source_string(string), cached_data(data) {}
|
|
|
|
|
|
ScriptCompiler::Source::~Source() {
|
|
delete cached_data;
|
|
}
|
|
|
|
|
|
const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData()
|
|
const {
|
|
return cached_data;
|
|
}
|
|
|
|
const ScriptOriginOptions& ScriptCompiler::Source::GetResourceOptions() const {
|
|
return resource_options;
|
|
}
|
|
|
|
Local<Boolean> Boolean::New(Isolate* isolate, bool value) {
|
|
return value ? True(isolate) : False(isolate);
|
|
}
|
|
|
|
void Template::Set(Isolate* isolate, const char* name, Local<Data> value) {
|
|
Set(String::NewFromUtf8(isolate, name, NewStringType::kInternalized)
|
|
.ToLocalChecked(),
|
|
value);
|
|
}
|
|
|
|
|
|
Local<Value> Object::GetInternalField(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::HeapObject HO;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O**>(this);
|
|
// Fast path: If the object is a plain JSObject, which is the common case, we
|
|
// know where to find the internal fields and can return the value directly.
|
|
auto instance_type = I::GetInstanceType(obj);
|
|
if (instance_type == I::kJSObjectType ||
|
|
instance_type == I::kJSApiObjectType) {
|
|
int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index);
|
|
O* value = I::ReadField<O*>(obj, offset);
|
|
O** result = HandleScope::CreateHandle(reinterpret_cast<HO*>(obj), value);
|
|
return Local<Value>(reinterpret_cast<Value*>(result));
|
|
}
|
|
#endif
|
|
return SlowGetInternalField(index);
|
|
}
|
|
|
|
|
|
void* Object::GetAlignedPointerFromInternalField(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O**>(this);
|
|
// Fast path: If the object is a plain JSObject, which is the common case, we
|
|
// know where to find the internal fields and can return the value directly.
|
|
auto instance_type = I::GetInstanceType(obj);
|
|
if (V8_LIKELY(instance_type == I::kJSObjectType ||
|
|
instance_type == I::kJSApiObjectType)) {
|
|
int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index);
|
|
return I::ReadField<void*>(obj, offset);
|
|
}
|
|
#endif
|
|
return SlowGetAlignedPointerFromInternalField(index);
|
|
}
|
|
|
|
String* String::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<String*>(value);
|
|
}
|
|
|
|
|
|
Local<String> String::Empty(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex);
|
|
return Local<String>(reinterpret_cast<String*>(slot));
|
|
}
|
|
|
|
|
|
String::ExternalStringResource* String::GetExternalStringResource() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
String::ExternalStringResource* result;
|
|
if (I::IsExternalTwoByteString(I::GetInstanceType(obj))) {
|
|
void* value = I::ReadField<void*>(obj, I::kStringResourceOffset);
|
|
result = reinterpret_cast<String::ExternalStringResource*>(value);
|
|
} else {
|
|
result = NULL;
|
|
}
|
|
#ifdef V8_ENABLE_CHECKS
|
|
VerifyExternalStringResource(result);
|
|
#endif
|
|
return result;
|
|
}
|
|
|
|
|
|
String::ExternalStringResourceBase* String::GetExternalStringResourceBase(
|
|
String::Encoding* encoding_out) const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
int type = I::GetInstanceType(obj) & I::kFullStringRepresentationMask;
|
|
*encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask);
|
|
ExternalStringResourceBase* resource = NULL;
|
|
if (type == I::kExternalOneByteRepresentationTag ||
|
|
type == I::kExternalTwoByteRepresentationTag) {
|
|
void* value = I::ReadField<void*>(obj, I::kStringResourceOffset);
|
|
resource = static_cast<ExternalStringResourceBase*>(value);
|
|
}
|
|
#ifdef V8_ENABLE_CHECKS
|
|
VerifyExternalStringResourceBase(resource, *encoding_out);
|
|
#endif
|
|
return resource;
|
|
}
|
|
|
|
|
|
bool Value::IsUndefined() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsUndefined();
|
|
#else
|
|
return QuickIsUndefined();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsUndefined() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
if (I::GetInstanceType(obj) != I::kOddballType) return false;
|
|
return (I::GetOddballKind(obj) == I::kUndefinedOddballKind);
|
|
}
|
|
|
|
|
|
bool Value::IsNull() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsNull();
|
|
#else
|
|
return QuickIsNull();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsNull() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
if (I::GetInstanceType(obj) != I::kOddballType) return false;
|
|
return (I::GetOddballKind(obj) == I::kNullOddballKind);
|
|
}
|
|
|
|
bool Value::IsNullOrUndefined() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsNull() || FullIsUndefined();
|
|
#else
|
|
return QuickIsNullOrUndefined();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsNullOrUndefined() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
if (I::GetInstanceType(obj) != I::kOddballType) return false;
|
|
int kind = I::GetOddballKind(obj);
|
|
return kind == I::kNullOddballKind || kind == I::kUndefinedOddballKind;
|
|
}
|
|
|
|
bool Value::IsString() const {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
return FullIsString();
|
|
#else
|
|
return QuickIsString();
|
|
#endif
|
|
}
|
|
|
|
bool Value::QuickIsString() const {
|
|
typedef internal::Object O;
|
|
typedef internal::Internals I;
|
|
O* obj = *reinterpret_cast<O* const*>(this);
|
|
if (!I::HasHeapObjectTag(obj)) return false;
|
|
return (I::GetInstanceType(obj) < I::kFirstNonstringType);
|
|
}
|
|
|
|
|
|
template <class T> Value* Value::Cast(T* value) {
|
|
return static_cast<Value*>(value);
|
|
}
|
|
|
|
|
|
Local<Boolean> Value::ToBoolean() const {
|
|
return ToBoolean(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Boolean>());
|
|
}
|
|
|
|
|
|
Local<Number> Value::ToNumber() const {
|
|
return ToNumber(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Number>());
|
|
}
|
|
|
|
|
|
Local<String> Value::ToString() const {
|
|
return ToString(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<String>());
|
|
}
|
|
|
|
|
|
Local<String> Value::ToDetailString() const {
|
|
return ToDetailString(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<String>());
|
|
}
|
|
|
|
|
|
Local<Object> Value::ToObject() const {
|
|
return ToObject(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Object>());
|
|
}
|
|
|
|
|
|
Local<Integer> Value::ToInteger() const {
|
|
return ToInteger(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Integer>());
|
|
}
|
|
|
|
|
|
Local<Uint32> Value::ToUint32() const {
|
|
return ToUint32(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Uint32>());
|
|
}
|
|
|
|
|
|
Local<Int32> Value::ToInt32() const {
|
|
return ToInt32(Isolate::GetCurrent()->GetCurrentContext())
|
|
.FromMaybe(Local<Int32>());
|
|
}
|
|
|
|
|
|
Boolean* Boolean::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Boolean*>(value);
|
|
}
|
|
|
|
|
|
Name* Name::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Name*>(value);
|
|
}
|
|
|
|
|
|
Symbol* Symbol::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Symbol*>(value);
|
|
}
|
|
|
|
|
|
Number* Number::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Number*>(value);
|
|
}
|
|
|
|
|
|
Integer* Integer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Integer*>(value);
|
|
}
|
|
|
|
|
|
Int32* Int32::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int32*>(value);
|
|
}
|
|
|
|
|
|
Uint32* Uint32::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint32*>(value);
|
|
}
|
|
|
|
|
|
Date* Date::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Date*>(value);
|
|
}
|
|
|
|
|
|
StringObject* StringObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<StringObject*>(value);
|
|
}
|
|
|
|
|
|
SymbolObject* SymbolObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<SymbolObject*>(value);
|
|
}
|
|
|
|
|
|
NumberObject* NumberObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<NumberObject*>(value);
|
|
}
|
|
|
|
|
|
BooleanObject* BooleanObject::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<BooleanObject*>(value);
|
|
}
|
|
|
|
|
|
RegExp* RegExp::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<RegExp*>(value);
|
|
}
|
|
|
|
|
|
Object* Object::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Object*>(value);
|
|
}
|
|
|
|
|
|
Array* Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Array*>(value);
|
|
}
|
|
|
|
|
|
Map* Map::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Map*>(value);
|
|
}
|
|
|
|
|
|
Set* Set::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Set*>(value);
|
|
}
|
|
|
|
|
|
Promise* Promise::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Promise*>(value);
|
|
}
|
|
|
|
|
|
Proxy* Proxy::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Proxy*>(value);
|
|
}
|
|
|
|
WasmCompiledModule* WasmCompiledModule::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<WasmCompiledModule*>(value);
|
|
}
|
|
|
|
Promise::Resolver* Promise::Resolver::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Promise::Resolver*>(value);
|
|
}
|
|
|
|
|
|
ArrayBuffer* ArrayBuffer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<ArrayBuffer*>(value);
|
|
}
|
|
|
|
|
|
ArrayBufferView* ArrayBufferView::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<ArrayBufferView*>(value);
|
|
}
|
|
|
|
|
|
TypedArray* TypedArray::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<TypedArray*>(value);
|
|
}
|
|
|
|
|
|
Uint8Array* Uint8Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint8Array*>(value);
|
|
}
|
|
|
|
|
|
Int8Array* Int8Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int8Array*>(value);
|
|
}
|
|
|
|
|
|
Uint16Array* Uint16Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint16Array*>(value);
|
|
}
|
|
|
|
|
|
Int16Array* Int16Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int16Array*>(value);
|
|
}
|
|
|
|
|
|
Uint32Array* Uint32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint32Array*>(value);
|
|
}
|
|
|
|
|
|
Int32Array* Int32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Int32Array*>(value);
|
|
}
|
|
|
|
|
|
Float32Array* Float32Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Float32Array*>(value);
|
|
}
|
|
|
|
|
|
Float64Array* Float64Array::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Float64Array*>(value);
|
|
}
|
|
|
|
|
|
Uint8ClampedArray* Uint8ClampedArray::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Uint8ClampedArray*>(value);
|
|
}
|
|
|
|
|
|
DataView* DataView::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<DataView*>(value);
|
|
}
|
|
|
|
|
|
SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<SharedArrayBuffer*>(value);
|
|
}
|
|
|
|
|
|
Function* Function::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<Function*>(value);
|
|
}
|
|
|
|
|
|
External* External::Cast(v8::Value* value) {
|
|
#ifdef V8_ENABLE_CHECKS
|
|
CheckCast(value);
|
|
#endif
|
|
return static_cast<External*>(value);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Isolate* PropertyCallbackInfo<T>::GetIsolate() const {
|
|
return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]);
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Value> PropertyCallbackInfo<T>::Data() const {
|
|
return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> PropertyCallbackInfo<T>::This() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
Local<Object> PropertyCallbackInfo<T>::Holder() const {
|
|
return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex]));
|
|
}
|
|
|
|
|
|
template<typename T>
|
|
ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const {
|
|
return ReturnValue<T>(&args_[kReturnValueIndex]);
|
|
}
|
|
|
|
template <typename T>
|
|
bool PropertyCallbackInfo<T>::ShouldThrowOnError() const {
|
|
typedef internal::Internals I;
|
|
return args_[kShouldThrowOnErrorIndex] != I::IntToSmi(0);
|
|
}
|
|
|
|
|
|
Local<Primitive> Undefined(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex);
|
|
return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
|
|
}
|
|
|
|
|
|
Local<Primitive> Null(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kNullValueRootIndex);
|
|
return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
|
|
}
|
|
|
|
|
|
Local<Boolean> True(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex);
|
|
return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
|
|
}
|
|
|
|
|
|
Local<Boolean> False(Isolate* isolate) {
|
|
typedef internal::Object* S;
|
|
typedef internal::Internals I;
|
|
I::CheckInitialized(isolate);
|
|
S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex);
|
|
return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
|
|
}
|
|
|
|
|
|
void Isolate::SetData(uint32_t slot, void* data) {
|
|
typedef internal::Internals I;
|
|
I::SetEmbedderData(this, slot, data);
|
|
}
|
|
|
|
|
|
void* Isolate::GetData(uint32_t slot) {
|
|
typedef internal::Internals I;
|
|
return I::GetEmbedderData(this, slot);
|
|
}
|
|
|
|
|
|
uint32_t Isolate::GetNumberOfDataSlots() {
|
|
typedef internal::Internals I;
|
|
return I::kNumIsolateDataSlots;
|
|
}
|
|
|
|
|
|
int64_t Isolate::AdjustAmountOfExternalAllocatedMemory(
|
|
int64_t change_in_bytes) {
|
|
typedef internal::Internals I;
|
|
int64_t* external_memory = reinterpret_cast<int64_t*>(
|
|
reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryOffset);
|
|
const int64_t external_memory_limit = *reinterpret_cast<int64_t*>(
|
|
reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryLimitOffset);
|
|
const int64_t amount = *external_memory + change_in_bytes;
|
|
*external_memory = amount;
|
|
if (change_in_bytes > 0 && amount > external_memory_limit) {
|
|
ReportExternalAllocationLimitReached();
|
|
}
|
|
return *external_memory;
|
|
}
|
|
|
|
Local<Value> Context::GetEmbedderData(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Object O;
|
|
typedef internal::HeapObject HO;
|
|
typedef internal::Internals I;
|
|
HO* context = *reinterpret_cast<HO**>(this);
|
|
O** result =
|
|
HandleScope::CreateHandle(context, I::ReadEmbedderData<O*>(this, index));
|
|
return Local<Value>(reinterpret_cast<Value*>(result));
|
|
#else
|
|
return SlowGetEmbedderData(index);
|
|
#endif
|
|
}
|
|
|
|
|
|
void* Context::GetAlignedPointerFromEmbedderData(int index) {
|
|
#ifndef V8_ENABLE_CHECKS
|
|
typedef internal::Internals I;
|
|
return I::ReadEmbedderData<void*>(this, index);
|
|
#else
|
|
return SlowGetAlignedPointerFromEmbedderData(index);
|
|
#endif
|
|
}
|
|
|
|
|
|
void V8::SetAllowCodeGenerationFromStringsCallback(
|
|
AllowCodeGenerationFromStringsCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetAllowCodeGenerationFromStringsCallback(callback);
|
|
}
|
|
|
|
|
|
bool V8::IsDead() {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
return isolate->IsDead();
|
|
}
|
|
|
|
|
|
bool V8::AddMessageListener(MessageCallback that, Local<Value> data) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
return isolate->AddMessageListener(that, data);
|
|
}
|
|
|
|
|
|
void V8::RemoveMessageListeners(MessageCallback that) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveMessageListeners(that);
|
|
}
|
|
|
|
|
|
void V8::SetFailedAccessCheckCallbackFunction(
|
|
FailedAccessCheckCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetFailedAccessCheckCallbackFunction(callback);
|
|
}
|
|
|
|
|
|
void V8::SetCaptureStackTraceForUncaughtExceptions(
|
|
bool capture, int frame_limit, StackTrace::StackTraceOptions options) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetCaptureStackTraceForUncaughtExceptions(capture, frame_limit,
|
|
options);
|
|
}
|
|
|
|
|
|
void V8::SetFatalErrorHandler(FatalErrorCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->SetFatalErrorHandler(callback);
|
|
}
|
|
|
|
void V8::RemoveGCPrologueCallback(GCCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveGCPrologueCallback(
|
|
reinterpret_cast<Isolate::GCCallback>(callback));
|
|
}
|
|
|
|
|
|
void V8::RemoveGCEpilogueCallback(GCCallback callback) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->RemoveGCEpilogueCallback(
|
|
reinterpret_cast<Isolate::GCCallback>(callback));
|
|
}
|
|
|
|
void V8::TerminateExecution(Isolate* isolate) { isolate->TerminateExecution(); }
|
|
|
|
|
|
bool V8::IsExecutionTerminating(Isolate* isolate) {
|
|
if (isolate == NULL) {
|
|
isolate = Isolate::GetCurrent();
|
|
}
|
|
return isolate->IsExecutionTerminating();
|
|
}
|
|
|
|
|
|
void V8::CancelTerminateExecution(Isolate* isolate) {
|
|
isolate->CancelTerminateExecution();
|
|
}
|
|
|
|
|
|
void V8::VisitExternalResources(ExternalResourceVisitor* visitor) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->VisitExternalResources(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesWithClassIds(PersistentHandleVisitor* visitor) {
|
|
Isolate* isolate = Isolate::GetCurrent();
|
|
isolate->VisitHandlesWithClassIds(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesWithClassIds(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor) {
|
|
isolate->VisitHandlesWithClassIds(visitor);
|
|
}
|
|
|
|
|
|
void V8::VisitHandlesForPartialDependence(Isolate* isolate,
|
|
PersistentHandleVisitor* visitor) {
|
|
isolate->VisitHandlesForPartialDependence(visitor);
|
|
}
|
|
|
|
/**
|
|
* \example shell.cc
|
|
* A simple shell that takes a list of expressions on the
|
|
* command-line and executes them.
|
|
*/
|
|
|
|
|
|
/**
|
|
* \example process.cc
|
|
*/
|
|
|
|
|
|
} // namespace v8
|
|
|
|
|
|
#undef TYPE_CHECK
|
|
|
|
|
|
#endif // INCLUDE_V8_H_
|